- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
- Name
- Urea, propyl-
- InChI
- InChI=1S/C4H10N2O/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7)
- InChI Key
- ZQZJKHIIQFPZCS-UHFFFAOYSA-N
- Formula
- C4H10N2O
- SMILES
- CCCNC(=N)O
- Mol. Weight (g/mol)
- 102.14
- CAS
- 627-06-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Urea, propyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 999.096 |
| 288.15 | 0.0494 | 999.566 |
| 288.15 | 0.0790 | 999.848 |
| 288.15 | 0.1089 | 1000.134 |
| 288.15 | 0.1484 | 1000.517 |
| 288.15 | 0.1983 | 1000.994 |
| 288.15 | 0.2490 | 1001.486 |
| 288.15 | 0.3012 | 1001.991 |
| 293.15 | 0.0000 | 998.206 |
| 293.15 | 0.0494 | 998.653 |
| 293.15 | 0.0790 | 998.924 |
| 293.15 | 0.1089 | 999.198 |
| 293.15 | 0.1484 | 999.564 |
| 293.15 | 0.1983 | 1000.021 |
| 293.15 | 0.2490 | 1000.493 |
| 293.15 | 0.3012 | 1000.974 |
| 298.15 | 0.0000 | 997.051 |
| 298.15 | 0.0494 | 997.48 |
| 298.15 | 0.0790 | 997.74 |
| 298.15 | 0.1089 | 998.003 |
| 298.15 | 0.1484 | 998.356 |
| 298.15 | 0.1983 | 998.792 |
| 298.15 | 0.2490 | 999.244 |
| 298.15 | 0.3012 | 999.704 |
| 303.15 | 0.0000 | 995.65 |
| 303.15 | 0.0494 | 996.069 |
| 303.15 | 0.0790 | 996.318 |
| 303.15 | 0.1089 | 996.573 |
| 303.15 | 0.1484 | 996.91 |
| 303.15 | 0.1983 | 997.329 |
| 303.15 | 0.2490 | 997.763 |
| 303.15 | 0.3012 | 998.202 |
| 308.15 | 0.0000 | 994.036 |
| 308.15 | 0.0494 | 994.44 |
| 308.15 | 0.0790 | 994.678 |
| 308.15 | 0.1089 | 994.925 |
| 308.15 | 0.1484 | 995.249 |
| 308.15 | 0.1983 | 995.652 |
| 308.15 | 0.2490 | 996.069 |
| 308.15 | 0.3012 | 996.489 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Urea, propyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 999.096 |
| 288.15 | 0.0494 | 999.566 |
| 288.15 | 0.0790 | 999.848 |
| 288.15 | 0.1089 | 1000.134 |
| 288.15 | 0.1484 | 1000.517 |
| 288.15 | 0.1983 | 1000.994 |
| 288.15 | 0.2490 | 1001.486 |
| 288.15 | 0.3012 | 1001.991 |
| 293.15 | 0.0000 | 998.206 |
| 293.15 | 0.0494 | 998.653 |
| 293.15 | 0.0790 | 998.924 |
| 293.15 | 0.1089 | 999.198 |
| 293.15 | 0.1484 | 999.564 |
| 293.15 | 0.1983 | 1000.021 |
| 293.15 | 0.2490 | 1000.493 |
| 293.15 | 0.3012 | 1000.974 |
| 298.15 | 0.0000 | 997.051 |
| 298.15 | 0.0494 | 997.48 |
| 298.15 | 0.0790 | 997.74 |
| 298.15 | 0.1089 | 998.003 |
| 298.15 | 0.1484 | 998.356 |
| 298.15 | 0.1983 | 998.792 |
| 298.15 | 0.2490 | 999.244 |
| 298.15 | 0.3012 | 999.704 |
| 303.15 | 0.0000 | 995.65 |
| 303.15 | 0.0494 | 996.069 |
| 303.15 | 0.0790 | 996.318 |
| 303.15 | 0.1089 | 996.573 |
| 303.15 | 0.1484 | 996.91 |
| 303.15 | 0.1983 | 997.329 |
| 303.15 | 0.2490 | 997.763 |
| 303.15 | 0.3012 | 998.202 |
| 308.15 | 0.0000 | 994.036 |
| 308.15 | 0.0494 | 994.44 |
| 308.15 | 0.0790 | 994.678 |
| 308.15 | 0.1089 | 994.925 |
| 308.15 | 0.1484 | 995.249 |
| 308.15 | 0.1983 | 995.652 |
| 308.15 | 0.2490 | 996.069 |
| 308.15 | 0.3012 | 996.489 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Urea, propyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1466.7 |
| 288.15 | 0.0791 | 1473.3 |
| 288.15 | 0.1089 | 1475.8 |
| 288.15 | 0.1484 | 1479.0 |
| 288.15 | 0.1983 | 1483.0 |
| 288.15 | 0.2490 | 1487.1 |
| 288.15 | 0.3012 | 1491.1 |
| 293.15 | 0.0000 | 1482.6 |
| 293.15 | 0.0791 | 1488.9 |
| 293.15 | 0.1089 | 1491.1 |
| 293.15 | 0.1484 | 1494.1 |
| 293.15 | 0.1983 | 1497.8 |
| 293.15 | 0.2490 | 1501.6 |
| 293.15 | 0.3012 | 1505.3 |
| 298.15 | 0.0000 | 1496.9 |
| 298.15 | 0.0791 | 1502.6 |
| 298.15 | 0.1089 | 1504.7 |
| 298.15 | 0.1484 | 1507.4 |
| 298.15 | 0.1983 | 1510.8 |
| 298.15 | 0.2490 | 1514.2 |
| 298.15 | 0.3012 | 1517.7 |
| 303.15 | 0.0000 | 1509.5 |
| 303.15 | 0.0791 | 1514.5 |
| 303.15 | 0.1089 | 1516.4 |
| 303.15 | 0.1484 | 1518.9 |
| 303.15 | 0.1983 | 1522.0 |
| 303.15 | 0.2490 | 1525.2 |
| 303.15 | 0.3012 | 1528.4 |
| 308.15 | 0.0000 | 1520.2 |
| 308.15 | 0.0791 | 1524.8 |
| 308.15 | 0.1089 | 1526.5 |
| 308.15 | 0.1484 | 1528.8 |
| 308.15 | 0.1983 | 1531.7 |
| 308.15 | 0.2490 | 1534.6 |
| 308.15 | 0.3012 | 1537.5 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Urea, propyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1466.7 |
| 288.15 | 0.0791 | 1473.3 |
| 288.15 | 0.1089 | 1475.8 |
| 288.15 | 0.1484 | 1479.0 |
| 288.15 | 0.1983 | 1483.0 |
| 288.15 | 0.2490 | 1487.1 |
| 288.15 | 0.3012 | 1491.1 |
| 293.15 | 0.0000 | 1482.6 |
| 293.15 | 0.0791 | 1488.9 |
| 293.15 | 0.1089 | 1491.1 |
| 293.15 | 0.1484 | 1494.1 |
| 293.15 | 0.1983 | 1497.8 |
| 293.15 | 0.2490 | 1501.6 |
| 293.15 | 0.3012 | 1505.3 |
| 298.15 | 0.0000 | 1496.9 |
| 298.15 | 0.0791 | 1502.6 |
| 298.15 | 0.1089 | 1504.7 |
| 298.15 | 0.1484 | 1507.4 |
| 298.15 | 0.1983 | 1510.8 |
| 298.15 | 0.2490 | 1514.2 |
| 298.15 | 0.3012 | 1517.7 |
| 303.15 | 0.0000 | 1509.5 |
| 303.15 | 0.0791 | 1514.5 |
| 303.15 | 0.1089 | 1516.4 |
| 303.15 | 0.1484 | 1518.9 |
| 303.15 | 0.1983 | 1522.0 |
| 303.15 | 0.2490 | 1525.2 |
| 303.15 | 0.3012 | 1528.4 |
| 308.15 | 0.0000 | 1520.2 |
| 308.15 | 0.0791 | 1524.8 |
| 308.15 | 0.1089 | 1526.5 |
| 308.15 | 0.1484 | 1528.8 |
| 308.15 | 0.1983 | 1531.7 |
| 308.15 | 0.2490 | 1534.6 |
| 308.15 | 0.3012 | 1537.5 |