- Name
- Acetamide
- InChI
- InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4)
- InChI Key
- DLFVBJFMPXGRIB-UHFFFAOYSA-N
- Formula
- C2H5NO
- SMILES
- CC(N)=O
- Mol. Weight (g/mol)
- 59.07
- CAS
- 60-35-5
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Acetamide (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetamide (1) - Liquid |
|---|---|
| 278.15 | 0.3087 |
| 283.15 | 0.3424 |
| 288.15 | 0.3709 |
| 293.15 | 0.4017 |
| 298.15 | 0.4431 |
| 303.15 | 0.4775 |
| 308.15 | 0.5149 |
| 313.15 | 0.5563 |
| 318.15 | 0.5913 |
| 323.15 | 0.6308 |
| 328.15 | 0.6773 |
| 333.15 | 0.7213 |
Mole fraction of Acetamide (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Acetamide (1) - Liquid |
|---|---|
| 278.15 | 0.3087 |
| 283.15 | 0.3424 |
| 288.15 | 0.3709 |
| 293.15 | 0.4017 |
| 298.15 | 0.4431 |
| 303.15 | 0.4775 |
| 308.15 | 0.5149 |
| 313.15 | 0.5563 |
| 318.15 | 0.5913 |
| 323.15 | 0.6308 |
| 328.15 | 0.6773 |
| 333.15 | 0.7213 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 293.15 | 0.5999 | 0.2736 | 0.0060 |
| 293.15 | 0.7962 | 0.3608 | 0.0099 |
| 293.15 | 1.0007 | 0.4507 | 0.0170 |
| 293.15 | 1.1989 | 0.5367 | 0.0210 |
| 293.15 | 1.3991 | 0.6225 | 0.0254 |
| 293.15 | 1.5981 | 0.7068 | 0.0308 |
| 293.15 | 1.7995 | 0.7911 | 0.0377 |
| 293.15 | 1.9988 | 0.8735 | 0.0437 |
| 293.15 | 2.5014 | 1.0771 | 0.0581 |
| 293.15 | 2.9965 | 1.2718 | 0.0786 |
| 298.15 | 0.5918 | 0.2880 | 0.0058 |
| 298.15 | 0.7999 | 0.3952 | 0.0097 |
| 298.15 | 0.9989 | 0.4804 | 0.0130 |
| 298.15 | 1.125 | 0.5391 | 0.0180 |
| 298.15 | 1.397 | 0.6643 | 0.0232 |
| 298.15 | 1.5921 | 0.7528 | 0.0282 |
| 298.15 | 1.7916 | 0.8423 | 0.0340 |
| 298.15 | 2.0111 | 0.9603 | 0.0371 |
| 298.15 | 2.5037 | 1.1794 | 0.0515 |
| 298.15 | 2.9987 | 1.3633 | 0.0676 |
| 303.15 | 0.6059 | 0.3010 | 0.0039 |
| 303.15 | 0.7961 | 0.3933 | 0.0041 |
| 303.15 | 1.0029 | 0.4925 | 0.0078 |
| 303.15 | 1.2102 | 0.5909 | 0.0137 |
| 303.15 | 1.4056 | 0.6825 | 0.0163 |
| 303.15 | 1.6008 | 0.7731 | 0.0233 |
| 303.15 | 1.8035 | 0.8661 | 0.0275 |
| 303.15 | 1.9943 | 0.9527 | 0.0334 |
| 303.15 | 2.4947 | 1.1755 | 0.0485 |
| 303.15 | 3.0017 | 1.3951 | 0.0623 |
| 308.15 | 0.6000 | 0.2736 | 0.0010 |
| 308.15 | 0.8030 | 0.3639 | 0.0022 |
| 308.15 | 1.0024 | 0.4514 | 0.0058 |
| 308.15 | 1.1976 | 0.5362 | 0.0107 |
| 308.15 | 1.4047 | 0.6249 | 0.0166 |
| 308.15 | 1.5989 | 0.7072 | 0.0208 |
| 308.15 | 1.7975 | 0.7903 | 0.0286 |
| 308.15 | 1.9813 | 0.8663 | 0.0311 |
| 308.15 | 2.5006 | 1.0767 | 0.0456 |
| 308.15 | 3.0107 | 1.2773 | 0.0600 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 0.1000 | 0.0507 | -0.0035 |
| 0.1500 | 0.0760 | -0.0037 |
| 0.1800 | 0.0912 | -0.0039 |
| 0.2000 | 0.1013 | -0.0040 |
| 0.2200 | 0.1114 | -0.0041 |
| 0.2500 | 0.1265 | -0.0043 |
| 0.2800 | 0.1416 | -0.0045 |
| 0.3000 | 0.1517 | -0.0046 |
| 0.3200 | 0.1617 | -0.0048 |
| 0.3500 | 0.1768 | -0.0051 |
| 0.3800 | 0.1919 | -0.0053 |
| 0.4000 | 0.2019 | -0.0055 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | ||
|---|---|---|---|
| Temperature, K - Liquid | Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 293.15 | 0.5999 | 0.2736 | 0.0060 |
| 293.15 | 0.7962 | 0.3608 | 0.0099 |
| 293.15 | 1.0007 | 0.4507 | 0.0170 |
| 293.15 | 1.1989 | 0.5367 | 0.0210 |
| 293.15 | 1.3991 | 0.6225 | 0.0254 |
| 293.15 | 1.5981 | 0.7068 | 0.0308 |
| 293.15 | 1.7995 | 0.7911 | 0.0377 |
| 293.15 | 1.9988 | 0.8735 | 0.0437 |
| 293.15 | 2.5014 | 1.0771 | 0.0581 |
| 293.15 | 2.9965 | 1.2718 | 0.0786 |
| 298.15 | 0.5918 | 0.2880 | 0.0058 |
| 298.15 | 0.7999 | 0.3952 | 0.0097 |
| 298.15 | 0.9989 | 0.4804 | 0.0130 |
| 298.15 | 1.125 | 0.5391 | 0.0180 |
| 298.15 | 1.397 | 0.6643 | 0.0232 |
| 298.15 | 1.5921 | 0.7528 | 0.0282 |
| 298.15 | 1.7916 | 0.8423 | 0.0340 |
| 298.15 | 2.0111 | 0.9603 | 0.0371 |
| 298.15 | 2.5037 | 1.1794 | 0.0515 |
| 298.15 | 2.9987 | 1.3633 | 0.0676 |
| 303.15 | 0.6059 | 0.3010 | 0.0039 |
| 303.15 | 0.7961 | 0.3933 | 0.0041 |
| 303.15 | 1.0029 | 0.4925 | 0.0078 |
| 303.15 | 1.2102 | 0.5909 | 0.0137 |
| 303.15 | 1.4056 | 0.6825 | 0.0163 |
| 303.15 | 1.6008 | 0.7731 | 0.0233 |
| 303.15 | 1.8035 | 0.8661 | 0.0275 |
| 303.15 | 1.9943 | 0.9527 | 0.0334 |
| 303.15 | 2.4947 | 1.1755 | 0.0485 |
| 303.15 | 3.0017 | 1.3951 | 0.0623 |
| 308.15 | 0.6000 | 0.2736 | 0.0010 |
| 308.15 | 0.8030 | 0.3639 | 0.0022 |
| 308.15 | 1.0024 | 0.4514 | 0.0058 |
| 308.15 | 1.1976 | 0.5362 | 0.0107 |
| 308.15 | 1.4047 | 0.6249 | 0.0166 |
| 308.15 | 1.5989 | 0.7072 | 0.0208 |
| 308.15 | 1.7975 | 0.7903 | 0.0286 |
| 308.15 | 1.9813 | 0.8663 | 0.0311 |
| 308.15 | 2.5006 | 1.0767 | 0.0456 |
| 308.15 | 3.0107 | 1.2773 | 0.0600 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Initial molality of solute, mol/kg - Liquid | Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
| 0.1000 | 0.0507 | -0.0035 |
| 0.1500 | 0.0760 | -0.0037 |
| 0.1800 | 0.0912 | -0.0039 |
| 0.2000 | 0.1013 | -0.0040 |
| 0.2200 | 0.1114 | -0.0041 |
| 0.2500 | 0.1265 | -0.0043 |
| 0.2800 | 0.1416 | -0.0045 |
| 0.3000 | 0.1517 | -0.0046 |
| 0.3200 | 0.1617 | -0.0048 |
| 0.3500 | 0.1768 | -0.0051 |
| 0.3800 | 0.1919 | -0.0053 |
| 0.4000 | 0.2019 | -0.0055 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Acetamide (1) - Liquid | Mass density, kg/m3 - Liquid |
| 275.66 | 0.1020 | 1000.473 |
| 275.66 | 0.2015 | 1000.955 |
| 275.66 | 0.2995 | 1001.416 |
| 275.66 | 0.4032 | 1001.902 |
| 275.66 | 0.4848 | 1002.29 |
| 275.66 | 0.5945 | 1002.811 |
| 275.66 | 0.6875 | 1003.243 |
| 275.66 | 0.7747 | 1003.644 |
| 276.14 | 0.0968 | 1000.432 |
| 276.14 | 0.2023 | 1000.928 |
| 276.14 | 0.3049 | 1001.423 |
| 276.14 | 0.4077 | 1001.906 |
| 276.14 | 0.5003 | 1002.345 |
| 276.14 | 0.6016 | 1002.823 |
| 276.14 | 0.7037 | 1003.303 |
| 276.14 | 0.8092 | 1003.786 |
| 276.61 | 0.1016 | 1000.37 |
| 276.61 | 0.1972 | 1000.905 |
| 276.61 | 0.2990 | 1001.387 |
| 276.61 | 0.4078 | 1001.903 |
| 276.61 | 0.4957 | 1002.321 |
| 276.61 | 0.6048 | 1002.826 |
| 276.61 | 0.6858 | 1003.208 |
| 276.61 | 0.8092 | 1003.782 |
| 277.15 | 0.0968 | 1000.432 |
| 277.15 | 0.2023 | 1000.928 |
| 277.15 | 0.3049 | 1001.409 |
| 277.15 | 0.4077 | 1001.884 |
| 277.15 | 0.5003 | 1002.32 |
| 277.15 | 0.6016 | 1002.796 |
| 277.15 | 0.7037 | 1003.278 |
| 277.15 | 0.8092 | 1003.774 |
| 277.61 | 0.1016 | 1000.447 |
| 277.61 | 0.1972 | 1000.907 |
| 277.61 | 0.2990 | 1001.383 |
| 277.61 | 0.4078 | 1001.888 |
| 277.61 | 0.4957 | 1002.289 |
| 277.61 | 0.6048 | 1002.793 |
| 277.61 | 0.6858 | 1003.163 |
| 277.61 | 0.8092 | 1003.734 |
| 278.12 | 0.1016 | 1000.435 |
| 278.12 | 0.1972 | 1000.881 |
| 278.12 | 0.2990 | 1001.353 |
| 278.12 | 0.4078 | 1001.854 |
| 278.12 | 0.4957 | 1002.266 |
| 278.12 | 0.6048 | 1002.771 |
| 278.12 | 0.6858 | 1003.147 |
| 278.12 | 0.8092 | 1003.73 |
| 278.68 | 0.1020 | 1000.431 |
| 278.68 | 0.2015 | 1000.9 |
| 278.68 | 0.2995 | 1001.357 |
| 278.68 | 0.4032 | 1001.828 |
| 278.68 | 0.4848 | 1002.206 |
| 278.68 | 0.5945 | 1002.695 |
| 278.68 | 0.6875 | 1003.117 |
| 278.68 | 0.7747 | 1003.511 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 75 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Acetamide (1) - Liquid | Mass density, kg/m3 - Liquid |
| 275.66 | 0.1020 | 1000.473 |
| 275.66 | 0.2015 | 1000.955 |
| 275.66 | 0.2995 | 1001.416 |
| 275.66 | 0.4032 | 1001.902 |
| 275.66 | 0.4848 | 1002.29 |
| 275.66 | 0.5945 | 1002.811 |
| 275.66 | 0.6875 | 1003.243 |
| 275.66 | 0.7747 | 1003.644 |
| 276.14 | 0.0968 | 1000.432 |
| 276.14 | 0.2023 | 1000.928 |
| 276.14 | 0.3049 | 1001.423 |
| 276.14 | 0.4077 | 1001.906 |
| 276.14 | 0.5003 | 1002.345 |
| 276.14 | 0.6016 | 1002.823 |
| 276.14 | 0.7037 | 1003.303 |
| 276.14 | 0.8092 | 1003.786 |
| 276.61 | 0.1016 | 1000.37 |
| 276.61 | 0.1972 | 1000.905 |
| 276.61 | 0.2990 | 1001.387 |
| 276.61 | 0.4078 | 1001.903 |
| 276.61 | 0.4957 | 1002.321 |
| 276.61 | 0.6048 | 1002.826 |
| 276.61 | 0.6858 | 1003.208 |
| 276.61 | 0.8092 | 1003.782 |
| 277.15 | 0.0968 | 1000.432 |
| 277.15 | 0.2023 | 1000.928 |
| 277.15 | 0.3049 | 1001.409 |
| 277.15 | 0.4077 | 1001.884 |
| 277.15 | 0.5003 | 1002.32 |
| 277.15 | 0.6016 | 1002.796 |
| 277.15 | 0.7037 | 1003.278 |
| 277.15 | 0.8092 | 1003.774 |
| 277.61 | 0.1016 | 1000.447 |
| 277.61 | 0.1972 | 1000.907 |
| 277.61 | 0.2990 | 1001.383 |
| 277.61 | 0.4078 | 1001.888 |
| 277.61 | 0.4957 | 1002.289 |
| 277.61 | 0.6048 | 1002.793 |
| 277.61 | 0.6858 | 1003.163 |
| 277.61 | 0.8092 | 1003.734 |
| 278.12 | 0.1016 | 1000.435 |
| 278.12 | 0.1972 | 1000.881 |
| 278.12 | 0.2990 | 1001.353 |
| 278.12 | 0.4078 | 1001.854 |
| 278.12 | 0.4957 | 1002.266 |
| 278.12 | 0.6048 | 1002.771 |
| 278.12 | 0.6858 | 1003.147 |
| 278.12 | 0.8092 | 1003.73 |
| 278.68 | 0.1020 | 1000.431 |
| 278.68 | 0.2015 | 1000.9 |
| 278.68 | 0.2995 | 1001.357 |
| 278.68 | 0.4032 | 1001.828 |
| 278.68 | 0.4848 | 1002.206 |
| 278.68 | 0.5945 | 1002.695 |
| 278.68 | 0.6875 | 1003.117 |
| 278.68 | 0.7747 | 1003.511 |
Sources
- Influence of aliphatic amides on the temperature of maximum density of water
- Enthalpy of dilution of aliphatic amides in aqueous solutions at temperatures between 293.15K and 308.15K
- Enthalpies of Dilution of Acetamide and N,N-Dimethylformamide in Aqueous Sodium Chloride Solutions at 298.15 K
- Solubility of Acetamide, Propionamide, and Butyramide in Water at Temperatures between (278.15 and 333.15) K