- Name
- n-Hexane
- InChI
- InChI=1S/C6H14/c1-3-5-6-4-2/h3-6H2,1-2H3
- InChI Key
- VLKZOEOYAKHREP-UHFFFAOYSA-N
- Formula
- C6H14
- SMILES
- CCCCCC
- Mol. Weight (g/mol)
- 86.18
- CAS
- 110-54-3
- Name
- Fluoroform
- InChI
- InChI=1S/CHF3/c2-1(3)4/h1H
- InChI Key
- XPDWGBQVDMORPB-UHFFFAOYSA-N
- Formula
- CHF3
- SMILES
- FC(F)F
- Mol. Weight (g/mol)
- 70.01
- CAS
- 75-46-7
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (6)
- Pc - Critical pressure, kPa (2)
- Pvap - Vapor or sublimation pressure, kPa (4)
- Tc - Critical temperature, K (2)
Mole fraction of Fluoroform (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Fluoroform (2) - Liquid | Temperature, K - Liquid | Mole fraction of Fluoroform (2) - Gas |
| 0.1730 | 272.86 | 0.9886 |
| 0.2430 | 272.85 | 0.9888 |
| 0.2550 | 272.86 | 0.9865 |
| 0.3350 | 272.87 | 0.9889 |
| 0.4440 | 272.87 | 0.9896 |
| 0.8730 | 272.87 | 0.9896 |
| 0.9530 | 272.87 | 0.9919 |
| 0.9800 | 272.87 | 0.9949 |
| 0.9870 | 272.86 | 0.9970 |
| 0.1010 | 282.95 | 0.9754 |
| 0.1620 | 282.95 | 0.9807 |
| 0.2250 | 282.94 | 0.9819 |
| 0.2370 | 282.95 | 0.9837 |
| 0.4320 | 282.96 | 0.9861 |
| 0.6160 | 282.96 | 0.9868 |
| 0.6800 | 282.95 | 0.9898 |
| 0.8850 | 282.96 | 0.9911 |
| 0.9520 | 282.96 | 0.9900 |
| 0.9810 | 282.95 | 0.9911 |
| 0.9860 | 282.95 | 0.9946 |
| 0.0880 | 293.03 | 0.9644 |
| 0.1070 | 293.02 | 0.9650 |
| 0.1300 | 293.02 | 0.9624 |
| 0.1950 | 293.00 | 0.9715 |
| 0.2990 | 293.03 | 0.9775 |
| 0.3540 | 293.02 | 0.9789 |
| 0.5200 | 293.03 | 0.9818 |
| 0.8790 | 293.02 | 0.9861 |
| 0.9640 | 293.02 | 0.9918 |
| 0.9870 | 293.03 | 0.9951 |
| 0.0860 | 303.10 | 0.9625 |
| 0.2500 | 303.11 | 0.9793 |
| 0.3510 | 303.11 | 0.9807 |
| 0.3820 | 303.11 | 0.9770 |
| 0.5800 | 303.09 | 0.9801 |
| 0.6600 | 303.11 | 0.9798 |
| 0.7260 | 303.10 | 0.9788 |
| 0.8740 | 303.12 | 0.9820 |
| 0.9420 | 303.11 | 0.9810 |
| 0.9620 | 303.12 | 0.9859 |
| 0.9740 | 303.11 | 0.9914 |
| 0.0610 | 313.21 | 0.9640 |
| 0.2300 | 313.20 | 0.9748 |
| 0.3670 | 313.19 | 0.9749 |
| 0.4640 | 313.19 | 0.9762 |
| 0.5510 | 313.19 | 0.9730 |
| 0.6300 | 313.20 | 0.9706 |
| 0.7100 | 313.20 | 0.9722 |
| 0.8640 | 313.20 | 0.9735 |
| 0.9310 | 313.21 | 0.9688 |
| 0.9550 | 313.20 | 0.9615 |
Mole fraction of Fluoroform (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid mixture 1 | Temperature, K - Liquid mixture 1 | Mole fraction of Fluoroform (2) - Liquid mixture 1 |
| 2324.00 | 272.87 | 0.4440 |
Mole fraction of Fluoroform (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid mixture 2 | Temperature, K - Liquid mixture 2 | Mole fraction of Fluoroform (2) - Liquid mixture 2 |
| 2324.00 | 272.87 | 0.8730 |
Mole fraction of Fluoroform (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Fluoroform (2) - Liquid | Temperature, K - Liquid | Mole fraction of Fluoroform (2) - Gas |
| 0.1730 | 272.86 | 0.9886 |
| 0.2430 | 272.85 | 0.9888 |
| 0.2550 | 272.86 | 0.9865 |
| 0.3350 | 272.87 | 0.9889 |
| 0.4440 | 272.87 | 0.9896 |
| 0.8730 | 272.87 | 0.9896 |
| 0.9530 | 272.87 | 0.9919 |
| 0.9800 | 272.87 | 0.9949 |
| 0.9870 | 272.86 | 0.9970 |
| 0.1010 | 282.95 | 0.9754 |
| 0.1620 | 282.95 | 0.9807 |
| 0.2250 | 282.94 | 0.9819 |
| 0.2370 | 282.95 | 0.9837 |
| 0.4320 | 282.96 | 0.9861 |
| 0.6160 | 282.96 | 0.9868 |
| 0.6800 | 282.95 | 0.9898 |
| 0.8850 | 282.96 | 0.9911 |
| 0.9520 | 282.96 | 0.9900 |
| 0.9810 | 282.95 | 0.9911 |
| 0.9860 | 282.95 | 0.9946 |
| 0.0880 | 293.03 | 0.9644 |
| 0.1070 | 293.02 | 0.9650 |
| 0.1300 | 293.02 | 0.9624 |
| 0.1950 | 293.00 | 0.9715 |
| 0.2990 | 293.03 | 0.9775 |
| 0.3540 | 293.02 | 0.9789 |
| 0.5200 | 293.03 | 0.9818 |
| 0.8790 | 293.02 | 0.9861 |
| 0.9640 | 293.02 | 0.9918 |
| 0.9870 | 293.03 | 0.9951 |
| 0.0860 | 303.10 | 0.9625 |
| 0.2500 | 303.11 | 0.9793 |
| 0.3510 | 303.11 | 0.9807 |
| 0.3820 | 303.11 | 0.9770 |
| 0.5800 | 303.09 | 0.9801 |
| 0.6600 | 303.11 | 0.9798 |
| 0.7260 | 303.10 | 0.9788 |
| 0.8740 | 303.12 | 0.9820 |
| 0.9420 | 303.11 | 0.9810 |
| 0.9620 | 303.12 | 0.9859 |
| 0.9740 | 303.11 | 0.9914 |
| 0.0610 | 313.21 | 0.9640 |
| 0.2300 | 313.20 | 0.9748 |
| 0.3670 | 313.19 | 0.9749 |
| 0.4640 | 313.19 | 0.9762 |
| 0.5510 | 313.19 | 0.9730 |
| 0.6300 | 313.20 | 0.9706 |
| 0.7100 | 313.20 | 0.9722 |
| 0.8640 | 313.20 | 0.9735 |
| 0.9310 | 313.21 | 0.9688 |
| 0.9550 | 313.20 | 0.9615 |
Mole fraction of Fluoroform (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid mixture 1 | Temperature, K - Liquid mixture 1 | Mole fraction of Fluoroform (2) - Liquid mixture 1 |
| 2324.00 | 272.87 | 0.4440 |
Mole fraction of Fluoroform (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Pressure, kPa - Liquid mixture 2 | Temperature, K - Liquid mixture 2 | Mole fraction of Fluoroform (2) - Liquid mixture 2 |
| 2324.00 | 272.87 | 0.8730 |
Critical pressure, kPa [ref]
| Mole fraction of Fluoroform (2) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.1110 | 3660.00 |
| 0.3200 | 5340.00 |
| 0.5370 | 7910.00 |
| 0.6610 | 9180.00 |
| 0.7730 | 9820.00 |
| 0.8600 | 7980.00 |
| 0.9220 | 5950.00 |
| 0.9440 | 5410.00 |
Mole fraction of Fluoroform (2)
Critical pressure, kPa
4000
5000
6000
7000
8000
9000
10000
0.2
0.4
0.6000000000000001
0.8
Critical pressure, kPa [ref]
| Mole fraction of Fluoroform (2) - Liquid | Critical pressure, kPa - Liquid |
|---|---|
| 0.1110 | 3660.00 |
| 0.3200 | 5340.00 |
| 0.5370 | 7910.00 |
| 0.6610 | 9180.00 |
| 0.7730 | 9820.00 |
| 0.8600 | 7980.00 |
| 0.9220 | 5950.00 |
| 0.9440 | 5410.00 |
Mole fraction of Fluoroform (2)
Critical pressure, kPa
4000
5000
6000
7000
8000
9000
10000
0.2
0.4
0.6000000000000001
0.8
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Fluoroform (2) - Liquid | Temperature, K - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 0.1730 | 272.86 | 1545.00 |
| 0.2430 | 272.85 | 1891.00 |
| 0.2550 | 272.86 | 1943.00 |
| 0.3350 | 272.87 | 2167.00 |
| 0.4440 | 272.87 | 2324.00 |
| 0.8730 | 272.87 | 2324.00 |
| 0.9530 | 272.87 | 2396.00 |
| 0.9800 | 272.87 | 2436.00 |
| 0.9870 | 272.86 | 2469.00 |
| 0.1010 | 282.95 | 1197.00 |
| 0.1620 | 282.95 | 1693.00 |
| 0.2250 | 282.94 | 2114.00 |
| 0.2370 | 282.95 | 2196.00 |
| 0.4320 | 282.96 | 2798.00 |
| 0.6160 | 282.96 | 2906.00 |
| 0.6800 | 282.95 | 2908.00 |
| 0.8850 | 282.96 | 2948.00 |
| 0.9520 | 282.96 | 3071.00 |
| 0.9810 | 282.95 | 3149.00 |
| 0.9860 | 282.95 | 3189.00 |
| 0.0880 | 293.03 | 1192.00 |
| 0.1070 | 293.02 | 1395.00 |
| 0.1300 | 293.02 | 1623.00 |
| 0.1950 | 293.00 | 2201.00 |
| 0.2990 | 293.03 | 2872.00 |
| 0.3540 | 293.02 | 3116.00 |
| 0.5200 | 293.03 | 3491.00 |
| 0.8790 | 293.02 | 3681.00 |
| 0.9640 | 293.02 | 3943.00 |
| 0.9870 | 293.03 | 4065.00 |
| 0.0860 | 303.10 | 1270.00 |
| 0.2500 | 303.11 | 2925.00 |
| 0.3510 | 303.11 | 3589.00 |
| 0.3820 | 303.11 | 3744.00 |
| 0.5800 | 303.09 | 4256.00 |
| 0.6600 | 303.11 | 4333.00 |
| 0.7260 | 303.10 | 4380.00 |
| 0.8740 | 303.12 | 4500.00 |
| 0.9420 | 303.11 | 4726.00 |
| 0.9620 | 303.12 | 4884.00 |
| 0.9740 | 303.11 | 4929.00 |
| 0.0610 | 313.21 | 1060.00 |
| 0.2300 | 313.20 | 3059.00 |
| 0.3670 | 313.19 | 4156.00 |
| 0.4640 | 313.19 | 4634.00 |
| 0.5510 | 313.19 | 4942.00 |
| 0.6300 | 313.20 | 5099.00 |
| 0.7100 | 313.20 | 5209.00 |
| 0.8640 | 313.20 | 5381.00 |
| 0.9310 | 313.21 | 5590.00 |
| 0.9550 | 313.20 | 5770.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Fluoroform (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 293.17 | 0.1383 | 1669.20 |
| 293.15 | 0.4993 | 3456.90 |
| 293.14 | 0.7255 | 3600.30 |
| 293.16 | 0.8562 | 3671.00 |
| 303.16 | 0.1383 | 1761.00 |
| 303.17 | 0.4993 | 4075.70 |
| 303.13 | 0.7255 | 4373.60 |
| 303.18 | 0.8562 | 4503.80 |
| 313.17 | 0.1383 | 1904.30 |
| 313.21 | 0.4993 | 4721.30 |
| 313.16 | 0.7255 | 5233.20 |
| 313.23 | 0.8562 | 5425.10 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Mole fraction of Fluoroform (2) - Liquid | Temperature, K - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 0.1730 | 272.86 | 1545.00 |
| 0.2430 | 272.85 | 1891.00 |
| 0.2550 | 272.86 | 1943.00 |
| 0.3350 | 272.87 | 2167.00 |
| 0.4440 | 272.87 | 2324.00 |
| 0.8730 | 272.87 | 2324.00 |
| 0.9530 | 272.87 | 2396.00 |
| 0.9800 | 272.87 | 2436.00 |
| 0.9870 | 272.86 | 2469.00 |
| 0.1010 | 282.95 | 1197.00 |
| 0.1620 | 282.95 | 1693.00 |
| 0.2250 | 282.94 | 2114.00 |
| 0.2370 | 282.95 | 2196.00 |
| 0.4320 | 282.96 | 2798.00 |
| 0.6160 | 282.96 | 2906.00 |
| 0.6800 | 282.95 | 2908.00 |
| 0.8850 | 282.96 | 2948.00 |
| 0.9520 | 282.96 | 3071.00 |
| 0.9810 | 282.95 | 3149.00 |
| 0.9860 | 282.95 | 3189.00 |
| 0.0880 | 293.03 | 1192.00 |
| 0.1070 | 293.02 | 1395.00 |
| 0.1300 | 293.02 | 1623.00 |
| 0.1950 | 293.00 | 2201.00 |
| 0.2990 | 293.03 | 2872.00 |
| 0.3540 | 293.02 | 3116.00 |
| 0.5200 | 293.03 | 3491.00 |
| 0.8790 | 293.02 | 3681.00 |
| 0.9640 | 293.02 | 3943.00 |
| 0.9870 | 293.03 | 4065.00 |
| 0.0860 | 303.10 | 1270.00 |
| 0.2500 | 303.11 | 2925.00 |
| 0.3510 | 303.11 | 3589.00 |
| 0.3820 | 303.11 | 3744.00 |
| 0.5800 | 303.09 | 4256.00 |
| 0.6600 | 303.11 | 4333.00 |
| 0.7260 | 303.10 | 4380.00 |
| 0.8740 | 303.12 | 4500.00 |
| 0.9420 | 303.11 | 4726.00 |
| 0.9620 | 303.12 | 4884.00 |
| 0.9740 | 303.11 | 4929.00 |
| 0.0610 | 313.21 | 1060.00 |
| 0.2300 | 313.20 | 3059.00 |
| 0.3670 | 313.19 | 4156.00 |
| 0.4640 | 313.19 | 4634.00 |
| 0.5510 | 313.19 | 4942.00 |
| 0.6300 | 313.20 | 5099.00 |
| 0.7100 | 313.20 | 5209.00 |
| 0.8640 | 313.20 | 5381.00 |
| 0.9310 | 313.21 | 5590.00 |
| 0.9550 | 313.20 | 5770.00 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Fluoroform (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 293.17 | 0.1383 | 1669.20 |
| 293.15 | 0.4993 | 3456.90 |
| 293.14 | 0.7255 | 3600.30 |
| 293.16 | 0.8562 | 3671.00 |
| 303.16 | 0.1383 | 1761.00 |
| 303.17 | 0.4993 | 4075.70 |
| 303.13 | 0.7255 | 4373.60 |
| 303.18 | 0.8562 | 4503.80 |
| 313.17 | 0.1383 | 1904.30 |
| 313.21 | 0.4993 | 4721.30 |
| 313.16 | 0.7255 | 5233.20 |
| 313.23 | 0.8562 | 5425.10 |
Critical temperature, K [ref]
| Mole fraction of Fluoroform (2) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.1110 | 503.30 |
| 0.3200 | 486.90 |
| 0.5370 | 454.30 |
| 0.6610 | 427.80 |
| 0.7730 | 383.20 |
| 0.8600 | 343.00 |
| 0.9220 | 318.70 |
| 0.9440 | 310.80 |
Mole fraction of Fluoroform (2)
Critical temperature, K
300
350
400
450
500
0.2
0.4
0.6000000000000001
0.8
Critical temperature, K [ref]
| Mole fraction of Fluoroform (2) - Liquid | Critical temperature, K - Liquid |
|---|---|
| 0.1110 | 503.30 |
| 0.3200 | 486.90 |
| 0.5370 | 454.30 |
| 0.6610 | 427.80 |
| 0.7730 | 383.20 |
| 0.8600 | 343.00 |
| 0.9220 | 318.70 |
| 0.9440 | 310.80 |
Mole fraction of Fluoroform (2)
Critical temperature, K
300
350
400
450
500
0.2
0.4
0.6000000000000001
0.8