- Name
- Benzene, ethoxy-
- InChI
- InChI=1S/C8H10O/c1-2-9-8-6-4-3-5-7-8/h3-7H,2H2,1H3
- InChI Key
- DLRJIFUOBPOJNS-UHFFFAOYSA-N
- Formula
- C8H10O
- SMILES
- CCOc1ccccc1
- Mol. Weight (g/mol)
- 122.16
- CAS
- 103-73-1
- Name
- Formamide, N,N-dimethyl-
- InChI
- InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3
- InChI Key
- ZMXDDKWLCZADIW-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CN(C)C=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 68-12-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.00 | 0.0000 | 1.429 |
| 298.00 | 0.0310 | 1.431 |
| 298.00 | 0.0910 | 1.437 |
| 298.00 | 0.1530 | 1.442 |
| 298.00 | 0.2230 | 1.448 |
| 298.00 | 0.3040 | 1.455 |
| 298.00 | 0.4630 | 1.468 |
| 298.00 | 0.5560 | 1.475 |
| 298.00 | 0.6420 | 1.481 |
| 298.00 | 0.8000 | 1.493 |
| 298.00 | 1.0000 | 1.505 |
| 303.00 | 0.0000 | 1.427 |
| 303.00 | 0.0310 | 1.43 |
| 303.00 | 0.0910 | 1.435 |
| 303.00 | 0.1530 | 1.44 |
| 303.00 | 0.2230 | 1.446 |
| 303.00 | 0.3040 | 1.452 |
| 303.00 | 0.4630 | 1.465 |
| 303.00 | 0.5560 | 1.471 |
| 303.00 | 0.6420 | 1.478 |
| 303.00 | 0.8000 | 1.489 |
| 303.00 | 1.0000 | 1.503 |
| 308.00 | 0.0000 | 1.425 |
| 308.00 | 0.0310 | 1.427 |
| 308.00 | 0.0910 | 1.432 |
| 308.00 | 0.1530 | 1.437 |
| 308.00 | 0.2230 | 1.442 |
| 308.00 | 0.3040 | 1.449 |
| 308.00 | 0.4630 | 1.461 |
| 308.00 | 0.5560 | 1.468 |
| 308.00 | 0.6420 | 1.474 |
| 308.00 | 0.8000 | 1.485 |
| 308.00 | 1.0000 | 1.499 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.00 | 0.0000 | 1.429 |
| 298.00 | 0.0310 | 1.431 |
| 298.00 | 0.0910 | 1.437 |
| 298.00 | 0.1530 | 1.442 |
| 298.00 | 0.2230 | 1.448 |
| 298.00 | 0.3040 | 1.455 |
| 298.00 | 0.4630 | 1.468 |
| 298.00 | 0.5560 | 1.475 |
| 298.00 | 0.6420 | 1.481 |
| 298.00 | 0.8000 | 1.493 |
| 298.00 | 1.0000 | 1.505 |
| 303.00 | 0.0000 | 1.427 |
| 303.00 | 0.0310 | 1.43 |
| 303.00 | 0.0910 | 1.435 |
| 303.00 | 0.1530 | 1.44 |
| 303.00 | 0.2230 | 1.446 |
| 303.00 | 0.3040 | 1.452 |
| 303.00 | 0.4630 | 1.465 |
| 303.00 | 0.5560 | 1.471 |
| 303.00 | 0.6420 | 1.478 |
| 303.00 | 0.8000 | 1.489 |
| 303.00 | 1.0000 | 1.503 |
| 308.00 | 0.0000 | 1.425 |
| 308.00 | 0.0310 | 1.427 |
| 308.00 | 0.0910 | 1.432 |
| 308.00 | 0.1530 | 1.437 |
| 308.00 | 0.2230 | 1.442 |
| 308.00 | 0.3040 | 1.449 |
| 308.00 | 0.4630 | 1.461 |
| 308.00 | 0.5560 | 1.468 |
| 308.00 | 0.6420 | 1.474 |
| 308.00 | 0.8000 | 1.485 |
| 308.00 | 1.0000 | 1.499 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.00 | 0.0000 | 944.0 |
| 298.00 | 0.0310 | 946.0 |
| 298.00 | 0.0910 | 948.0 |
| 298.00 | 0.1530 | 950.0 |
| 298.00 | 0.2230 | 952.0 |
| 298.00 | 0.3040 | 954.0 |
| 298.00 | 0.4630 | 956.0 |
| 298.00 | 0.5560 | 957.0 |
| 298.00 | 0.6420 | 958.0 |
| 298.00 | 0.8000 | 959.0 |
| 298.00 | 1.0000 | 960.0 |
| 303.00 | 0.0000 | 939.0 |
| 303.00 | 0.0310 | 941.0 |
| 303.00 | 0.0910 | 943.0 |
| 303.00 | 0.1530 | 945.0 |
| 303.00 | 0.2230 | 947.0 |
| 303.00 | 0.3040 | 949.0 |
| 303.00 | 0.4630 | 952.0 |
| 303.00 | 0.5560 | 953.0 |
| 303.00 | 0.6420 | 954.0 |
| 303.00 | 0.8000 | 955.0 |
| 303.00 | 1.0000 | 955.0 |
| 308.00 | 0.0000 | 935.0 |
| 308.00 | 0.0310 | 936.0 |
| 308.00 | 0.0910 | 939.0 |
| 308.00 | 0.1530 | 941.0 |
| 308.00 | 0.2230 | 943.0 |
| 308.00 | 0.3040 | 945.0 |
| 308.00 | 0.4630 | 948.0 |
| 308.00 | 0.5560 | 949.0 |
| 308.00 | 0.6420 | 949.0 |
| 308.00 | 0.8000 | 950.0 |
| 308.00 | 1.0000 | 951.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.00 | 0.0000 | 944.0 |
| 298.00 | 0.0310 | 946.0 |
| 298.00 | 0.0910 | 948.0 |
| 298.00 | 0.1530 | 950.0 |
| 298.00 | 0.2230 | 952.0 |
| 298.00 | 0.3040 | 954.0 |
| 298.00 | 0.4630 | 956.0 |
| 298.00 | 0.5560 | 957.0 |
| 298.00 | 0.6420 | 958.0 |
| 298.00 | 0.8000 | 959.0 |
| 298.00 | 1.0000 | 960.0 |
| 303.00 | 0.0000 | 939.0 |
| 303.00 | 0.0310 | 941.0 |
| 303.00 | 0.0910 | 943.0 |
| 303.00 | 0.1530 | 945.0 |
| 303.00 | 0.2230 | 947.0 |
| 303.00 | 0.3040 | 949.0 |
| 303.00 | 0.4630 | 952.0 |
| 303.00 | 0.5560 | 953.0 |
| 303.00 | 0.6420 | 954.0 |
| 303.00 | 0.8000 | 955.0 |
| 303.00 | 1.0000 | 955.0 |
| 308.00 | 0.0000 | 935.0 |
| 308.00 | 0.0310 | 936.0 |
| 308.00 | 0.0910 | 939.0 |
| 308.00 | 0.1530 | 941.0 |
| 308.00 | 0.2230 | 943.0 |
| 308.00 | 0.3040 | 945.0 |
| 308.00 | 0.4630 | 948.0 |
| 308.00 | 0.5560 | 949.0 |
| 308.00 | 0.6420 | 949.0 |
| 308.00 | 0.8000 | 950.0 |
| 308.00 | 1.0000 | 951.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.00 | 0.0000 | 1457.0 |
| 298.00 | 0.0310 | 1452.0 |
| 298.00 | 0.0910 | 1443.0 |
| 298.00 | 0.1530 | 1435.0 |
| 298.00 | 0.2230 | 1427.0 |
| 298.00 | 0.3040 | 1418.0 |
| 298.00 | 0.4630 | 1403.0 |
| 298.00 | 0.5560 | 1396.0 |
| 298.00 | 0.6420 | 1390.0 |
| 298.00 | 0.8000 | 1379.0 |
| 298.00 | 1.0000 | 1369.0 |
| 303.00 | 0.0000 | 1437.0 |
| 303.00 | 0.0310 | 1432.0 |
| 303.00 | 0.0910 | 1424.0 |
| 303.00 | 0.1530 | 1415.0 |
| 303.00 | 0.2230 | 1407.0 |
| 303.00 | 0.3040 | 1398.0 |
| 303.00 | 0.4630 | 1383.0 |
| 303.00 | 0.5560 | 1376.0 |
| 303.00 | 0.6420 | 1370.0 |
| 303.00 | 0.8000 | 1360.0 |
| 303.00 | 1.0000 | 1349.0 |
| 308.00 | 0.0000 | 1420.0 |
| 308.00 | 0.0310 | 1415.0 |
| 308.00 | 0.0910 | 1406.0 |
| 308.00 | 0.1530 | 1398.0 |
| 308.00 | 0.2230 | 1389.0 |
| 308.00 | 0.3040 | 1380.0 |
| 308.00 | 0.4630 | 1365.0 |
| 308.00 | 0.5560 | 1357.0 |
| 308.00 | 0.6420 | 1350.0 |
| 308.00 | 0.8000 | 1340.0 |
| 308.00 | 1.0000 | 1329.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.00 | 0.0000 | 1457.0 |
| 298.00 | 0.0310 | 1452.0 |
| 298.00 | 0.0910 | 1443.0 |
| 298.00 | 0.1530 | 1435.0 |
| 298.00 | 0.2230 | 1427.0 |
| 298.00 | 0.3040 | 1418.0 |
| 298.00 | 0.4630 | 1403.0 |
| 298.00 | 0.5560 | 1396.0 |
| 298.00 | 0.6420 | 1390.0 |
| 298.00 | 0.8000 | 1379.0 |
| 298.00 | 1.0000 | 1369.0 |
| 303.00 | 0.0000 | 1437.0 |
| 303.00 | 0.0310 | 1432.0 |
| 303.00 | 0.0910 | 1424.0 |
| 303.00 | 0.1530 | 1415.0 |
| 303.00 | 0.2230 | 1407.0 |
| 303.00 | 0.3040 | 1398.0 |
| 303.00 | 0.4630 | 1383.0 |
| 303.00 | 0.5560 | 1376.0 |
| 303.00 | 0.6420 | 1370.0 |
| 303.00 | 0.8000 | 1360.0 |
| 303.00 | 1.0000 | 1349.0 |
| 308.00 | 0.0000 | 1420.0 |
| 308.00 | 0.0310 | 1415.0 |
| 308.00 | 0.0910 | 1406.0 |
| 308.00 | 0.1530 | 1398.0 |
| 308.00 | 0.2230 | 1389.0 |
| 308.00 | 0.3040 | 1380.0 |
| 308.00 | 0.4630 | 1365.0 |
| 308.00 | 0.5560 | 1357.0 |
| 308.00 | 0.6420 | 1350.0 |
| 308.00 | 0.8000 | 1340.0 |
| 308.00 | 1.0000 | 1329.0 |