- Name
- DL-Phenylalanine
- InChI
- InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)
- InChI Key
- COLNVLDHVKWLRT-UHFFFAOYSA-N
- Formula
- C9H11NO2
- SMILES
- NC(Cc1ccccc1)C(=O)O
- Mol. Weight (g/mol)
- 165.19
- CAS
- 150-30-1
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Molality, mol/kg (4)
- η - Viscosity, Pa*s (2)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (2)
- Binary diffusion coefficient, m2/s (2)
Molality, mol/kg of DL-Phenylalanine (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid |
|---|---|
| 288.15 | 0.0773 |
| 293.15 | 0.0814 |
| 298.15 | 0.0870 |
| 303.15 | 0.0917 |
| 308.15 | 0.0946 |
Mass fraction of DL-Phenylalanine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass fraction of DL-Phenylalanine (1) - Liquid |
|---|---|
| 283.15 | 0.0254 |
| 293.15 | 0.0281 |
| 298.15 | 0.0297 |
| 303.15 | 0.0322 |
| 313.15 | 0.0365 |
| 318.15 | 0.0417 |
| 323.15 | 0.0443 |
Molality, mol/kg of DL-Phenylalanine (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid |
|---|---|
| 288.15 | 0.0773 |
| 293.15 | 0.0814 |
| 298.15 | 0.0870 |
| 303.15 | 0.0917 |
| 308.15 | 0.0946 |
Mass fraction of DL-Phenylalanine (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mass fraction of DL-Phenylalanine (1) - Liquid |
|---|---|
| 283.15 | 0.0254 |
| 293.15 | 0.0281 |
| 298.15 | 0.0297 |
| 303.15 | 0.0322 |
| 313.15 | 0.0365 |
| 318.15 | 0.0417 |
| 323.15 | 0.0443 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0249 | 0.0009 |
| 298.15 | 0.0498 | 0.0009 |
| 298.15 | 0.0749 | 0.0009 |
| 298.15 | 0.0999 | 0.0009 |
| 298.15 | 0.1250 | 0.0010 |
| 298.15 | 0.1499 | 0.0010 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.0249 | 0.0008 |
| 303.15 | 0.0498 | 0.0008 |
| 303.15 | 0.0749 | 0.0008 |
| 303.15 | 0.0999 | 0.0008 |
| 303.15 | 0.1250 | 0.0009 |
| 303.15 | 0.1499 | 0.0009 |
| 308.15 | 0.0000 | 0.0007 |
| 308.15 | 0.0249 | 0.0007 |
| 308.15 | 0.0498 | 0.0007 |
| 308.15 | 0.0749 | 0.0007 |
| 308.15 | 0.0999 | 0.0008 |
| 308.15 | 0.1250 | 0.0008 |
| 308.15 | 0.1499 | 0.0008 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.0249 | 0.0007 |
| 313.15 | 0.0498 | 0.0007 |
| 313.15 | 0.0749 | 0.0007 |
| 313.15 | 0.0999 | 0.0007 |
| 313.15 | 0.1250 | 0.0007 |
| 313.15 | 0.1499 | 0.0007 |
| 318.15 | 0.0000 | 0.0006 |
| 318.15 | 0.0249 | 0.0006 |
| 318.15 | 0.0498 | 0.0006 |
| 318.15 | 0.0749 | 0.0006 |
| 318.15 | 0.0999 | 0.0006 |
| 318.15 | 0.1250 | 0.0006 |
| 318.15 | 0.1499 | 0.0006 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0009 |
| 298.15 | 0.0249 | 0.0009 |
| 298.15 | 0.0498 | 0.0009 |
| 298.15 | 0.0749 | 0.0009 |
| 298.15 | 0.0999 | 0.0009 |
| 298.15 | 0.1250 | 0.0010 |
| 298.15 | 0.1499 | 0.0010 |
| 303.15 | 0.0000 | 0.0008 |
| 303.15 | 0.0249 | 0.0008 |
| 303.15 | 0.0498 | 0.0008 |
| 303.15 | 0.0749 | 0.0008 |
| 303.15 | 0.0999 | 0.0008 |
| 303.15 | 0.1250 | 0.0009 |
| 303.15 | 0.1499 | 0.0009 |
| 308.15 | 0.0000 | 0.0007 |
| 308.15 | 0.0249 | 0.0007 |
| 308.15 | 0.0498 | 0.0007 |
| 308.15 | 0.0749 | 0.0007 |
| 308.15 | 0.0999 | 0.0008 |
| 308.15 | 0.1250 | 0.0008 |
| 308.15 | 0.1499 | 0.0008 |
| 313.15 | 0.0000 | 0.0007 |
| 313.15 | 0.0249 | 0.0007 |
| 313.15 | 0.0498 | 0.0007 |
| 313.15 | 0.0749 | 0.0007 |
| 313.15 | 0.0999 | 0.0007 |
| 313.15 | 0.1250 | 0.0007 |
| 313.15 | 0.1499 | 0.0007 |
| 318.15 | 0.0000 | 0.0006 |
| 318.15 | 0.0249 | 0.0006 |
| 318.15 | 0.0498 | 0.0006 |
| 318.15 | 0.0749 | 0.0006 |
| 318.15 | 0.0999 | 0.0006 |
| 318.15 | 0.1250 | 0.0006 |
| 318.15 | 0.1499 | 0.0006 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 998.24 |
| 293.15 | 0.0249 | 999.4 |
| 293.15 | 0.0498 | 1000.55 |
| 293.15 | 0.0749 | 1001.71 |
| 293.15 | 0.0999 | 1002.88 |
| 293.15 | 0.1250 | 1004.04 |
| 293.15 | 0.1499 | 1005.2 |
| 298.15 | 0.0000 | 997.07 |
| 298.15 | 0.0249 | 998.23 |
| 298.15 | 0.0498 | 999.39 |
| 298.15 | 0.0749 | 1000.55 |
| 298.15 | 0.0999 | 1001.72 |
| 298.15 | 0.1250 | 1002.88 |
| 298.15 | 0.1499 | 1004.05 |
| 303.15 | 0.0000 | 995.68 |
| 303.15 | 0.0249 | 996.84 |
| 303.15 | 0.0498 | 998.0 |
| 303.15 | 0.0749 | 999.17 |
| 303.15 | 0.0999 | 1000.34 |
| 303.15 | 0.1250 | 1001.51 |
| 303.15 | 0.1499 | 1002.68 |
| 308.15 | 0.0000 | 994.07 |
| 308.15 | 0.0249 | 995.24 |
| 308.15 | 0.0498 | 996.4 |
| 308.15 | 0.0749 | 997.58 |
| 308.15 | 0.0999 | 998.75 |
| 308.15 | 0.1250 | 999.92 |
| 308.15 | 0.1499 | 1001.09 |
| 313.15 | 0.0000 | 992.25 |
| 313.15 | 0.0249 | 993.43 |
| 313.15 | 0.0498 | 994.6 |
| 313.15 | 0.0749 | 995.78 |
| 313.15 | 0.0999 | 996.96 |
| 313.15 | 0.1250 | 998.14 |
| 313.15 | 0.1499 | 999.32 |
| 318.15 | 0.0000 | 990.24 |
| 318.15 | 0.0249 | 991.43 |
| 318.15 | 0.0498 | 992.61 |
| 318.15 | 0.0749 | 993.8 |
| 318.15 | 0.0999 | 994.98 |
| 318.15 | 0.1250 | 996.17 |
| 318.15 | 0.1499 | 997.36 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0102 | 1000.19 |
| 283.15 | 0.0203 | 1000.64 |
| 283.15 | 0.0293 | 1001.05 |
| 283.15 | 0.0398 | 1001.53 |
| 283.15 | 0.0509 | 1002.02 |
| 283.15 | 0.0606 | 1002.47 |
| 283.15 | 0.0610 | 1002.49 |
| 283.15 | 0.0736 | 1003.05 |
| 283.15 | 0.0915 | 1003.87 |
| 283.15 | 0.1028 | 1004.36 |
| 288.15 | 0.0102 | 999.59 |
| 288.15 | 0.0203 | 1000.04 |
| 288.15 | 0.0293 | 1000.44 |
| 288.15 | 0.0398 | 1000.91 |
| 288.15 | 0.0509 | 1001.39 |
| 288.15 | 0.0606 | 1001.83 |
| 288.15 | 0.0610 | 1001.85 |
| 288.15 | 0.0736 | 1002.4 |
| 288.15 | 0.0915 | 1003.2 |
| 288.15 | 0.1028 | 1003.69 |
| 293.15 | 0.0102 | 998.69 |
| 293.15 | 0.0203 | 999.13 |
| 293.15 | 0.0293 | 999.52 |
| 293.15 | 0.0398 | 999.98 |
| 293.15 | 0.0509 | 1000.46 |
| 293.15 | 0.0606 | 1000.9 |
| 293.15 | 0.0610 | 1000.91 |
| 293.15 | 0.0736 | 1001.45 |
| 293.15 | 0.0915 | 1002.24 |
| 293.15 | 0.1028 | 1002.73 |
| 298.15 | 0.0102 | 997.52 |
| 298.15 | 0.0203 | 997.95 |
| 298.15 | 0.0293 | 998.35 |
| 298.15 | 0.0398 | 998.8 |
| 298.15 | 0.0509 | 999.27 |
| 298.15 | 0.0606 | 999.7 |
| 298.15 | 0.0610 | 999.71 |
| 298.15 | 0.0736 | 1000.25 |
| 298.15 | 0.0915 | 1001.03 |
| 298.15 | 0.1028 | 1001.5 |
| 303.15 | 0.0102 | 996.12 |
| 303.15 | 0.0203 | 996.54 |
| 303.15 | 0.0293 | 996.93 |
| 303.15 | 0.0398 | 997.38 |
| 303.15 | 0.0509 | 997.85 |
| 303.15 | 0.0606 | 998.27 |
| 303.15 | 0.0610 | 998.28 |
| 303.15 | 0.0736 | 998.81 |
| 303.15 | 0.0915 | 999.58 |
| 303.15 | 0.1028 | 1000.05 |
| 283.15 | 0.0000 | 999.72 |
| 288.15 | 0.0000 | 999.14 |
| 293.15 | 0.0000 | 998.24 |
| 298.15 | 0.0000 | 997.08 |
| 303.15 | 0.0000 | 995.68 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0000 | 998.24 |
| 293.15 | 0.0249 | 999.4 |
| 293.15 | 0.0498 | 1000.55 |
| 293.15 | 0.0749 | 1001.71 |
| 293.15 | 0.0999 | 1002.88 |
| 293.15 | 0.1250 | 1004.04 |
| 293.15 | 0.1499 | 1005.2 |
| 298.15 | 0.0000 | 997.07 |
| 298.15 | 0.0249 | 998.23 |
| 298.15 | 0.0498 | 999.39 |
| 298.15 | 0.0749 | 1000.55 |
| 298.15 | 0.0999 | 1001.72 |
| 298.15 | 0.1250 | 1002.88 |
| 298.15 | 0.1499 | 1004.05 |
| 303.15 | 0.0000 | 995.68 |
| 303.15 | 0.0249 | 996.84 |
| 303.15 | 0.0498 | 998.0 |
| 303.15 | 0.0749 | 999.17 |
| 303.15 | 0.0999 | 1000.34 |
| 303.15 | 0.1250 | 1001.51 |
| 303.15 | 0.1499 | 1002.68 |
| 308.15 | 0.0000 | 994.07 |
| 308.15 | 0.0249 | 995.24 |
| 308.15 | 0.0498 | 996.4 |
| 308.15 | 0.0749 | 997.58 |
| 308.15 | 0.0999 | 998.75 |
| 308.15 | 0.1250 | 999.92 |
| 308.15 | 0.1499 | 1001.09 |
| 313.15 | 0.0000 | 992.25 |
| 313.15 | 0.0249 | 993.43 |
| 313.15 | 0.0498 | 994.6 |
| 313.15 | 0.0749 | 995.78 |
| 313.15 | 0.0999 | 996.96 |
| 313.15 | 0.1250 | 998.14 |
| 313.15 | 0.1499 | 999.32 |
| 318.15 | 0.0000 | 990.24 |
| 318.15 | 0.0249 | 991.43 |
| 318.15 | 0.0498 | 992.61 |
| 318.15 | 0.0749 | 993.8 |
| 318.15 | 0.0999 | 994.98 |
| 318.15 | 0.1250 | 996.17 |
| 318.15 | 0.1499 | 997.36 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid | Mass density, kg/m3 - Liquid |
| 283.15 | 0.0102 | 1000.19 |
| 283.15 | 0.0203 | 1000.64 |
| 283.15 | 0.0293 | 1001.05 |
| 283.15 | 0.0398 | 1001.53 |
| 283.15 | 0.0509 | 1002.02 |
| 283.15 | 0.0606 | 1002.47 |
| 283.15 | 0.0610 | 1002.49 |
| 283.15 | 0.0736 | 1003.05 |
| 283.15 | 0.0915 | 1003.87 |
| 283.15 | 0.1028 | 1004.36 |
| 288.15 | 0.0102 | 999.59 |
| 288.15 | 0.0203 | 1000.04 |
| 288.15 | 0.0293 | 1000.44 |
| 288.15 | 0.0398 | 1000.91 |
| 288.15 | 0.0509 | 1001.39 |
| 288.15 | 0.0606 | 1001.83 |
| 288.15 | 0.0610 | 1001.85 |
| 288.15 | 0.0736 | 1002.4 |
| 288.15 | 0.0915 | 1003.2 |
| 288.15 | 0.1028 | 1003.69 |
| 293.15 | 0.0102 | 998.69 |
| 293.15 | 0.0203 | 999.13 |
| 293.15 | 0.0293 | 999.52 |
| 293.15 | 0.0398 | 999.98 |
| 293.15 | 0.0509 | 1000.46 |
| 293.15 | 0.0606 | 1000.9 |
| 293.15 | 0.0610 | 1000.91 |
| 293.15 | 0.0736 | 1001.45 |
| 293.15 | 0.0915 | 1002.24 |
| 293.15 | 0.1028 | 1002.73 |
| 298.15 | 0.0102 | 997.52 |
| 298.15 | 0.0203 | 997.95 |
| 298.15 | 0.0293 | 998.35 |
| 298.15 | 0.0398 | 998.8 |
| 298.15 | 0.0509 | 999.27 |
| 298.15 | 0.0606 | 999.7 |
| 298.15 | 0.0610 | 999.71 |
| 298.15 | 0.0736 | 1000.25 |
| 298.15 | 0.0915 | 1001.03 |
| 298.15 | 0.1028 | 1001.5 |
| 303.15 | 0.0102 | 996.12 |
| 303.15 | 0.0203 | 996.54 |
| 303.15 | 0.0293 | 996.93 |
| 303.15 | 0.0398 | 997.38 |
| 303.15 | 0.0509 | 997.85 |
| 303.15 | 0.0606 | 998.27 |
| 303.15 | 0.0610 | 998.28 |
| 303.15 | 0.0736 | 998.81 |
| 303.15 | 0.0915 | 999.58 |
| 303.15 | 0.1028 | 1000.05 |
| 283.15 | 0.0000 | 999.72 |
| 288.15 | 0.0000 | 999.14 |
| 293.15 | 0.0000 | 998.24 |
| 298.15 | 0.0000 | 997.08 |
| 303.15 | 0.0000 | 995.68 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1483.6 |
| 293.15 | 0.0249 | 1488.8 |
| 293.15 | 0.0498 | 1493.0 |
| 293.15 | 0.0749 | 1496.2 |
| 293.15 | 0.0999 | 1498.3 |
| 293.15 | 0.1250 | 1499.4 |
| 293.15 | 0.1499 | 1499.4 |
| 298.15 | 0.0000 | 1496.9 |
| 298.15 | 0.0249 | 1501.9 |
| 298.15 | 0.0498 | 1505.9 |
| 298.15 | 0.0749 | 1509.0 |
| 298.15 | 0.0999 | 1511.0 |
| 298.15 | 0.1250 | 1512.0 |
| 298.15 | 0.1499 | 1511.9 |
| 303.15 | 0.0000 | 1508.4 |
| 303.15 | 0.0249 | 1513.1 |
| 303.15 | 0.0498 | 1516.8 |
| 303.15 | 0.0749 | 1519.5 |
| 303.15 | 0.0999 | 1521.2 |
| 303.15 | 0.1250 | 1521.8 |
| 303.15 | 0.1499 | 1521.3 |
| 308.15 | 0.0000 | 1519.8 |
| 308.15 | 0.0249 | 1524.1 |
| 308.15 | 0.0498 | 1527.4 |
| 308.15 | 0.0749 | 1529.8 |
| 308.15 | 0.0999 | 1531.1 |
| 308.15 | 0.1250 | 1531.4 |
| 308.15 | 0.1499 | 1530.6 |
| 313.15 | 0.0000 | 1526.8 |
| 313.15 | 0.0249 | 1530.8 |
| 313.15 | 0.0498 | 1533.8 |
| 313.15 | 0.0749 | 1535.8 |
| 313.15 | 0.0999 | 1536.8 |
| 313.15 | 0.1250 | 1536.7 |
| 313.15 | 0.1499 | 1535.7 |
| 318.15 | 0.0000 | 1533.0 |
| 318.15 | 0.0249 | 1536.5 |
| 318.15 | 0.0498 | 1539.1 |
| 318.15 | 0.0749 | 1540.8 |
| 318.15 | 0.0999 | 1541.5 |
| 318.15 | 0.1250 | 1541.3 |
| 318.15 | 0.1499 | 1540.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101.325 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of DL-Phenylalanine (1) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0000 | 1483.6 |
| 293.15 | 0.0249 | 1488.8 |
| 293.15 | 0.0498 | 1493.0 |
| 293.15 | 0.0749 | 1496.2 |
| 293.15 | 0.0999 | 1498.3 |
| 293.15 | 0.1250 | 1499.4 |
| 293.15 | 0.1499 | 1499.4 |
| 298.15 | 0.0000 | 1496.9 |
| 298.15 | 0.0249 | 1501.9 |
| 298.15 | 0.0498 | 1505.9 |
| 298.15 | 0.0749 | 1509.0 |
| 298.15 | 0.0999 | 1511.0 |
| 298.15 | 0.1250 | 1512.0 |
| 298.15 | 0.1499 | 1511.9 |
| 303.15 | 0.0000 | 1508.4 |
| 303.15 | 0.0249 | 1513.1 |
| 303.15 | 0.0498 | 1516.8 |
| 303.15 | 0.0749 | 1519.5 |
| 303.15 | 0.0999 | 1521.2 |
| 303.15 | 0.1250 | 1521.8 |
| 303.15 | 0.1499 | 1521.3 |
| 308.15 | 0.0000 | 1519.8 |
| 308.15 | 0.0249 | 1524.1 |
| 308.15 | 0.0498 | 1527.4 |
| 308.15 | 0.0749 | 1529.8 |
| 308.15 | 0.0999 | 1531.1 |
| 308.15 | 0.1250 | 1531.4 |
| 308.15 | 0.1499 | 1530.6 |
| 313.15 | 0.0000 | 1526.8 |
| 313.15 | 0.0249 | 1530.8 |
| 313.15 | 0.0498 | 1533.8 |
| 313.15 | 0.0749 | 1535.8 |
| 313.15 | 0.0999 | 1536.8 |
| 313.15 | 0.1250 | 1536.7 |
| 313.15 | 0.1499 | 1535.7 |
| 318.15 | 0.0000 | 1533.0 |
| 318.15 | 0.0249 | 1536.5 |
| 318.15 | 0.0498 | 1539.1 |
| 318.15 | 0.0749 | 1540.8 |
| 318.15 | 0.0999 | 1541.5 |
| 318.15 | 0.1250 | 1541.3 |
| 318.15 | 0.1499 | 1540.0 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 298.20 | 0.0000 |
| 303.20 | 0.0000 |
| 313.20 | 0.0000 |
Binary diffusion coefficient, m2/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Mole fraction = 0 (Liquid)
| Temperature, K - Liquid | Binary diffusion coefficient, m2/s - Liquid |
|---|---|
| 298.20 | 0.0000 |
| 303.20 | 0.0000 |
| 313.20 | 0.0000 |
Sources
- Physicochemical study of solute-solute and solute-solvent interactions of l-phenylalanine in (water + arabinose/glucose/sucrose) solutions at different temperatures
- Solute-solvent interactions of amino acid L-phenylalanine in aqueous 1-butyl-2,3-dimethylimidazolium bromide ionic liquid solutions
- Solubility of l-Phosphinothricin and Its Hydrochloride in Water + (Methanol and Ethanol) Binary Solvent Mixtures from 278.15 to 318.15 K
- Solubility of L-Phenylalanine Anhydrous and Monohydrate Forms: Experimental Measurements and Predictions
- Binary Diffusion Coefficients of Aqueous Phenylalanine, Tyrosine Isomers, and Aminobutyric Acids at Infinitesimal Concentration and Temperatures from (293.2 to 333.2) K