- Name
- L-Leucine, N-glycyl-
- InChI
- InChI=1S/C8H16N2O3/c1-5(2)3-6(8(12)13)10-7(11)4-9/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t6-/m1/s1
- InChI Key
- DKEXFJVMVGETOO-ZCFIWIBFSA-N
- Formula
- C8H16N2O3
- SMILES
- CC(C)CC(NC(=O)CN)C(=O)O
- Mol. Weight (g/mol)
- 188.22
- CAS
- 869-19-2
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- σcond - Electrical conductivity, S/m (2)
- Molar enthalpy (2)
- ρl - Mass density, kg/m3 (14)
- csound,fluid - Speed of Sound, m/s (6)
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Electrical conductivity, S/m - Liquid |
| 293.15 | 0.0500 | 0.0032 |
| 298.15 | 0.0500 | 0.0034 |
| 303.15 | 0.0500 | 0.0037 |
| 308.15 | 0.0500 | 0.0041 |
| 313.15 | 0.0500 | 0.0046 |
| 293.15 | 0.1000 | 0.0053 |
| 298.15 | 0.1000 | 0.0058 |
| 303.15 | 0.1000 | 0.0063 |
| 308.15 | 0.1000 | 0.0070 |
| 313.15 | 0.1000 | 0.0078 |
| 293.15 | 0.1500 | 0.0074 |
| 298.15 | 0.1500 | 0.0081 |
| 303.15 | 0.1500 | 0.0089 |
| 308.15 | 0.1500 | 0.0099 |
| 313.15 | 0.1500 | 0.0110 |
| 293.15 | 0.2000 | 0.0104 |
| 298.15 | 0.2000 | 0.0113 |
| 303.15 | 0.2000 | 0.0124 |
| 308.15 | 0.2000 | 0.0137 |
| 313.15 | 0.2000 | 0.0152 |
| 303.15 | 0.0500 | 0.0037 |
Electrical conductivity, S/m [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Electrical conductivity, S/m - Liquid |
| 293.15 | 0.0500 | 0.0032 |
| 298.15 | 0.0500 | 0.0034 |
| 303.15 | 0.0500 | 0.0037 |
| 308.15 | 0.0500 | 0.0041 |
| 313.15 | 0.0500 | 0.0046 |
| 293.15 | 0.1000 | 0.0053 |
| 298.15 | 0.1000 | 0.0058 |
| 303.15 | 0.1000 | 0.0063 |
| 308.15 | 0.1000 | 0.0070 |
| 313.15 | 0.1000 | 0.0078 |
| 293.15 | 0.1500 | 0.0074 |
| 298.15 | 0.1500 | 0.0081 |
| 303.15 | 0.1500 | 0.0089 |
| 308.15 | 0.1500 | 0.0099 |
| 313.15 | 0.1500 | 0.0110 |
| 293.15 | 0.2000 | 0.0104 |
| 298.15 | 0.2000 | 0.0113 |
| 303.15 | 0.2000 | 0.0124 |
| 308.15 | 0.2000 | 0.0137 |
| 313.15 | 0.2000 | 0.0152 |
| 303.15 | 0.0500 | 0.0037 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Initial molality of solute, mol/kg = 0.025 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 0.0003 | -0.0113 |
| 0.0005 | -0.0106 |
| 0.0007 | -0.0109 |
| 0.0009 | -0.0125 |
| 0.0010 | -0.0115 |
| 0.0012 | -0.0112 |
| 0.0014 | -0.0117 |
| 0.0016 | -0.0103 |
| 0.0017 | -0.0108 |
| 0.0019 | -0.0097 |
| 0.0021 | -0.0096 |
| 0.0022 | -0.0103 |
| 0.0024 | -0.0093 |
| 0.0026 | -0.0099 |
| 0.0027 | -0.0102 |
| 0.0029 | -0.0099 |
| 0.0031 | -0.0091 |
| 0.0032 | -0.0087 |
| 0.0034 | -0.0096 |
| 0.0036 | -0.0094 |
| 0.0037 | -0.0102 |
| 0.0039 | -0.0096 |
| 0.0040 | -0.0103 |
| 0.0042 | -0.0111 |
Molar enthalpy of dilution, kJ/mol [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Initial molality of solute, mol/kg = 0.025 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Final molality of solute, mol/kg - Liquid | Molar enthalpy of dilution, kJ/mol - Liquid |
|---|---|
| 0.0003 | -0.0113 |
| 0.0005 | -0.0106 |
| 0.0007 | -0.0109 |
| 0.0009 | -0.0125 |
| 0.0010 | -0.0115 |
| 0.0012 | -0.0112 |
| 0.0014 | -0.0117 |
| 0.0016 | -0.0103 |
| 0.0017 | -0.0108 |
| 0.0019 | -0.0097 |
| 0.0021 | -0.0096 |
| 0.0022 | -0.0103 |
| 0.0024 | -0.0093 |
| 0.0026 | -0.0099 |
| 0.0027 | -0.0102 |
| 0.0029 | -0.0099 |
| 0.0031 | -0.0091 |
| 0.0032 | -0.0087 |
| 0.0034 | -0.0096 |
| 0.0036 | -0.0094 |
| 0.0037 | -0.0102 |
| 0.0039 | -0.0096 |
| 0.0040 | -0.0103 |
| 0.0042 | -0.0111 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 288.15 (Liquid)
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 999.14 |
| 0.0330 | 1000.8 |
| 0.0494 | 1001.65 |
| 0.0589 | 1002.14 |
| 0.0689 | 1002.67 |
| 0.0784 | 1003.17 |
| 0.0882 | 1003.69 |
| 0.0974 | 1004.12 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 293.15 (Liquid)
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 998.2 |
| 0.0198 | 999.17 |
| 0.0263 | 999.49 |
| 0.0330 | 999.83 |
| 0.0397 | 1000.15 |
| 0.0494 | 1000.61 |
| 0.0589 | 1001.06 |
| 0.0689 | 1001.56 |
| 0.0784 | 1002.04 |
| 0.0882 | 1002.51 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0000 | 305.15 | 995.132 |
| 0.0000 | 310.15 | 992.274 |
| 0.0000 | 315.15 | 991.385 |
| 0.0331 | 305.15 | 996.762 |
| 0.0331 | 310.15 | 993.879 |
| 0.0331 | 315.15 | 992.968 |
| 0.0597 | 305.15 | 998.038 |
| 0.0597 | 310.15 | 995.132 |
| 0.0597 | 315.15 | 994.198 |
| 0.0946 | 305.15 | 999.652 |
| 0.0946 | 310.15 | 996.722 |
| 0.0946 | 315.15 | 995.757 |
| 0.1115 | 305.15 | 1000.423 |
| 0.1115 | 310.15 | 997.479 |
| 0.1115 | 315.15 | 996.494 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 305.15 | 0.0020 | 995.189 |
| 305.15 | 0.0060 | 995.39 |
| 305.15 | 0.0081 | 995.498 |
| 305.15 | 0.0101 | 995.597 |
| 305.15 | 0.0201 | 996.102 |
| 305.15 | 0.0508 | 997.635 |
| 305.15 | 0.1002 | 1000.07 |
| 305.15 | 0.1991 | 1004.855 |
| 305.15 | 0.2990 | 1009.555 |
| 310.15 | 0.0020 | 993.501 |
| 310.15 | 0.0060 | 993.701 |
| 310.15 | 0.0081 | 993.809 |
| 310.15 | 0.0101 | 993.908 |
| 310.15 | 0.0201 | 994.41 |
| 310.15 | 0.0508 | 995.935 |
| 310.15 | 0.1002 | 998.358 |
| 310.15 | 0.1991 | 1003.118 |
| 310.15 | 0.2990 | 1007.795 |
| 315.15 | 0.0020 | 991.607 |
| 315.15 | 0.0060 | 991.806 |
| 315.15 | 0.0081 | 991.913 |
| 315.15 | 0.0101 | 992.01 |
| 315.15 | 0.0201 | 992.508 |
| 315.15 | 0.0508 | 994.019 |
| 315.15 | 0.1002 | 996.42 |
| 315.15 | 0.1991 | 1001.137 |
| 315.15 | 0.2990 | 1005.77 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0104 | 999.623 |
| 288.15 | 0.0204 | 1000.139 |
| 288.15 | 0.0401 | 1001.13 |
| 288.15 | 0.0601 | 1002.126 |
| 288.15 | 0.0802 | 1003.078 |
| 288.15 | 0.0997 | 1004.024 |
| 288.15 | 0.1502 | 1006.404 |
| 288.15 | 0.2014 | 1008.794 |
| 298.15 | 0.0104 | 997.544 |
| 298.15 | 0.0204 | 998.07 |
| 298.15 | 0.0401 | 999.05 |
| 298.15 | 0.0601 | 999.995 |
| 298.15 | 0.0802 | 1000.945 |
| 298.15 | 0.0997 | 1001.902 |
| 298.15 | 0.1502 | 1004.282 |
| 298.15 | 0.2014 | 1006.662 |
| 308.15 | 0.0104 | 994.554 |
| 308.15 | 0.0204 | 995.045 |
| 308.15 | 0.0401 | 995.995 |
| 308.15 | 0.0601 | 996.94 |
| 308.15 | 0.0802 | 997.866 |
| 308.15 | 0.0997 | 998.802 |
| 308.15 | 0.1502 | 1001.187 |
| 308.15 | 0.2014 | 1003.567 |
| 318.15 | 0.0104 | 990.713 |
| 318.15 | 0.0204 | 991.171 |
| 318.15 | 0.0401 | 992.11 |
| 318.15 | 0.0601 | 993.02 |
| 318.15 | 0.0802 | 993.927 |
| 318.15 | 0.0997 | 994.85 |
| 318.15 | 0.1502 | 997.236 |
| 318.15 | 0.2014 | 999.61 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0194 | 997.991 |
| 298.15 | 0.0296 | 998.487 |
| 298.15 | 0.0395 | 998.954 |
| 298.15 | 0.0493 | 999.428 |
| 298.15 | 0.0570 | 999.792 |
| 298.15 | 0.0713 | 1000.487 |
| 298.15 | 0.0912 | 1001.436 |
| 298.15 | 0.1001 | 1001.847 |
| 303.15 | 0.0194 | 996.492 |
| 303.15 | 0.0296 | 996.981 |
| 303.15 | 0.0395 | 997.455 |
| 303.15 | 0.0493 | 997.926 |
| 303.15 | 0.0570 | 998.294 |
| 303.15 | 0.0713 | 998.981 |
| 303.15 | 0.0912 | 999.94 |
| 303.15 | 0.1001 | 1000.35 |
| 308.15 | 0.0194 | 994.971 |
| 308.15 | 0.0296 | 995.453 |
| 308.15 | 0.0395 | 995.927 |
| 308.15 | 0.0493 | 996.398 |
| 308.15 | 0.0570 | 996.773 |
| 308.15 | 0.0713 | 997.443 |
| 308.15 | 0.0912 | 998.415 |
| 308.15 | 0.1001 | 998.822 |
| 313.15 | 0.0194 | 993.308 |
| 313.15 | 0.0296 | 993.787 |
| 313.15 | 0.0395 | 994.248 |
| 313.15 | 0.0493 | 994.705 |
| 313.15 | 0.0570 | 995.068 |
| 313.15 | 0.0713 | 995.712 |
| 313.15 | 0.0912 | 996.655 |
| 313.15 | 0.1001 | 997.07 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 999.705 |
| 0.0194 | 1000.645 |
| 0.0296 | 1001.134 |
| 0.0395 | 1001.609 |
| 0.0493 | 1002.078 |
| 0.0570 | 1002.444 |
| 0.0713 | 1003.122 |
| 0.0770 | 1003.39 |
| 0.0912 | 1004.06 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 288.15 (Liquid)
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 999.14 |
| 0.0330 | 1000.8 |
| 0.0494 | 1001.65 |
| 0.0589 | 1002.14 |
| 0.0689 | 1002.67 |
| 0.0784 | 1003.17 |
| 0.0882 | 1003.69 |
| 0.0974 | 1004.12 |
Mass density, kg/m3 [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 293.15 (Liquid)
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 998.2 |
| 0.0198 | 999.17 |
| 0.0263 | 999.49 |
| 0.0330 | 999.83 |
| 0.0397 | 1000.15 |
| 0.0494 | 1000.61 |
| 0.0589 | 1001.06 |
| 0.0689 | 1001.56 |
| 0.0784 | 1002.04 |
| 0.0882 | 1002.51 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0000 | 305.15 | 995.132 |
| 0.0000 | 310.15 | 992.274 |
| 0.0000 | 315.15 | 991.385 |
| 0.0331 | 305.15 | 996.762 |
| 0.0331 | 310.15 | 993.879 |
| 0.0331 | 315.15 | 992.968 |
| 0.0597 | 305.15 | 998.038 |
| 0.0597 | 310.15 | 995.132 |
| 0.0597 | 315.15 | 994.198 |
| 0.0946 | 305.15 | 999.652 |
| 0.0946 | 310.15 | 996.722 |
| 0.0946 | 315.15 | 995.757 |
| 0.1115 | 305.15 | 1000.423 |
| 0.1115 | 310.15 | 997.479 |
| 0.1115 | 315.15 | 996.494 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 305.15 | 0.0020 | 995.189 |
| 305.15 | 0.0060 | 995.39 |
| 305.15 | 0.0081 | 995.498 |
| 305.15 | 0.0101 | 995.597 |
| 305.15 | 0.0201 | 996.102 |
| 305.15 | 0.0508 | 997.635 |
| 305.15 | 0.1002 | 1000.07 |
| 305.15 | 0.1991 | 1004.855 |
| 305.15 | 0.2990 | 1009.555 |
| 310.15 | 0.0020 | 993.501 |
| 310.15 | 0.0060 | 993.701 |
| 310.15 | 0.0081 | 993.809 |
| 310.15 | 0.0101 | 993.908 |
| 310.15 | 0.0201 | 994.41 |
| 310.15 | 0.0508 | 995.935 |
| 310.15 | 0.1002 | 998.358 |
| 310.15 | 0.1991 | 1003.118 |
| 310.15 | 0.2990 | 1007.795 |
| 315.15 | 0.0020 | 991.607 |
| 315.15 | 0.0060 | 991.806 |
| 315.15 | 0.0081 | 991.913 |
| 315.15 | 0.0101 | 992.01 |
| 315.15 | 0.0201 | 992.508 |
| 315.15 | 0.0508 | 994.019 |
| 315.15 | 0.1002 | 996.42 |
| 315.15 | 0.1991 | 1001.137 |
| 315.15 | 0.2990 | 1005.77 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0104 | 999.623 |
| 288.15 | 0.0204 | 1000.139 |
| 288.15 | 0.0401 | 1001.13 |
| 288.15 | 0.0601 | 1002.126 |
| 288.15 | 0.0802 | 1003.078 |
| 288.15 | 0.0997 | 1004.024 |
| 288.15 | 0.1502 | 1006.404 |
| 288.15 | 0.2014 | 1008.794 |
| 298.15 | 0.0104 | 997.544 |
| 298.15 | 0.0204 | 998.07 |
| 298.15 | 0.0401 | 999.05 |
| 298.15 | 0.0601 | 999.995 |
| 298.15 | 0.0802 | 1000.945 |
| 298.15 | 0.0997 | 1001.902 |
| 298.15 | 0.1502 | 1004.282 |
| 298.15 | 0.2014 | 1006.662 |
| 308.15 | 0.0104 | 994.554 |
| 308.15 | 0.0204 | 995.045 |
| 308.15 | 0.0401 | 995.995 |
| 308.15 | 0.0601 | 996.94 |
| 308.15 | 0.0802 | 997.866 |
| 308.15 | 0.0997 | 998.802 |
| 308.15 | 0.1502 | 1001.187 |
| 308.15 | 0.2014 | 1003.567 |
| 318.15 | 0.0104 | 990.713 |
| 318.15 | 0.0204 | 991.171 |
| 318.15 | 0.0401 | 992.11 |
| 318.15 | 0.0601 | 993.02 |
| 318.15 | 0.0802 | 993.927 |
| 318.15 | 0.0997 | 994.85 |
| 318.15 | 0.1502 | 997.236 |
| 318.15 | 0.2014 | 999.61 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0194 | 997.991 |
| 298.15 | 0.0296 | 998.487 |
| 298.15 | 0.0395 | 998.954 |
| 298.15 | 0.0493 | 999.428 |
| 298.15 | 0.0570 | 999.792 |
| 298.15 | 0.0713 | 1000.487 |
| 298.15 | 0.0912 | 1001.436 |
| 298.15 | 0.1001 | 1001.847 |
| 303.15 | 0.0194 | 996.492 |
| 303.15 | 0.0296 | 996.981 |
| 303.15 | 0.0395 | 997.455 |
| 303.15 | 0.0493 | 997.926 |
| 303.15 | 0.0570 | 998.294 |
| 303.15 | 0.0713 | 998.981 |
| 303.15 | 0.0912 | 999.94 |
| 303.15 | 0.1001 | 1000.35 |
| 308.15 | 0.0194 | 994.971 |
| 308.15 | 0.0296 | 995.453 |
| 308.15 | 0.0395 | 995.927 |
| 308.15 | 0.0493 | 996.398 |
| 308.15 | 0.0570 | 996.773 |
| 308.15 | 0.0713 | 997.443 |
| 308.15 | 0.0912 | 998.415 |
| 308.15 | 0.1001 | 998.822 |
| 313.15 | 0.0194 | 993.308 |
| 313.15 | 0.0296 | 993.787 |
| 313.15 | 0.0395 | 994.248 |
| 313.15 | 0.0493 | 994.705 |
| 313.15 | 0.0570 | 995.068 |
| 313.15 | 0.0713 | 995.712 |
| 313.15 | 0.0912 | 996.655 |
| 313.15 | 0.1001 | 997.07 |
Mass density, kg/m3 [ref]
Operational conditions:
- Temperature, K = 298.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Mass density, kg/m3 - Liquid |
|---|---|
| 0.0000 | 999.705 |
| 0.0194 | 1000.645 |
| 0.0296 | 1001.134 |
| 0.0395 | 1001.609 |
| 0.0493 | 1002.078 |
| 0.0570 | 1002.444 |
| 0.0713 | 1003.122 |
| 0.0770 | 1003.39 |
| 0.0912 | 1004.06 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Temperature, K - Liquid | Speed of sound, m/s - Liquid |
| 0.0000 | 305.15 | 1513.49 |
| 0.0000 | 310.15 | 1523.5 |
| 0.0000 | 315.15 | 1532.17 |
| 0.0331 | 305.15 | 1518.11 |
| 0.0331 | 310.15 | 1527.98 |
| 0.0331 | 315.15 | 1536.47 |
| 0.0597 | 305.15 | 1521.83 |
| 0.0597 | 310.15 | 1531.6 |
| 0.0597 | 315.15 | 1539.93 |
| 0.0946 | 305.15 | 1526.75 |
| 0.0946 | 310.15 | 1536.34 |
| 0.0946 | 315.15 | 1544.42 |
| 0.1115 | 305.15 | 1529.12 |
| 0.1115 | 310.15 | 1538.63 |
| 0.1115 | 315.15 | 1546.56 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 305.15 | 0.0020 | 1514.02 |
| 305.15 | 0.0060 | 1514.83 |
| 305.15 | 0.0081 | 1514.97 |
| 305.15 | 0.0101 | 1515.25 |
| 305.15 | 0.0201 | 1516.36 |
| 305.15 | 0.0508 | 1521.45 |
| 305.15 | 0.1002 | 1528.78 |
| 305.15 | 0.1991 | 1540.16 |
| 305.15 | 0.2990 | 1551.98 |
| 310.15 | 0.0020 | 1523.91 |
| 310.15 | 0.0060 | 1524.6 |
| 310.15 | 0.0081 | 1524.92 |
| 310.15 | 0.0101 | 1525.15 |
| 310.15 | 0.0201 | 1526.15 |
| 310.15 | 0.0508 | 1531.36 |
| 310.15 | 0.1002 | 1538.17 |
| 310.15 | 0.1991 | 1548.86 |
| 310.15 | 0.2990 | 1559.96 |
| 315.15 | 0.0020 | 1532.36 |
| 315.15 | 0.0060 | 1532.98 |
| 315.15 | 0.0081 | 1533.07 |
| 315.15 | 0.0101 | 1533.32 |
| 315.15 | 0.0201 | 1534.47 |
| 315.15 | 0.0508 | 1539.25 |
| 315.15 | 0.1002 | 1545.87 |
| 315.15 | 0.1991 | 1555.84 |
| 315.15 | 0.2990 | 1566.61 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0104 | 1468.43 |
| 288.15 | 0.0204 | 1470.08 |
| 288.15 | 0.0401 | 1473.3 |
| 288.15 | 0.0601 | 1476.59 |
| 288.15 | 0.0802 | 1479.9 |
| 288.15 | 0.0997 | 1483.09 |
| 288.15 | 0.1502 | 1491.39 |
| 288.15 | 0.2014 | 1499.79 |
| 298.15 | 0.0104 | 1497.38 |
| 298.15 | 0.0204 | 1499.02 |
| 298.15 | 0.0401 | 1502.01 |
| 298.15 | 0.0601 | 1505.19 |
| 298.15 | 0.0802 | 1508.31 |
| 298.15 | 0.0997 | 1511.32 |
| 298.15 | 0.1502 | 1519.16 |
| 298.15 | 0.2014 | 1527.1 |
| 308.15 | 0.0104 | 1521.05 |
| 308.15 | 0.0204 | 1522.56 |
| 308.15 | 0.0401 | 1525.5 |
| 308.15 | 0.0601 | 1528.51 |
| 308.15 | 0.0802 | 1531.52 |
| 308.15 | 0.0997 | 1534.43 |
| 308.15 | 0.1502 | 1542.01 |
| 308.15 | 0.2014 | 1549.68 |
| 318.15 | 0.0104 | 1537.64 |
| 318.15 | 0.0204 | 1539.11 |
| 318.15 | 0.0401 | 1542.0 |
| 318.15 | 0.0601 | 1544.94 |
| 318.15 | 0.0802 | 1547.89 |
| 318.15 | 0.0997 | 1550.74 |
| 318.15 | 0.1502 | 1558.16 |
| 318.15 | 0.2014 | 1565.67 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Temperature, K - Liquid | Speed of sound, m/s - Liquid |
| 0.0000 | 305.15 | 1513.49 |
| 0.0000 | 310.15 | 1523.5 |
| 0.0000 | 315.15 | 1532.17 |
| 0.0331 | 305.15 | 1518.11 |
| 0.0331 | 310.15 | 1527.98 |
| 0.0331 | 315.15 | 1536.47 |
| 0.0597 | 305.15 | 1521.83 |
| 0.0597 | 310.15 | 1531.6 |
| 0.0597 | 315.15 | 1539.93 |
| 0.0946 | 305.15 | 1526.75 |
| 0.0946 | 310.15 | 1536.34 |
| 0.0946 | 315.15 | 1544.42 |
| 0.1115 | 305.15 | 1529.12 |
| 0.1115 | 310.15 | 1538.63 |
| 0.1115 | 315.15 | 1546.56 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 305.15 | 0.0020 | 1514.02 |
| 305.15 | 0.0060 | 1514.83 |
| 305.15 | 0.0081 | 1514.97 |
| 305.15 | 0.0101 | 1515.25 |
| 305.15 | 0.0201 | 1516.36 |
| 305.15 | 0.0508 | 1521.45 |
| 305.15 | 0.1002 | 1528.78 |
| 305.15 | 0.1991 | 1540.16 |
| 305.15 | 0.2990 | 1551.98 |
| 310.15 | 0.0020 | 1523.91 |
| 310.15 | 0.0060 | 1524.6 |
| 310.15 | 0.0081 | 1524.92 |
| 310.15 | 0.0101 | 1525.15 |
| 310.15 | 0.0201 | 1526.15 |
| 310.15 | 0.0508 | 1531.36 |
| 310.15 | 0.1002 | 1538.17 |
| 310.15 | 0.1991 | 1548.86 |
| 310.15 | 0.2990 | 1559.96 |
| 315.15 | 0.0020 | 1532.36 |
| 315.15 | 0.0060 | 1532.98 |
| 315.15 | 0.0081 | 1533.07 |
| 315.15 | 0.0101 | 1533.32 |
| 315.15 | 0.0201 | 1534.47 |
| 315.15 | 0.0508 | 1539.25 |
| 315.15 | 0.1002 | 1545.87 |
| 315.15 | 0.1991 | 1555.84 |
| 315.15 | 0.2990 | 1566.61 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Molality, mol/kg of L-Leucine, N-glycyl- (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0104 | 1468.43 |
| 288.15 | 0.0204 | 1470.08 |
| 288.15 | 0.0401 | 1473.3 |
| 288.15 | 0.0601 | 1476.59 |
| 288.15 | 0.0802 | 1479.9 |
| 288.15 | 0.0997 | 1483.09 |
| 288.15 | 0.1502 | 1491.39 |
| 288.15 | 0.2014 | 1499.79 |
| 298.15 | 0.0104 | 1497.38 |
| 298.15 | 0.0204 | 1499.02 |
| 298.15 | 0.0401 | 1502.01 |
| 298.15 | 0.0601 | 1505.19 |
| 298.15 | 0.0802 | 1508.31 |
| 298.15 | 0.0997 | 1511.32 |
| 298.15 | 0.1502 | 1519.16 |
| 298.15 | 0.2014 | 1527.1 |
| 308.15 | 0.0104 | 1521.05 |
| 308.15 | 0.0204 | 1522.56 |
| 308.15 | 0.0401 | 1525.5 |
| 308.15 | 0.0601 | 1528.51 |
| 308.15 | 0.0802 | 1531.52 |
| 308.15 | 0.0997 | 1534.43 |
| 308.15 | 0.1502 | 1542.01 |
| 308.15 | 0.2014 | 1549.68 |
| 318.15 | 0.0104 | 1537.64 |
| 318.15 | 0.0204 | 1539.11 |
| 318.15 | 0.0401 | 1542.0 |
| 318.15 | 0.0601 | 1544.94 |
| 318.15 | 0.0802 | 1547.89 |
| 318.15 | 0.0997 | 1550.74 |
| 318.15 | 0.1502 | 1558.16 |
| 318.15 | 0.2014 | 1565.67 |
Sources
- Densities, electrical conductances, and spectroscopic properties of glycyl dipeptide + ionic liquid ([C12mim]Br) + water mixtures at different temperatures
- Interactions of some short peptides with the osmolyte trimethylamine N-oxide in aqueous solution: physico-chemical insights
- Effect of temperature on the interactions of glycyl dipeptides with sodium perfluorooctanoate in aqueous solution: Volumetric, conductometric, and spectroscopic study
- Volumetric and conductometric studies on the interactions of dipeptides with potassium perfluoroalkanesulfonate in aqueous solution at different temperatures
- Interaction of antibacterial drug ampicillin with glycine and its dipeptides analyzed by volumetric and acoustic methods at different temperatures
- Volumetric, acoustic, and UV absorption studies on solute solvent interactions of dipeptides of glycine with aqueous amoxicillin solutions
- Densities and Speeds of Sound of Antibiotic Drug Chloramphenicol with l-Leucine and Glycyl-l-leucine in Aqueous Medium at T = (288.15 318.15) K: A Volumetric, Ultrasonic, and UV Absorption Study
- Effect of Temperature on the Interactions of Glycyl Dipeptides with Sodium Dodecyl Sulfate in Aqueous Solution: A Volumetric, Conductometric, and Fluorescence Probe Study
- Interactions of Some Glycyl Dipeptides with Sodium Butyrate in Aqueous Solutions at 298.15 K: A Volumetric and Conductometric Study