- Name
- Vitamin C
- InChI
- InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2
- InChI Key
- CIWBSHSKHKDKBQ-UHFFFAOYSA-N
- Formula
- C6H8O6
- SMILES
- O=C1OC(C(O)CO)C(O)=C1O
- Mol. Weight (g/mol)
- 176.12
- CAS
- 50-81-7
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (6)
- η - Viscosity, Pa*s (12)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (10)
- csound,fluid - Speed of Sound, m/s (4)
Mole fraction of Vitamin C (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Vitamin C (1) - Liquid |
|---|---|
| 293.15 | 0.0271 |
| 303.15 | 0.0369 |
| 313.15 | 0.0481 |
| 323.15 | 0.0593 |
Mole fraction of Vitamin C (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Vitamin C (1) - Liquid |
|---|---|
| 293.00 | 0.0290 |
| 298.00 | 0.0331 |
| 303.00 | 0.0378 |
| 308.00 | 0.0438 |
| 313.00 | 0.0504 |
| 318.00 | 0.0579 |
| 323.00 | 0.0663 |
Molality, mol/kg of Vitamin C (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid |
|---|---|
| 298.15 | 1.523 |
| 308.15 | 2.5472 |
| 308.15 | 2.577 |
Mole fraction of Vitamin C (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Mole fraction of Vitamin C (1) - Liquid |
|---|---|
| 293.15 | 0.0271 |
| 303.15 | 0.0369 |
| 313.15 | 0.0481 |
| 323.15 | 0.0593 |
Mole fraction of Vitamin C (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Vitamin C (1) - Liquid |
|---|---|
| 293.00 | 0.0290 |
| 298.00 | 0.0331 |
| 303.00 | 0.0378 |
| 308.00 | 0.0438 |
| 313.00 | 0.0504 |
| 318.00 | 0.0579 |
| 323.00 | 0.0663 |
Molality, mol/kg of Vitamin C (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid |
|---|---|
| 298.15 | 1.523 |
| 308.15 | 2.5472 |
| 308.15 | 2.577 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.00 | 0.5000 | 0.0012 |
| 298.00 | 1.0000 | 0.0016 |
| 298.00 | 1.5 | 0.0019 |
| 308.00 | 0.5000 | 0.0010 |
| 308.00 | 1.0000 | 0.0012 |
| 308.00 | 1.5 | 0.0015 |
| 313.00 | 0.5000 | 0.0008 |
| 313.00 | 1.0000 | 0.0010 |
| 313.00 | 1.5 | 0.0012 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 278.15 | 0.0000 | 0.0015 |
| 278.15 | 0.0502 | 0.0016 |
| 278.15 | 0.0997 | 0.0016 |
| 278.15 | 0.1384 | 0.0016 |
| 278.15 | 0.1964 | 0.0017 |
| 278.15 | 0.2338 | 0.0017 |
| 278.15 | 0.2927 | 0.0017 |
| 278.15 | 0.3392 | 0.0018 |
| 278.15 | 0.4069 | 0.0018 |
| 278.15 | 0.4383 | 0.0018 |
| 278.15 | 0.4932 | 0.0019 |
| 278.15 | 0.5541 | 0.0019 |
| 278.15 | 0.6251 | 0.0020 |
| 278.15 | 0.7110 | 0.0020 |
| 278.15 | 0.7457 | 0.0020 |
| 288.15 | 0.0000 | 0.0011 |
| 288.15 | 0.0496 | 0.0012 |
| 288.15 | 0.1009 | 0.0012 |
| 288.15 | 0.1408 | 0.0012 |
| 288.15 | 0.1952 | 0.0012 |
| 288.15 | 0.2426 | 0.0013 |
| 288.15 | 0.2997 | 0.0013 |
| 288.15 | 0.3402 | 0.0013 |
| 288.15 | 0.3936 | 0.0013 |
| 288.15 | 0.4492 | 0.0014 |
| 288.15 | 0.5096 | 0.0014 |
| 288.15 | 0.5782 | 0.0014 |
| 288.15 | 0.6302 | 0.0014 |
| 288.15 | 0.6984 | 0.0015 |
| 288.15 | 0.7426 | 0.0015 |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0502 | 0.0009 |
| 298.15 | 0.1017 | 0.0009 |
| 298.15 | 0.1409 | 0.0009 |
| 298.15 | 0.1988 | 0.0010 |
| 298.15 | 0.2402 | 0.0010 |
| 298.15 | 0.2987 | 0.0010 |
| 298.15 | 0.3421 | 0.0010 |
| 298.15 | 0.4046 | 0.0010 |
| 298.15 | 0.4536 | 0.0010 |
| 298.15 | 0.5119 | 0.0011 |
| 298.15 | 0.5788 | 0.0011 |
| 298.15 | 0.6259 | 0.0011 |
| 298.15 | 0.6974 | 0.0011 |
| 298.15 | 0.7486 | 0.0012 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.1000 | 0.0010 |
| 303.15 | 0.1000 | 0.0008 |
| 313.15 | 0.1000 | 0.0007 |
| 323.15 | 0.1000 | 0.0006 |
| 293.15 | 0.2000 | 0.0011 |
| 303.15 | 0.2000 | 0.0009 |
| 313.15 | 0.2000 | 0.0007 |
| 323.15 | 0.2000 | 0.0006 |
| 293.15 | 0.3000 | 0.0011 |
| 303.15 | 0.3000 | 0.0009 |
| 313.15 | 0.3000 | 0.0007 |
| 323.15 | 0.3000 | 0.0006 |
| 293.15 | 0.4000 | 0.0012 |
| 303.15 | 0.4000 | 0.0009 |
| 313.15 | 0.4000 | 0.0007 |
| 323.15 | 0.4000 | 0.0006 |
| 303.15 | 0.1000 | 0.0008 |
| 313.15 | 0.1000 | 0.0007 |
| 323.15 | 0.1000 | 0.0006 |
| 293.15 | 0.2000 | 0.0011 |
| 303.15 | 0.2000 | 0.0009 |
| 313.15 | 0.2000 | 0.0007 |
| 323.15 | 0.2000 | 0.0006 |
| 293.15 | 0.3000 | 0.0011 |
| 303.15 | 0.3000 | 0.0009 |
| 313.15 | 0.3000 | 0.0007 |
| 323.15 | 0.3000 | 0.0006 |
| 293.15 | 0.4000 | 0.0012 |
| 303.15 | 0.4000 | 0.0009 |
| 313.15 | 0.4000 | 0.0007 |
| 323.15 | 0.4000 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0500 | 0.0012 |
| 298.15 | 0.0500 | 0.0009 |
| 308.15 | 0.0500 | 0.0007 |
| 318.15 | 0.0500 | 0.0006 |
| 288.15 | 0.1500 | 0.0012 |
| 298.15 | 0.1500 | 0.0009 |
| 308.15 | 0.1500 | 0.0008 |
| 318.15 | 0.1500 | 0.0006 |
| 288.15 | 0.2500 | 0.0013 |
| 298.15 | 0.2500 | 0.0010 |
| 308.15 | 0.2500 | 0.0008 |
| 318.15 | 0.2500 | 0.0006 |
| 288.15 | 0.3500 | 0.0013 |
| 298.15 | 0.3500 | 0.0010 |
| 308.15 | 0.3500 | 0.0008 |
| 318.15 | 0.3500 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0426 | 0.0012 |
| 288.15 | 0.0926 | 0.0012 |
| 288.15 | 0.1545 | 0.0012 |
| 288.15 | 0.3011 | 0.0013 |
| 288.15 | 0.3466 | 0.0013 |
| 288.15 | 0.5606 | 0.0014 |
| 298.15 | 0.0426 | 0.0009 |
| 298.15 | 0.0926 | 0.0009 |
| 298.15 | 0.1545 | 0.0009 |
| 298.15 | 0.3011 | 0.0010 |
| 298.15 | 0.3466 | 0.0010 |
| 298.15 | 0.5606 | 0.0011 |
| 308.15 | 0.0426 | 0.0007 |
| 308.15 | 0.0926 | 0.0007 |
| 308.15 | 0.1545 | 0.0008 |
| 308.15 | 0.3011 | 0.0008 |
| 308.15 | 0.3466 | 0.0008 |
| 308.15 | 0.5606 | 0.0009 |
| 318.15 | 0.0426 | 0.0006 |
| 318.15 | 0.0926 | 0.0006 |
| 318.15 | 0.1545 | 0.0006 |
| 318.15 | 0.3466 | 0.0007 |
| 318.15 | 0.5606 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.1000 | 0.0010 |
| 303.15 | 0.1000 | 0.0008 |
| 313.15 | 0.1000 | 0.0007 |
| 323.15 | 0.1000 | 0.0006 |
| 293.15 | 0.2000 | 0.0011 |
| 303.15 | 0.2000 | 0.0009 |
| 313.15 | 0.2000 | 0.0007 |
| 323.15 | 0.2000 | 0.0006 |
| 293.15 | 0.3000 | 0.0011 |
| 303.15 | 0.3000 | 0.0009 |
| 313.15 | 0.3000 | 0.0007 |
| 323.15 | 0.3000 | 0.0006 |
| 293.15 | 0.4000 | 0.0012 |
| 303.15 | 0.4000 | 0.0009 |
| 313.15 | 0.4000 | 0.0008 |
| 323.15 | 0.4000 | 0.0006 |
| 293.15 | 0.2002 | 0.0011 |
| 303.15 | 0.2002 | 0.0009 |
| 313.15 | 0.2002 | 0.0007 |
| 323.15 | 0.2002 | 0.0006 |
| 293.15 | 0.3141 | 0.0011 |
| 303.15 | 0.3141 | 0.0009 |
| 313.15 | 0.3141 | 0.0007 |
| 323.15 | 0.3141 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.00 | 0.5000 | 0.0012 |
| 298.00 | 1.0000 | 0.0016 |
| 298.00 | 1.5 | 0.0019 |
| 308.00 | 0.5000 | 0.0010 |
| 308.00 | 1.0000 | 0.0012 |
| 308.00 | 1.5 | 0.0015 |
| 313.00 | 0.5000 | 0.0008 |
| 313.00 | 1.0000 | 0.0010 |
| 313.00 | 1.5 | 0.0012 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 278.15 | 0.0000 | 0.0015 |
| 278.15 | 0.0502 | 0.0016 |
| 278.15 | 0.0997 | 0.0016 |
| 278.15 | 0.1384 | 0.0016 |
| 278.15 | 0.1964 | 0.0017 |
| 278.15 | 0.2338 | 0.0017 |
| 278.15 | 0.2927 | 0.0017 |
| 278.15 | 0.3392 | 0.0018 |
| 278.15 | 0.4069 | 0.0018 |
| 278.15 | 0.4383 | 0.0018 |
| 278.15 | 0.4932 | 0.0019 |
| 278.15 | 0.5541 | 0.0019 |
| 278.15 | 0.6251 | 0.0020 |
| 278.15 | 0.7110 | 0.0020 |
| 278.15 | 0.7457 | 0.0020 |
| 288.15 | 0.0000 | 0.0011 |
| 288.15 | 0.0496 | 0.0012 |
| 288.15 | 0.1009 | 0.0012 |
| 288.15 | 0.1408 | 0.0012 |
| 288.15 | 0.1952 | 0.0012 |
| 288.15 | 0.2426 | 0.0013 |
| 288.15 | 0.2997 | 0.0013 |
| 288.15 | 0.3402 | 0.0013 |
| 288.15 | 0.3936 | 0.0013 |
| 288.15 | 0.4492 | 0.0014 |
| 288.15 | 0.5096 | 0.0014 |
| 288.15 | 0.5782 | 0.0014 |
| 288.15 | 0.6302 | 0.0014 |
| 288.15 | 0.6984 | 0.0015 |
| 288.15 | 0.7426 | 0.0015 |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0502 | 0.0009 |
| 298.15 | 0.1017 | 0.0009 |
| 298.15 | 0.1409 | 0.0009 |
| 298.15 | 0.1988 | 0.0010 |
| 298.15 | 0.2402 | 0.0010 |
| 298.15 | 0.2987 | 0.0010 |
| 298.15 | 0.3421 | 0.0010 |
| 298.15 | 0.4046 | 0.0010 |
| 298.15 | 0.4536 | 0.0010 |
| 298.15 | 0.5119 | 0.0011 |
| 298.15 | 0.5788 | 0.0011 |
| 298.15 | 0.6259 | 0.0011 |
| 298.15 | 0.6974 | 0.0011 |
| 298.15 | 0.7486 | 0.0012 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.1000 | 0.0010 |
| 303.15 | 0.1000 | 0.0008 |
| 313.15 | 0.1000 | 0.0007 |
| 323.15 | 0.1000 | 0.0006 |
| 293.15 | 0.2000 | 0.0011 |
| 303.15 | 0.2000 | 0.0009 |
| 313.15 | 0.2000 | 0.0007 |
| 323.15 | 0.2000 | 0.0006 |
| 293.15 | 0.3000 | 0.0011 |
| 303.15 | 0.3000 | 0.0009 |
| 313.15 | 0.3000 | 0.0007 |
| 323.15 | 0.3000 | 0.0006 |
| 293.15 | 0.4000 | 0.0012 |
| 303.15 | 0.4000 | 0.0009 |
| 313.15 | 0.4000 | 0.0007 |
| 323.15 | 0.4000 | 0.0006 |
| 303.15 | 0.1000 | 0.0008 |
| 313.15 | 0.1000 | 0.0007 |
| 323.15 | 0.1000 | 0.0006 |
| 293.15 | 0.2000 | 0.0011 |
| 303.15 | 0.2000 | 0.0009 |
| 313.15 | 0.2000 | 0.0007 |
| 323.15 | 0.2000 | 0.0006 |
| 293.15 | 0.3000 | 0.0011 |
| 303.15 | 0.3000 | 0.0009 |
| 313.15 | 0.3000 | 0.0007 |
| 323.15 | 0.3000 | 0.0006 |
| 293.15 | 0.4000 | 0.0012 |
| 303.15 | 0.4000 | 0.0009 |
| 313.15 | 0.4000 | 0.0007 |
| 323.15 | 0.4000 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0500 | 0.0012 |
| 298.15 | 0.0500 | 0.0009 |
| 308.15 | 0.0500 | 0.0007 |
| 318.15 | 0.0500 | 0.0006 |
| 288.15 | 0.1500 | 0.0012 |
| 298.15 | 0.1500 | 0.0009 |
| 308.15 | 0.1500 | 0.0008 |
| 318.15 | 0.1500 | 0.0006 |
| 288.15 | 0.2500 | 0.0013 |
| 298.15 | 0.2500 | 0.0010 |
| 308.15 | 0.2500 | 0.0008 |
| 318.15 | 0.2500 | 0.0006 |
| 288.15 | 0.3500 | 0.0013 |
| 298.15 | 0.3500 | 0.0010 |
| 308.15 | 0.3500 | 0.0008 |
| 318.15 | 0.3500 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0426 | 0.0012 |
| 288.15 | 0.0926 | 0.0012 |
| 288.15 | 0.1545 | 0.0012 |
| 288.15 | 0.3011 | 0.0013 |
| 288.15 | 0.3466 | 0.0013 |
| 288.15 | 0.5606 | 0.0014 |
| 298.15 | 0.0426 | 0.0009 |
| 298.15 | 0.0926 | 0.0009 |
| 298.15 | 0.1545 | 0.0009 |
| 298.15 | 0.3011 | 0.0010 |
| 298.15 | 0.3466 | 0.0010 |
| 298.15 | 0.5606 | 0.0011 |
| 308.15 | 0.0426 | 0.0007 |
| 308.15 | 0.0926 | 0.0007 |
| 308.15 | 0.1545 | 0.0008 |
| 308.15 | 0.3011 | 0.0008 |
| 308.15 | 0.3466 | 0.0008 |
| 308.15 | 0.5606 | 0.0009 |
| 318.15 | 0.0426 | 0.0006 |
| 318.15 | 0.0926 | 0.0006 |
| 318.15 | 0.1545 | 0.0006 |
| 318.15 | 0.3466 | 0.0007 |
| 318.15 | 0.5606 | 0.0007 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Viscosity, Pa*s - Liquid |
| 293.15 | 0.1000 | 0.0010 |
| 303.15 | 0.1000 | 0.0008 |
| 313.15 | 0.1000 | 0.0007 |
| 323.15 | 0.1000 | 0.0006 |
| 293.15 | 0.2000 | 0.0011 |
| 303.15 | 0.2000 | 0.0009 |
| 313.15 | 0.2000 | 0.0007 |
| 323.15 | 0.2000 | 0.0006 |
| 293.15 | 0.3000 | 0.0011 |
| 303.15 | 0.3000 | 0.0009 |
| 313.15 | 0.3000 | 0.0007 |
| 323.15 | 0.3000 | 0.0006 |
| 293.15 | 0.4000 | 0.0012 |
| 303.15 | 0.4000 | 0.0009 |
| 313.15 | 0.4000 | 0.0008 |
| 323.15 | 0.4000 | 0.0006 |
| 293.15 | 0.2002 | 0.0011 |
| 303.15 | 0.2002 | 0.0009 |
| 313.15 | 0.2002 | 0.0007 |
| 323.15 | 0.2002 | 0.0006 |
| 293.15 | 0.3141 | 0.0011 |
| 303.15 | 0.3141 | 0.0009 |
| 313.15 | 0.3141 | 0.0007 |
| 323.15 | 0.3141 | 0.0006 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 278.15 | 0.0000 | 1.3339 |
| 278.15 | 0.0502 | 1.3353 |
| 278.15 | 0.0997 | 1.3365 |
| 278.15 | 0.1384 | 1.3378 |
| 278.15 | 0.1964 | 1.3394 |
| 278.15 | 0.2338 | 1.3405 |
| 278.15 | 0.2927 | 1.3419 |
| 278.15 | 0.3392 | 1.3434 |
| 278.15 | 0.4069 | 1.3448 |
| 278.15 | 0.4383 | 1.3459 |
| 278.15 | 0.4932 | 1.3472 |
| 278.15 | 0.5541 | 1.3489 |
| 278.15 | 0.6251 | 1.351 |
| 278.15 | 0.7110 | 1.3533 |
| 278.15 | 0.7457 | 1.3544 |
| 288.15 | 0.0000 | 1.3334 |
| 288.15 | 0.0496 | 1.3348 |
| 288.15 | 0.1009 | 1.3364 |
| 288.15 | 0.1408 | 1.3378 |
| 288.15 | 0.1952 | 1.339 |
| 288.15 | 0.2426 | 1.34 |
| 288.15 | 0.2997 | 1.3417 |
| 288.15 | 0.3402 | 1.3428 |
| 288.15 | 0.3936 | 1.3441 |
| 288.15 | 0.4492 | 1.3456 |
| 288.15 | 0.5096 | 1.3471 |
| 288.15 | 0.5782 | 1.3489 |
| 288.15 | 0.6302 | 1.3499 |
| 288.15 | 0.6984 | 1.352 |
| 288.15 | 0.7426 | 1.3529 |
| 298.15 | 0.0000 | 1.3325 |
| 298.15 | 0.0502 | 1.3339 |
| 298.15 | 0.1017 | 1.3354 |
| 298.15 | 0.1409 | 1.3365 |
| 298.15 | 0.1988 | 1.338 |
| 298.15 | 0.2402 | 1.3391 |
| 298.15 | 0.2987 | 1.3407 |
| 298.15 | 0.3421 | 1.3418 |
| 298.15 | 0.4046 | 1.3431 |
| 298.15 | 0.4536 | 1.3443 |
| 298.15 | 0.5119 | 1.3461 |
| 298.15 | 0.5788 | 1.3478 |
| 298.15 | 0.6259 | 1.3497 |
| 298.15 | 0.6974 | 1.3508 |
| 298.15 | 0.7486 | 1.3518 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 278.15 | 0.0000 | 1.3339 |
| 278.15 | 0.0502 | 1.3353 |
| 278.15 | 0.0997 | 1.3365 |
| 278.15 | 0.1384 | 1.3378 |
| 278.15 | 0.1964 | 1.3394 |
| 278.15 | 0.2338 | 1.3405 |
| 278.15 | 0.2927 | 1.3419 |
| 278.15 | 0.3392 | 1.3434 |
| 278.15 | 0.4069 | 1.3448 |
| 278.15 | 0.4383 | 1.3459 |
| 278.15 | 0.4932 | 1.3472 |
| 278.15 | 0.5541 | 1.3489 |
| 278.15 | 0.6251 | 1.351 |
| 278.15 | 0.7110 | 1.3533 |
| 278.15 | 0.7457 | 1.3544 |
| 288.15 | 0.0000 | 1.3334 |
| 288.15 | 0.0496 | 1.3348 |
| 288.15 | 0.1009 | 1.3364 |
| 288.15 | 0.1408 | 1.3378 |
| 288.15 | 0.1952 | 1.339 |
| 288.15 | 0.2426 | 1.34 |
| 288.15 | 0.2997 | 1.3417 |
| 288.15 | 0.3402 | 1.3428 |
| 288.15 | 0.3936 | 1.3441 |
| 288.15 | 0.4492 | 1.3456 |
| 288.15 | 0.5096 | 1.3471 |
| 288.15 | 0.5782 | 1.3489 |
| 288.15 | 0.6302 | 1.3499 |
| 288.15 | 0.6984 | 1.352 |
| 288.15 | 0.7426 | 1.3529 |
| 298.15 | 0.0000 | 1.3325 |
| 298.15 | 0.0502 | 1.3339 |
| 298.15 | 0.1017 | 1.3354 |
| 298.15 | 0.1409 | 1.3365 |
| 298.15 | 0.1988 | 1.338 |
| 298.15 | 0.2402 | 1.3391 |
| 298.15 | 0.2987 | 1.3407 |
| 298.15 | 0.3421 | 1.3418 |
| 298.15 | 0.4046 | 1.3431 |
| 298.15 | 0.4536 | 1.3443 |
| 298.15 | 0.5119 | 1.3461 |
| 298.15 | 0.5788 | 1.3478 |
| 298.15 | 0.6259 | 1.3497 |
| 298.15 | 0.6974 | 1.3508 |
| 298.15 | 0.7486 | 1.3518 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.00 | 0.5000 | 1025.091 |
| 298.00 | 1.0000 | 1066.913 |
| 298.00 | 1.5 | 1101.385 |
| 308.00 | 0.5000 | 1011.179 |
| 308.00 | 1.0000 | 1063.935 |
| 308.00 | 1.5 | 1098.839 |
| 313.00 | 0.5000 | 1007.767 |
| 313.00 | 1.0000 | 1061.471 |
| 313.00 | 1.5 | 1093.845 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 278.15 | 0.0000 | 999.96 |
| 278.15 | 0.0502 | 1003.69 |
| 278.15 | 0.0997 | 1007.29 |
| 278.15 | 0.1384 | 1010.1 |
| 278.15 | 0.1964 | 1014.25 |
| 278.15 | 0.2338 | 1016.85 |
| 278.15 | 0.2927 | 1020.96 |
| 278.15 | 0.3392 | 1024.27 |
| 278.15 | 0.4069 | 1028.56 |
| 278.15 | 0.4383 | 1030.63 |
| 278.15 | 0.4932 | 1034.36 |
| 278.15 | 0.5541 | 1038.24 |
| 278.15 | 0.6251 | 1042.79 |
| 278.15 | 0.7110 | 1048.36 |
| 278.15 | 0.7457 | 1050.45 |
| 288.15 | 0.0000 | 999.1 |
| 288.15 | 0.0496 | 1002.68 |
| 288.15 | 0.1009 | 1006.33 |
| 288.15 | 0.1408 | 1009.14 |
| 288.15 | 0.1952 | 1012.94 |
| 288.15 | 0.2426 | 1016.2 |
| 288.15 | 0.2997 | 1020.14 |
| 288.15 | 0.3402 | 1022.83 |
| 288.15 | 0.3936 | 1026.48 |
| 288.15 | 0.4492 | 1030.03 |
| 288.15 | 0.5096 | 1034.09 |
| 288.15 | 0.5782 | 1038.38 |
| 288.15 | 0.6302 | 1041.56 |
| 288.15 | 0.6984 | 1046.01 |
| 288.15 | 0.7426 | 1048.42 |
| 298.15 | 0.0000 | 997.05 |
| 298.15 | 0.0502 | 1000.6 |
| 298.15 | 0.1017 | 1004.18 |
| 298.15 | 0.1409 | 1006.8 |
| 298.15 | 0.1988 | 1010.73 |
| 298.15 | 0.2402 | 1013.54 |
| 298.15 | 0.2987 | 1017.33 |
| 298.15 | 0.3421 | 1020.12 |
| 298.15 | 0.4046 | 1024.34 |
| 298.15 | 0.4536 | 1027.31 |
| 298.15 | 0.5119 | 1030.98 |
| 298.15 | 0.5788 | 1035.16 |
| 298.15 | 0.6259 | 1038.06 |
| 298.15 | 0.6974 | 1042.37 |
| 298.15 | 0.7486 | 1045.37 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.1000 | 1005.24 |
| 303.15 | 0.1000 | 1002.56 |
| 313.15 | 0.1000 | 999.06 |
| 323.15 | 0.1000 | 994.78 |
| 293.15 | 0.2000 | 1012.06 |
| 303.15 | 0.2000 | 1009.29 |
| 313.15 | 0.2000 | 1005.67 |
| 323.15 | 0.2000 | 1001.33 |
| 293.15 | 0.3000 | 1018.77 |
| 303.15 | 0.3000 | 1015.86 |
| 313.15 | 0.3000 | 1012.14 |
| 323.15 | 0.3000 | 1007.75 |
| 293.15 | 0.4000 | 1025.29 |
| 303.15 | 0.4000 | 1022.27 |
| 313.15 | 0.4000 | 1018.47 |
| 323.15 | 0.4000 | 1014.02 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.1086 | 1006.822 |
| 288.15 | 0.1575 | 1010.227 |
| 288.15 | 0.2308 | 1015.262 |
| 288.15 | 0.3467 | 1023.054 |
| 288.15 | 0.4009 | 1026.634 |
| 288.15 | 0.4232 | 1028.099 |
| 298.15 | 0.1086 | 1004.595 |
| 298.15 | 0.1575 | 1007.935 |
| 298.15 | 0.2308 | 1012.88 |
| 298.15 | 0.2809 | 1016.213 |
| 298.15 | 0.3467 | 1020.544 |
| 298.15 | 0.4009 | 1024.062 |
| 298.15 | 0.4232 | 1025.502 |
| 308.15 | 0.1485 | 1004.189 |
| 308.15 | 0.1885 | 1006.852 |
| 308.15 | 0.2479 | 1010.766 |
| 308.15 | 0.2864 | 1013.279 |
| 308.15 | 0.3317 | 1016.194 |
| 308.15 | 0.4562 | 1024.074 |
| 318.15 | 0.1086 | 997.606 |
| 318.15 | 0.1575 | 1000.864 |
| 318.15 | 0.2308 | 1005.685 |
| 318.15 | 0.2809 | 1008.933 |
| 318.15 | 0.3467 | 1013.155 |
| 318.15 | 0.4009 | 1016.581 |
| 318.15 | 0.4232 | 1017.983 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.1000 | 1005.25 |
| 303.15 | 0.1000 | 1002.56 |
| 313.15 | 0.1000 | 999.06 |
| 323.15 | 0.1000 | 994.78 |
| 293.15 | 0.2000 | 1012.12 |
| 303.15 | 0.2000 | 1009.33 |
| 313.15 | 0.2000 | 1005.69 |
| 323.15 | 0.2000 | 1001.31 |
| 293.15 | 0.3000 | 1018.82 |
| 303.15 | 0.3000 | 1015.91 |
| 313.15 | 0.3000 | 1012.2 |
| 323.15 | 0.3000 | 1007.78 |
| 293.15 | 0.4000 | 1025.4 |
| 303.15 | 0.4000 | 1022.39 |
| 313.15 | 0.4000 | 1018.62 |
| 323.15 | 0.4000 | 1014.08 |
| 293.15 | 0.2002 | 1012.12 |
| 303.15 | 0.2002 | 1009.33 |
| 313.15 | 0.2002 | 1005.69 |
| 323.15 | 0.2002 | 1001.31 |
| 293.15 | 0.3141 | 1018.82 |
| 303.15 | 0.3141 | 1015.91 |
| 313.15 | 0.3141 | 1012.2 |
| 323.15 | 0.3141 | 1007.78 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Amount concentration (molarity), mol/dm3 of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.00 | 0.5000 | 1025.091 |
| 298.00 | 1.0000 | 1066.913 |
| 298.00 | 1.5 | 1101.385 |
| 308.00 | 0.5000 | 1011.179 |
| 308.00 | 1.0000 | 1063.935 |
| 308.00 | 1.5 | 1098.839 |
| 313.00 | 0.5000 | 1007.767 |
| 313.00 | 1.0000 | 1061.471 |
| 313.00 | 1.5 | 1093.845 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 278.15 | 0.0000 | 999.96 |
| 278.15 | 0.0502 | 1003.69 |
| 278.15 | 0.0997 | 1007.29 |
| 278.15 | 0.1384 | 1010.1 |
| 278.15 | 0.1964 | 1014.25 |
| 278.15 | 0.2338 | 1016.85 |
| 278.15 | 0.2927 | 1020.96 |
| 278.15 | 0.3392 | 1024.27 |
| 278.15 | 0.4069 | 1028.56 |
| 278.15 | 0.4383 | 1030.63 |
| 278.15 | 0.4932 | 1034.36 |
| 278.15 | 0.5541 | 1038.24 |
| 278.15 | 0.6251 | 1042.79 |
| 278.15 | 0.7110 | 1048.36 |
| 278.15 | 0.7457 | 1050.45 |
| 288.15 | 0.0000 | 999.1 |
| 288.15 | 0.0496 | 1002.68 |
| 288.15 | 0.1009 | 1006.33 |
| 288.15 | 0.1408 | 1009.14 |
| 288.15 | 0.1952 | 1012.94 |
| 288.15 | 0.2426 | 1016.2 |
| 288.15 | 0.2997 | 1020.14 |
| 288.15 | 0.3402 | 1022.83 |
| 288.15 | 0.3936 | 1026.48 |
| 288.15 | 0.4492 | 1030.03 |
| 288.15 | 0.5096 | 1034.09 |
| 288.15 | 0.5782 | 1038.38 |
| 288.15 | 0.6302 | 1041.56 |
| 288.15 | 0.6984 | 1046.01 |
| 288.15 | 0.7426 | 1048.42 |
| 298.15 | 0.0000 | 997.05 |
| 298.15 | 0.0502 | 1000.6 |
| 298.15 | 0.1017 | 1004.18 |
| 298.15 | 0.1409 | 1006.8 |
| 298.15 | 0.1988 | 1010.73 |
| 298.15 | 0.2402 | 1013.54 |
| 298.15 | 0.2987 | 1017.33 |
| 298.15 | 0.3421 | 1020.12 |
| 298.15 | 0.4046 | 1024.34 |
| 298.15 | 0.4536 | 1027.31 |
| 298.15 | 0.5119 | 1030.98 |
| 298.15 | 0.5788 | 1035.16 |
| 298.15 | 0.6259 | 1038.06 |
| 298.15 | 0.6974 | 1042.37 |
| 298.15 | 0.7486 | 1045.37 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.1000 | 1005.24 |
| 303.15 | 0.1000 | 1002.56 |
| 313.15 | 0.1000 | 999.06 |
| 323.15 | 0.1000 | 994.78 |
| 293.15 | 0.2000 | 1012.06 |
| 303.15 | 0.2000 | 1009.29 |
| 313.15 | 0.2000 | 1005.67 |
| 323.15 | 0.2000 | 1001.33 |
| 293.15 | 0.3000 | 1018.77 |
| 303.15 | 0.3000 | 1015.86 |
| 313.15 | 0.3000 | 1012.14 |
| 323.15 | 0.3000 | 1007.75 |
| 293.15 | 0.4000 | 1025.29 |
| 303.15 | 0.4000 | 1022.27 |
| 313.15 | 0.4000 | 1018.47 |
| 323.15 | 0.4000 | 1014.02 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.1086 | 1006.822 |
| 288.15 | 0.1575 | 1010.227 |
| 288.15 | 0.2308 | 1015.262 |
| 288.15 | 0.3467 | 1023.054 |
| 288.15 | 0.4009 | 1026.634 |
| 288.15 | 0.4232 | 1028.099 |
| 298.15 | 0.1086 | 1004.595 |
| 298.15 | 0.1575 | 1007.935 |
| 298.15 | 0.2308 | 1012.88 |
| 298.15 | 0.2809 | 1016.213 |
| 298.15 | 0.3467 | 1020.544 |
| 298.15 | 0.4009 | 1024.062 |
| 298.15 | 0.4232 | 1025.502 |
| 308.15 | 0.1485 | 1004.189 |
| 308.15 | 0.1885 | 1006.852 |
| 308.15 | 0.2479 | 1010.766 |
| 308.15 | 0.2864 | 1013.279 |
| 308.15 | 0.3317 | 1016.194 |
| 308.15 | 0.4562 | 1024.074 |
| 318.15 | 0.1086 | 997.606 |
| 318.15 | 0.1575 | 1000.864 |
| 318.15 | 0.2308 | 1005.685 |
| 318.15 | 0.2809 | 1008.933 |
| 318.15 | 0.3467 | 1013.155 |
| 318.15 | 0.4009 | 1016.581 |
| 318.15 | 0.4232 | 1017.983 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.1000 | 1005.25 |
| 303.15 | 0.1000 | 1002.56 |
| 313.15 | 0.1000 | 999.06 |
| 323.15 | 0.1000 | 994.78 |
| 293.15 | 0.2000 | 1012.12 |
| 303.15 | 0.2000 | 1009.33 |
| 313.15 | 0.2000 | 1005.69 |
| 323.15 | 0.2000 | 1001.31 |
| 293.15 | 0.3000 | 1018.82 |
| 303.15 | 0.3000 | 1015.91 |
| 313.15 | 0.3000 | 1012.2 |
| 323.15 | 0.3000 | 1007.78 |
| 293.15 | 0.4000 | 1025.4 |
| 303.15 | 0.4000 | 1022.39 |
| 313.15 | 0.4000 | 1018.62 |
| 323.15 | 0.4000 | 1014.08 |
| 293.15 | 0.2002 | 1012.12 |
| 303.15 | 0.2002 | 1009.33 |
| 313.15 | 0.2002 | 1005.69 |
| 323.15 | 0.2002 | 1001.31 |
| 293.15 | 0.3141 | 1018.82 |
| 303.15 | 0.3141 | 1015.91 |
| 313.15 | 0.3141 | 1012.2 |
| 323.15 | 0.3141 | 1007.78 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Speed of sound, m/s - Liquid |
| 278.15 | 0.0000 | 1426.2 |
| 278.15 | 0.0502 | 1429.5 |
| 278.15 | 0.0997 | 1432.8 |
| 278.15 | 0.1384 | 1434.7 |
| 278.15 | 0.1964 | 1438.5 |
| 278.15 | 0.2338 | 1440.5 |
| 278.15 | 0.2927 | 1443.6 |
| 278.15 | 0.3392 | 1445.3 |
| 278.15 | 0.4069 | 1448.9 |
| 278.15 | 0.4383 | 1451.3 |
| 278.15 | 0.4932 | 1454.6 |
| 278.15 | 0.5541 | 1458.2 |
| 278.15 | 0.6251 | 1463.2 |
| 278.15 | 0.7110 | 1467.3 |
| 278.15 | 0.7457 | 1469.1 |
| 288.15 | 0.0000 | 1465.9 |
| 288.15 | 0.0496 | 1468.6 |
| 288.15 | 0.1009 | 1471.2 |
| 288.15 | 0.1408 | 1473.2 |
| 288.15 | 0.1952 | 1476.3 |
| 288.15 | 0.2426 | 1479.0 |
| 288.15 | 0.2997 | 1481.7 |
| 288.15 | 0.3402 | 1483.8 |
| 288.15 | 0.3936 | 1487.6 |
| 288.15 | 0.4492 | 1489.1 |
| 288.15 | 0.5096 | 1492.7 |
| 288.15 | 0.5782 | 1496.4 |
| 288.15 | 0.6302 | 1499.1 |
| 288.15 | 0.6984 | 1501.6 |
| 288.15 | 0.7426 | 1503.6 |
| 298.15 | 0.0000 | 1496.7 |
| 298.15 | 0.0502 | 1498.9 |
| 298.15 | 0.1017 | 1501.5 |
| 298.15 | 0.1409 | 1503.4 |
| 298.15 | 0.1988 | 1505.2 |
| 298.15 | 0.2402 | 1506.7 |
| 298.15 | 0.2987 | 1508.9 |
| 298.15 | 0.3421 | 1510.9 |
| 298.15 | 0.4046 | 1514.2 |
| 298.15 | 0.4536 | 1518.2 |
| 298.15 | 0.5119 | 1520.0 |
| 298.15 | 0.5788 | 1521.8 |
| 298.15 | 0.6259 | 1523.6 |
| 298.15 | 0.6974 | 1525.5 |
| 298.15 | 0.7486 | 1527.3 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1466.87 |
| 288.15 | 0.0564 | 1469.55 |
| 288.15 | 0.1176 | 1472.38 |
| 288.15 | 0.2212 | 1477.3 |
| 288.15 | 0.4673 | 1489.0 |
| 288.15 | 0.6206 | 1496.01 |
| 298.15 | 0.0000 | 1497.13 |
| 298.15 | 0.0564 | 1499.39 |
| 298.15 | 0.1176 | 1501.79 |
| 298.15 | 0.2212 | 1505.89 |
| 298.15 | 0.4673 | 1515.96 |
| 298.15 | 0.6206 | 1521.78 |
| 308.15 | 0.0000 | 1519.8 |
| 308.15 | 0.0564 | 1521.77 |
| 308.15 | 0.1176 | 1523.92 |
| 308.15 | 0.2212 | 1527.43 |
| 308.15 | 0.4673 | 1535.96 |
| 308.15 | 0.6206 | 1540.95 |
| 318.15 | 0.0000 | 1536.42 |
| 318.15 | 0.0564 | 1537.97 |
| 318.15 | 0.1176 | 1539.67 |
| 318.15 | 0.2212 | 1542.67 |
| 318.15 | 0.4673 | 1549.82 |
| 318.15 | 0.6206 | 1554.32 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Speed of sound, m/s - Liquid |
| 278.15 | 0.0000 | 1426.2 |
| 278.15 | 0.0502 | 1429.5 |
| 278.15 | 0.0997 | 1432.8 |
| 278.15 | 0.1384 | 1434.7 |
| 278.15 | 0.1964 | 1438.5 |
| 278.15 | 0.2338 | 1440.5 |
| 278.15 | 0.2927 | 1443.6 |
| 278.15 | 0.3392 | 1445.3 |
| 278.15 | 0.4069 | 1448.9 |
| 278.15 | 0.4383 | 1451.3 |
| 278.15 | 0.4932 | 1454.6 |
| 278.15 | 0.5541 | 1458.2 |
| 278.15 | 0.6251 | 1463.2 |
| 278.15 | 0.7110 | 1467.3 |
| 278.15 | 0.7457 | 1469.1 |
| 288.15 | 0.0000 | 1465.9 |
| 288.15 | 0.0496 | 1468.6 |
| 288.15 | 0.1009 | 1471.2 |
| 288.15 | 0.1408 | 1473.2 |
| 288.15 | 0.1952 | 1476.3 |
| 288.15 | 0.2426 | 1479.0 |
| 288.15 | 0.2997 | 1481.7 |
| 288.15 | 0.3402 | 1483.8 |
| 288.15 | 0.3936 | 1487.6 |
| 288.15 | 0.4492 | 1489.1 |
| 288.15 | 0.5096 | 1492.7 |
| 288.15 | 0.5782 | 1496.4 |
| 288.15 | 0.6302 | 1499.1 |
| 288.15 | 0.6984 | 1501.6 |
| 288.15 | 0.7426 | 1503.6 |
| 298.15 | 0.0000 | 1496.7 |
| 298.15 | 0.0502 | 1498.9 |
| 298.15 | 0.1017 | 1501.5 |
| 298.15 | 0.1409 | 1503.4 |
| 298.15 | 0.1988 | 1505.2 |
| 298.15 | 0.2402 | 1506.7 |
| 298.15 | 0.2987 | 1508.9 |
| 298.15 | 0.3421 | 1510.9 |
| 298.15 | 0.4046 | 1514.2 |
| 298.15 | 0.4536 | 1518.2 |
| 298.15 | 0.5119 | 1520.0 |
| 298.15 | 0.5788 | 1521.8 |
| 298.15 | 0.6259 | 1523.6 |
| 298.15 | 0.6974 | 1525.5 |
| 298.15 | 0.7486 | 1527.3 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of Vitamin C (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1466.87 |
| 288.15 | 0.0564 | 1469.55 |
| 288.15 | 0.1176 | 1472.38 |
| 288.15 | 0.2212 | 1477.3 |
| 288.15 | 0.4673 | 1489.0 |
| 288.15 | 0.6206 | 1496.01 |
| 298.15 | 0.0000 | 1497.13 |
| 298.15 | 0.0564 | 1499.39 |
| 298.15 | 0.1176 | 1501.79 |
| 298.15 | 0.2212 | 1505.89 |
| 298.15 | 0.4673 | 1515.96 |
| 298.15 | 0.6206 | 1521.78 |
| 308.15 | 0.0000 | 1519.8 |
| 308.15 | 0.0564 | 1521.77 |
| 308.15 | 0.1176 | 1523.92 |
| 308.15 | 0.2212 | 1527.43 |
| 308.15 | 0.4673 | 1535.96 |
| 308.15 | 0.6206 | 1540.95 |
| 318.15 | 0.0000 | 1536.42 |
| 318.15 | 0.0564 | 1537.97 |
| 318.15 | 0.1176 | 1539.67 |
| 318.15 | 0.2212 | 1542.67 |
| 318.15 | 0.4673 | 1549.82 |
| 318.15 | 0.6206 | 1554.32 |
Sources
- Experimental study on equilibrium solubility (at low partial pressures), density, viscosity and corrosion rate of carbon dioxide in aqueous solutions of ascorbic acid
- The study of molecular interactions of ascorbic acid and sodium ascorbate with water at temperatures (278.15, 288.15 and 298.15) K
- Volumetric and viscometric studies of amino acids in L-ascorbic acid aqueous solutions at T = (293.15 to 323.15) K
- Investigations to explore interactions in (polyhydroxy solute + L-ascorbic acid + H2O) solutions at different temperatures: Calorimetric and viscometric approach
- Solubility and thermodynamics of vitamin C in binary liquid mixtures involving water, methanol, ethanol and isopropanol at different temperatures
- Volumetric and viscometric studies on L-ascorbic acid, nicotinic acid, thiamine hydrochloride and pyridoxine hydrochloride in water at temperatures (288.15 to 318.15) K and at atmospheric pressure
- Densities and Viscosities of Erythritol, Xylitol, and Mannitol in l-ascorbic Acid Aqueous Solutions at T = (293.15 to 323.15) K
- solubility of L-(+)-ascorbic acid in water, ethanol, methanol, propan-2-ol, acetone, acetonitrile, ethyl acetate, and tetrahydrofuran from (293 to 323) K
- Solubility of Vitamin C in Water, Ethanol, Propan-1-ol, Water + Ethanol, and Water + Propan-1-ol at (298.15 and 308.15) K