- Name
- Benzene, ethoxy-
- InChI
- InChI=1S/C8H10O/c1-2-9-8-6-4-3-5-7-8/h3-7H,2H2,1H3
- InChI Key
- DLRJIFUOBPOJNS-UHFFFAOYSA-N
- Formula
- C8H10O
- SMILES
- CCOc1ccccc1
- Mol. Weight (g/mol)
- 122.16
- CAS
- 103-73-1
- Name
- 2-Pyrrolidinone, 1-methyl-
- InChI
- InChI=1S/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3
- InChI Key
- SECXISVLQFMRJM-UHFFFAOYSA-N
- Formula
- C5H9NO
- SMILES
- CN1CCCC1=O
- Mol. Weight (g/mol)
- 99.13
- CAS
- 872-50-4
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.00 | 0.0000 | 1.467 |
| 298.00 | 0.0410 | 1.469 |
| 298.00 | 0.1220 | 1.474 |
| 298.00 | 0.2010 | 1.478 |
| 298.00 | 0.2730 | 1.481 |
| 298.00 | 0.3700 | 1.485 |
| 298.00 | 0.5040 | 1.491 |
| 298.00 | 0.6280 | 1.495 |
| 298.00 | 0.7090 | 1.498 |
| 298.00 | 0.8220 | 1.501 |
| 298.00 | 1.0000 | 1.505 |
| 303.00 | 0.0000 | 1.466 |
| 303.00 | 0.0410 | 1.468 |
| 303.00 | 0.1220 | 1.472 |
| 303.00 | 0.2010 | 1.475 |
| 303.00 | 0.2730 | 1.479 |
| 303.00 | 0.3700 | 1.483 |
| 303.00 | 0.5040 | 1.488 |
| 303.00 | 0.6280 | 1.492 |
| 303.00 | 0.7090 | 1.495 |
| 303.00 | 0.8220 | 1.498 |
| 303.00 | 1.0000 | 1.503 |
| 308.00 | 0.0000 | 1.464 |
| 308.00 | 0.0410 | 1.466 |
| 308.00 | 0.1220 | 1.469 |
| 308.00 | 0.2010 | 1.473 |
| 308.00 | 0.2730 | 1.476 |
| 308.00 | 0.3700 | 1.48 |
| 308.00 | 0.5040 | 1.485 |
| 308.00 | 0.6280 | 1.489 |
| 308.00 | 0.7090 | 1.491 |
| 308.00 | 0.8220 | 1.495 |
| 308.00 | 1.0000 | 1.499 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.00 | 0.0000 | 1.467 |
| 298.00 | 0.0410 | 1.469 |
| 298.00 | 0.1220 | 1.474 |
| 298.00 | 0.2010 | 1.478 |
| 298.00 | 0.2730 | 1.481 |
| 298.00 | 0.3700 | 1.485 |
| 298.00 | 0.5040 | 1.491 |
| 298.00 | 0.6280 | 1.495 |
| 298.00 | 0.7090 | 1.498 |
| 298.00 | 0.8220 | 1.501 |
| 298.00 | 1.0000 | 1.505 |
| 303.00 | 0.0000 | 1.466 |
| 303.00 | 0.0410 | 1.468 |
| 303.00 | 0.1220 | 1.472 |
| 303.00 | 0.2010 | 1.475 |
| 303.00 | 0.2730 | 1.479 |
| 303.00 | 0.3700 | 1.483 |
| 303.00 | 0.5040 | 1.488 |
| 303.00 | 0.6280 | 1.492 |
| 303.00 | 0.7090 | 1.495 |
| 303.00 | 0.8220 | 1.498 |
| 303.00 | 1.0000 | 1.503 |
| 308.00 | 0.0000 | 1.464 |
| 308.00 | 0.0410 | 1.466 |
| 308.00 | 0.1220 | 1.469 |
| 308.00 | 0.2010 | 1.473 |
| 308.00 | 0.2730 | 1.476 |
| 308.00 | 0.3700 | 1.48 |
| 308.00 | 0.5040 | 1.485 |
| 308.00 | 0.6280 | 1.489 |
| 308.00 | 0.7090 | 1.491 |
| 308.00 | 0.8220 | 1.495 |
| 308.00 | 1.0000 | 1.499 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.00 | 0.0000 | 1026.0 |
| 298.00 | 0.0410 | 1023.0 |
| 298.00 | 0.1220 | 1018.0 |
| 298.00 | 0.2010 | 1013.0 |
| 298.00 | 0.2730 | 1008.0 |
| 298.00 | 0.3700 | 1001.0 |
| 298.00 | 0.5040 | 992.0 |
| 298.00 | 0.6280 | 983.0 |
| 298.00 | 0.7090 | 978.0 |
| 298.00 | 0.8220 | 971.0 |
| 298.00 | 1.0000 | 960.0 |
| 303.00 | 0.0000 | 1022.0 |
| 303.00 | 0.0410 | 1019.0 |
| 303.00 | 0.1220 | 1014.0 |
| 303.00 | 0.2010 | 1009.0 |
| 303.00 | 0.2730 | 1004.0 |
| 303.00 | 0.3700 | 997.0 |
| 303.00 | 0.5040 | 988.0 |
| 303.00 | 0.6280 | 979.0 |
| 303.00 | 0.7090 | 974.0 |
| 303.00 | 0.8220 | 966.0 |
| 303.00 | 1.0000 | 955.0 |
| 308.00 | 0.0000 | 1018.0 |
| 308.00 | 0.0410 | 1015.0 |
| 308.00 | 0.1220 | 1010.0 |
| 308.00 | 0.2010 | 1005.0 |
| 308.00 | 0.2730 | 1000.0 |
| 308.00 | 0.3700 | 993.0 |
| 308.00 | 0.5040 | 983.0 |
| 308.00 | 0.6280 | 975.0 |
| 308.00 | 0.7090 | 969.0 |
| 308.00 | 0.8220 | 962.0 |
| 308.00 | 1.0000 | 951.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.00 | 0.0000 | 1026.0 |
| 298.00 | 0.0410 | 1023.0 |
| 298.00 | 0.1220 | 1018.0 |
| 298.00 | 0.2010 | 1013.0 |
| 298.00 | 0.2730 | 1008.0 |
| 298.00 | 0.3700 | 1001.0 |
| 298.00 | 0.5040 | 992.0 |
| 298.00 | 0.6280 | 983.0 |
| 298.00 | 0.7090 | 978.0 |
| 298.00 | 0.8220 | 971.0 |
| 298.00 | 1.0000 | 960.0 |
| 303.00 | 0.0000 | 1022.0 |
| 303.00 | 0.0410 | 1019.0 |
| 303.00 | 0.1220 | 1014.0 |
| 303.00 | 0.2010 | 1009.0 |
| 303.00 | 0.2730 | 1004.0 |
| 303.00 | 0.3700 | 997.0 |
| 303.00 | 0.5040 | 988.0 |
| 303.00 | 0.6280 | 979.0 |
| 303.00 | 0.7090 | 974.0 |
| 303.00 | 0.8220 | 966.0 |
| 303.00 | 1.0000 | 955.0 |
| 308.00 | 0.0000 | 1018.0 |
| 308.00 | 0.0410 | 1015.0 |
| 308.00 | 0.1220 | 1010.0 |
| 308.00 | 0.2010 | 1005.0 |
| 308.00 | 0.2730 | 1000.0 |
| 308.00 | 0.3700 | 993.0 |
| 308.00 | 0.5040 | 983.0 |
| 308.00 | 0.6280 | 975.0 |
| 308.00 | 0.7090 | 969.0 |
| 308.00 | 0.8220 | 962.0 |
| 308.00 | 1.0000 | 951.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.00 | 0.0000 | 1546.0 |
| 298.00 | 0.0410 | 1534.0 |
| 298.00 | 0.1220 | 1513.0 |
| 298.00 | 0.2010 | 1495.0 |
| 298.00 | 0.2730 | 1480.0 |
| 298.00 | 0.3700 | 1460.0 |
| 298.00 | 0.5040 | 1437.0 |
| 298.00 | 0.6280 | 1418.0 |
| 298.00 | 0.7090 | 1406.0 |
| 298.00 | 0.8220 | 1391.0 |
| 298.00 | 1.0000 | 1369.0 |
| 303.00 | 0.0000 | 1526.0 |
| 303.00 | 0.0410 | 1515.0 |
| 303.00 | 0.1220 | 1495.0 |
| 303.00 | 0.2010 | 1477.0 |
| 303.00 | 0.2730 | 1462.0 |
| 303.00 | 0.3700 | 1443.0 |
| 303.00 | 0.5040 | 1420.0 |
| 303.00 | 0.6280 | 1400.0 |
| 303.00 | 0.7090 | 1388.0 |
| 303.00 | 0.8220 | 1372.0 |
| 303.00 | 1.0000 | 1349.0 |
| 308.00 | 0.0000 | 1507.0 |
| 308.00 | 0.0410 | 1497.0 |
| 308.00 | 0.1220 | 1477.0 |
| 308.00 | 0.2010 | 1460.0 |
| 308.00 | 0.2730 | 1445.0 |
| 308.00 | 0.3700 | 1427.0 |
| 308.00 | 0.5040 | 1403.0 |
| 308.00 | 0.6280 | 1383.0 |
| 308.00 | 0.7090 | 1370.0 |
| 308.00 | 0.8220 | 1354.0 |
| 308.00 | 1.0000 | 1329.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.3 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene, ethoxy- (1) - Liquid | Speed of sound, m/s - Liquid |
| 298.00 | 0.0000 | 1546.0 |
| 298.00 | 0.0410 | 1534.0 |
| 298.00 | 0.1220 | 1513.0 |
| 298.00 | 0.2010 | 1495.0 |
| 298.00 | 0.2730 | 1480.0 |
| 298.00 | 0.3700 | 1460.0 |
| 298.00 | 0.5040 | 1437.0 |
| 298.00 | 0.6280 | 1418.0 |
| 298.00 | 0.7090 | 1406.0 |
| 298.00 | 0.8220 | 1391.0 |
| 298.00 | 1.0000 | 1369.0 |
| 303.00 | 0.0000 | 1526.0 |
| 303.00 | 0.0410 | 1515.0 |
| 303.00 | 0.1220 | 1495.0 |
| 303.00 | 0.2010 | 1477.0 |
| 303.00 | 0.2730 | 1462.0 |
| 303.00 | 0.3700 | 1443.0 |
| 303.00 | 0.5040 | 1420.0 |
| 303.00 | 0.6280 | 1400.0 |
| 303.00 | 0.7090 | 1388.0 |
| 303.00 | 0.8220 | 1372.0 |
| 303.00 | 1.0000 | 1349.0 |
| 308.00 | 0.0000 | 1507.0 |
| 308.00 | 0.0410 | 1497.0 |
| 308.00 | 0.1220 | 1477.0 |
| 308.00 | 0.2010 | 1460.0 |
| 308.00 | 0.2730 | 1445.0 |
| 308.00 | 0.3700 | 1427.0 |
| 308.00 | 0.5040 | 1403.0 |
| 308.00 | 0.6280 | 1383.0 |
| 308.00 | 0.7090 | 1370.0 |
| 308.00 | 0.8220 | 1354.0 |
| 308.00 | 1.0000 | 1329.0 |