- Name
- 4-amino-2-hydroxypyrimidine
- InChI
- InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8)
- InChI Key
- OPTASPLRGRRNAP-UHFFFAOYSA-N
- Formula
- C4H5N3O
- SMILES
- Nc1cc[nH]c(=O)n1
- Mol. Weight (g/mol)
- 111.10
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 4-amino-2-hydroxypyrimidine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0073 | 0.0011 |
| 288.15 | 0.0105 | 0.0011 |
| 288.15 | 0.0157 | 0.0011 |
| 288.15 | 0.0254 | 0.0011 |
| 288.15 | 0.0272 | 0.0011 |
| 288.15 | 0.0311 | 0.0011 |
| 298.15 | 0.0073 | 0.0009 |
| 298.15 | 0.0105 | 0.0009 |
| 298.15 | 0.0157 | 0.0009 |
| 298.15 | 0.0254 | 0.0009 |
| 298.15 | 0.0272 | 0.0009 |
| 298.15 | 0.0311 | 0.0009 |
| 308.15 | 0.0073 | 0.0007 |
| 308.15 | 0.0105 | 0.0007 |
| 308.15 | 0.0157 | 0.0007 |
| 308.15 | 0.0254 | 0.0007 |
| 308.15 | 0.0272 | 0.0007 |
| 308.15 | 0.0311 | 0.0007 |
| 318.15 | 0.0073 | 0.0006 |
| 318.15 | 0.0105 | 0.0006 |
| 318.15 | 0.0157 | 0.0006 |
| 318.15 | 0.0254 | 0.0006 |
| 318.15 | 0.0272 | 0.0006 |
| 318.15 | 0.0311 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 4-amino-2-hydroxypyrimidine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0073 | 0.0011 |
| 288.15 | 0.0105 | 0.0011 |
| 288.15 | 0.0157 | 0.0011 |
| 288.15 | 0.0254 | 0.0011 |
| 288.15 | 0.0272 | 0.0011 |
| 288.15 | 0.0311 | 0.0011 |
| 298.15 | 0.0073 | 0.0009 |
| 298.15 | 0.0105 | 0.0009 |
| 298.15 | 0.0157 | 0.0009 |
| 298.15 | 0.0254 | 0.0009 |
| 298.15 | 0.0272 | 0.0009 |
| 298.15 | 0.0311 | 0.0009 |
| 308.15 | 0.0073 | 0.0007 |
| 308.15 | 0.0105 | 0.0007 |
| 308.15 | 0.0157 | 0.0007 |
| 308.15 | 0.0254 | 0.0007 |
| 308.15 | 0.0272 | 0.0007 |
| 308.15 | 0.0311 | 0.0007 |
| 318.15 | 0.0073 | 0.0006 |
| 318.15 | 0.0105 | 0.0006 |
| 318.15 | 0.0157 | 0.0006 |
| 318.15 | 0.0254 | 0.0006 |
| 318.15 | 0.0272 | 0.0006 |
| 318.15 | 0.0311 | 0.0006 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.02 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
- Final molality of solute, mol/kg = 0.0001958 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | 0.1600 |
| 298.16 | 0.1230 |
| 308.15 | 0.1080 |
| 318.15 | 0.0980 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Initial molality of solute, mol/kg = 0.02 (Liquid)
- Pressure, kPa = 101.3 (Liquid)
- Final molality of solute, mol/kg = 0.0001958 (Liquid)
| Temperature, K - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 288.15 | 0.1600 |
| 298.16 | 0.1230 |
| 308.15 | 0.1080 |
| 318.15 | 0.0980 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of 4-amino-2-hydroxypyrimidine (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0628 | 999.402 |
| 0.0560 | 999.144 |
| 0.0510 | 998.96 |
| 0.0460 | 998.777 |
| 0.0419 | 998.618 |
| 0.0370 | 998.438 |
| 0.0319 | 998.246 |
| 0.0270 | 998.062 |
| 0.0219 | 997.872 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 4-amino-2-hydroxypyrimidine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0062 | 999.374 |
| 288.15 | 0.0109 | 999.56 |
| 288.15 | 0.0163 | 999.767 |
| 288.15 | 0.0196 | 999.894 |
| 288.15 | 0.0268 | 1000.166 |
| 288.15 | 0.0330 | 1000.397 |
| 298.15 | 0.0062 | 997.282 |
| 298.15 | 0.0109 | 997.461 |
| 298.15 | 0.0128 | 997.529 |
| 298.15 | 0.0163 | 997.66 |
| 298.15 | 0.0186 | 997.743 |
| 298.15 | 0.0189 | 997.756 |
| 298.15 | 0.0196 | 997.779 |
| 298.15 | 0.0268 | 998.042 |
| 298.15 | 0.0277 | 998.073 |
| 298.15 | 0.0281 | 998.09 |
| 298.15 | 0.0330 | 998.264 |
| 298.15 | 0.0353 | 998.345 |
| 308.15 | 0.0062 | 994.295 |
| 308.15 | 0.0109 | 994.473 |
| 308.15 | 0.0163 | 994.67 |
| 308.15 | 0.0196 | 994.791 |
| 308.15 | 0.0268 | 995.052 |
| 308.15 | 0.0330 | 995.271 |
| 318.15 | 0.0062 | 990.472 |
| 318.15 | 0.0109 | 990.648 |
| 318.15 | 0.0163 | 990.845 |
| 318.15 | 0.0196 | 990.964 |
| 318.15 | 0.0268 | 991.228 |
| 318.15 | 0.0330 | 991.452 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of 4-amino-2-hydroxypyrimidine (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0628 | 999.402 |
| 0.0560 | 999.144 |
| 0.0510 | 998.96 |
| 0.0460 | 998.777 |
| 0.0419 | 998.618 |
| 0.0370 | 998.438 |
| 0.0319 | 998.246 |
| 0.0270 | 998.062 |
| 0.0219 | 997.872 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of 4-amino-2-hydroxypyrimidine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0062 | 999.374 |
| 288.15 | 0.0109 | 999.56 |
| 288.15 | 0.0163 | 999.767 |
| 288.15 | 0.0196 | 999.894 |
| 288.15 | 0.0268 | 1000.166 |
| 288.15 | 0.0330 | 1000.397 |
| 298.15 | 0.0062 | 997.282 |
| 298.15 | 0.0109 | 997.461 |
| 298.15 | 0.0128 | 997.529 |
| 298.15 | 0.0163 | 997.66 |
| 298.15 | 0.0186 | 997.743 |
| 298.15 | 0.0189 | 997.756 |
| 298.15 | 0.0196 | 997.779 |
| 298.15 | 0.0268 | 998.042 |
| 298.15 | 0.0277 | 998.073 |
| 298.15 | 0.0281 | 998.09 |
| 298.15 | 0.0330 | 998.264 |
| 298.15 | 0.0353 | 998.345 |
| 308.15 | 0.0062 | 994.295 |
| 308.15 | 0.0109 | 994.473 |
| 308.15 | 0.0163 | 994.67 |
| 308.15 | 0.0196 | 994.791 |
| 308.15 | 0.0268 | 995.052 |
| 308.15 | 0.0330 | 995.271 |
| 318.15 | 0.0062 | 990.472 |
| 318.15 | 0.0109 | 990.648 |
| 318.15 | 0.0163 | 990.845 |
| 318.15 | 0.0196 | 990.964 |
| 318.15 | 0.0268 | 991.228 |
| 318.15 | 0.0330 | 991.452 |
Sources
- Volumetric interaction coefficients for some nucleosides in aqueous solution at T= 298.15 K
- Volumetric studies on nucleic acid bases and nucleosides in aqueous guanidine hydrochloride solutions at T = (288.15 to 318.15) K and at atmospheric pressure
- Solvation behavior of some nucleic acid bases and nucleosides in water and in aqueous guanidine hydrochloride solutions: Viscometric, calorimetric and spectroscopic approach