- Name
- Ethane, 1,2-dimethoxy-
- InChI
- InChI=1S/C4H10O2/c1-5-3-4-6-2/h3-4H2,1-2H3
- InChI Key
- XTHFKEDIFFGKHM-UHFFFAOYSA-N
- Formula
- C4H10O2
- SMILES
- COCCOC
- Mol. Weight (g/mol)
- 90.12
- CAS
- 110-71-4
- Name
- o-Xylene
- InChI
- InChI=1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3
- InChI Key
- CTQNGGLPUBDAKN-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccccc1C
- Mol. Weight (g/mol)
- 106.17
- CAS
- 95-47-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- ρl - Mass density, kg/m3 (2)
- γ - Surface tension liquid-gas, N/m (2)
- Excess molar volume, m3/mol (2)
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.09 |
| 298.15 | 0.0995 | 874.01 |
| 298.15 | 0.1998 | 872.89 |
| 298.15 | 0.3003 | 871.73 |
| 298.15 | 0.4004 | 870.51 |
| 298.15 | 0.4998 | 869.24 |
| 298.15 | 0.6001 | 867.86 |
| 298.15 | 0.7008 | 866.37 |
| 298.15 | 0.7996 | 864.86 |
| 298.15 | 0.8992 | 863.22 |
| 298.15 | 0.9500 | 862.34 |
| 298.15 | 1.0000 | 861.36 |
| 303.15 | 0.0000 | 870.86 |
| 303.15 | 0.0996 | 869.77 |
| 303.15 | 0.1997 | 868.64 |
| 303.15 | 0.3007 | 867.45 |
| 303.15 | 0.3997 | 866.2 |
| 303.15 | 0.5001 | 864.88 |
| 303.15 | 0.6012 | 863.46 |
| 303.15 | 0.7009 | 861.98 |
| 303.15 | 0.7988 | 860.43 |
| 303.15 | 0.8998 | 858.74 |
| 303.15 | 0.9498 | 857.85 |
| 303.15 | 1.0000 | 856.8 |
| 308.15 | 0.0000 | 866.64 |
| 308.15 | 0.0998 | 865.45 |
| 308.15 | 0.2005 | 864.2 |
| 308.15 | 0.3003 | 862.9 |
| 308.15 | 0.4009 | 861.51 |
| 308.15 | 0.4991 | 860.07 |
| 308.15 | 0.5995 | 858.53 |
| 308.15 | 0.7013 | 856.88 |
| 308.15 | 0.7991 | 855.2 |
| 308.15 | 0.9008 | 853.35 |
| 308.15 | 0.9503 | 852.39 |
| 308.15 | 1.0000 | 851.24 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (1) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 875.09 |
| 298.15 | 0.0995 | 874.01 |
| 298.15 | 0.1998 | 872.89 |
| 298.15 | 0.3003 | 871.73 |
| 298.15 | 0.4004 | 870.51 |
| 298.15 | 0.4998 | 869.24 |
| 298.15 | 0.6001 | 867.86 |
| 298.15 | 0.7008 | 866.37 |
| 298.15 | 0.7996 | 864.86 |
| 298.15 | 0.8992 | 863.22 |
| 298.15 | 0.9500 | 862.34 |
| 298.15 | 1.0000 | 861.36 |
| 303.15 | 0.0000 | 870.86 |
| 303.15 | 0.0996 | 869.77 |
| 303.15 | 0.1997 | 868.64 |
| 303.15 | 0.3007 | 867.45 |
| 303.15 | 0.3997 | 866.2 |
| 303.15 | 0.5001 | 864.88 |
| 303.15 | 0.6012 | 863.46 |
| 303.15 | 0.7009 | 861.98 |
| 303.15 | 0.7988 | 860.43 |
| 303.15 | 0.8998 | 858.74 |
| 303.15 | 0.9498 | 857.85 |
| 303.15 | 1.0000 | 856.8 |
| 308.15 | 0.0000 | 866.64 |
| 308.15 | 0.0998 | 865.45 |
| 308.15 | 0.2005 | 864.2 |
| 308.15 | 0.3003 | 862.9 |
| 308.15 | 0.4009 | 861.51 |
| 308.15 | 0.4991 | 860.07 |
| 308.15 | 0.5995 | 858.53 |
| 308.15 | 0.7013 | 856.88 |
| 308.15 | 0.7991 | 855.2 |
| 308.15 | 0.9008 | 853.35 |
| 308.15 | 0.9503 | 852.39 |
| 308.15 | 1.0000 | 851.24 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0000 | 0.0299 |
| 298.15 | 0.0995 | 0.0290 |
| 298.15 | 0.1998 | 0.0283 |
| 298.15 | 0.3003 | 0.0276 |
| 298.15 | 0.4004 | 0.0271 |
| 298.15 | 0.4998 | 0.0266 |
| 298.15 | 0.6001 | 0.0262 |
| 298.15 | 0.7008 | 0.0258 |
| 298.15 | 0.7996 | 0.0254 |
| 298.15 | 0.8992 | 0.0250 |
| 298.15 | 0.9500 | 0.0246 |
| 298.15 | 1.0000 | 0.0243 |
| 303.15 | 0.0000 | 0.0292 |
| 303.15 | 0.0996 | 0.0284 |
| 303.15 | 0.1997 | 0.0277 |
| 303.15 | 0.3007 | 0.0271 |
| 303.15 | 0.3997 | 0.0266 |
| 303.15 | 0.5001 | 0.0262 |
| 303.15 | 0.6012 | 0.0258 |
| 303.15 | 0.7009 | 0.0254 |
| 303.15 | 0.7988 | 0.0250 |
| 303.15 | 0.8998 | 0.0245 |
| 303.15 | 0.9498 | 0.0242 |
| 303.15 | 1.0000 | 0.0237 |
| 308.15 | 0.0000 | 0.0286 |
| 308.15 | 0.0998 | 0.0279 |
| 308.15 | 0.2005 | 0.0272 |
| 308.15 | 0.3003 | 0.0266 |
| 308.15 | 0.4009 | 0.0262 |
| 308.15 | 0.4991 | 0.0258 |
| 308.15 | 0.5995 | 0.0254 |
| 308.15 | 0.7013 | 0.0250 |
| 308.15 | 0.7991 | 0.0246 |
| 308.15 | 0.9008 | 0.0241 |
| 308.15 | 0.9503 | 0.0237 |
| 308.15 | 1.0000 | 0.0232 |
Surface tension liquid-gas, N/m [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (1) - Liquid | Surface tension liquid-gas, N/m - Liquid |
| 298.15 | 0.0000 | 0.0299 |
| 298.15 | 0.0995 | 0.0290 |
| 298.15 | 0.1998 | 0.0283 |
| 298.15 | 0.3003 | 0.0276 |
| 298.15 | 0.4004 | 0.0271 |
| 298.15 | 0.4998 | 0.0266 |
| 298.15 | 0.6001 | 0.0262 |
| 298.15 | 0.7008 | 0.0258 |
| 298.15 | 0.7996 | 0.0254 |
| 298.15 | 0.8992 | 0.0250 |
| 298.15 | 0.9500 | 0.0246 |
| 298.15 | 1.0000 | 0.0243 |
| 303.15 | 0.0000 | 0.0292 |
| 303.15 | 0.0996 | 0.0284 |
| 303.15 | 0.1997 | 0.0277 |
| 303.15 | 0.3007 | 0.0271 |
| 303.15 | 0.3997 | 0.0266 |
| 303.15 | 0.5001 | 0.0262 |
| 303.15 | 0.6012 | 0.0258 |
| 303.15 | 0.7009 | 0.0254 |
| 303.15 | 0.7988 | 0.0250 |
| 303.15 | 0.8998 | 0.0245 |
| 303.15 | 0.9498 | 0.0242 |
| 303.15 | 1.0000 | 0.0237 |
| 308.15 | 0.0000 | 0.0286 |
| 308.15 | 0.0998 | 0.0279 |
| 308.15 | 0.2005 | 0.0272 |
| 308.15 | 0.3003 | 0.0266 |
| 308.15 | 0.4009 | 0.0262 |
| 308.15 | 0.4991 | 0.0258 |
| 308.15 | 0.5995 | 0.0254 |
| 308.15 | 0.7013 | 0.0250 |
| 308.15 | 0.7991 | 0.0246 |
| 308.15 | 0.9008 | 0.0241 |
| 308.15 | 0.9503 | 0.0237 |
| 308.15 | 1.0000 | 0.0232 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (1) - Liquid | Excess molar volume, m3/mol - Liquid |
| 298.15 | 0.0000 | 0.0000 |
| 298.15 | 0.0995 | -1.6100e-08 |
| 298.15 | 0.1998 | -3.2000e-08 |
| 298.15 | 0.3003 | -4.5900e-08 |
| 298.15 | 0.4004 | -5.7300e-08 |
| 298.15 | 0.4998 | -6.5700e-08 |
| 298.15 | 0.6001 | -6.6300e-08 |
| 298.15 | 0.7008 | -5.9100e-08 |
| 298.15 | 0.7996 | -5.0500e-08 |
| 298.15 | 0.8992 | -3.4400e-08 |
| 298.15 | 0.9500 | -2.3100e-08 |
| 298.15 | 1.0000 | 0.0000 |
| 303.15 | 0.0000 | 0.0000 |
| 303.15 | 0.0996 | -1.8700e-08 |
| 303.15 | 0.1997 | -3.7000e-08 |
| 303.15 | 0.3007 | -5.3200e-08 |
| 303.15 | 0.3997 | -6.2500e-08 |
| 303.15 | 0.5001 | -7.0100e-08 |
| 303.15 | 0.6012 | -7.1100e-08 |
| 303.15 | 0.7009 | -6.7400e-08 |
| 303.15 | 0.7988 | -5.7100e-08 |
| 303.15 | 0.8998 | -4.1400e-08 |
| 303.15 | 0.9498 | -2.9500e-08 |
| 303.15 | 1.0000 | 0.0000 |
| 308.15 | 0.0000 | 0.0000 |
| 308.15 | 0.0998 | -2.1800e-08 |
| 308.15 | 0.2005 | -4.1800e-08 |
| 308.15 | 0.3003 | -5.8100e-08 |
| 308.15 | 0.4009 | -6.8900e-08 |
| 308.15 | 0.4991 | -7.3700e-08 |
| 308.15 | 0.5995 | -7.5500e-08 |
| 308.15 | 0.7013 | -7.1900e-08 |
| 308.15 | 0.7991 | -6.2500e-08 |
| 308.15 | 0.9008 | -4.6500e-08 |
| 308.15 | 0.9503 | -3.4000e-08 |
| 308.15 | 1.0000 | 0.0000 |
Excess molar volume, m3/mol [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Ethane, 1,2-dimethoxy- (1) - Liquid | Excess molar volume, m3/mol - Liquid |
| 298.15 | 0.0000 | 0.0000 |
| 298.15 | 0.0995 | -1.6100e-08 |
| 298.15 | 0.1998 | -3.2000e-08 |
| 298.15 | 0.3003 | -4.5900e-08 |
| 298.15 | 0.4004 | -5.7300e-08 |
| 298.15 | 0.4998 | -6.5700e-08 |
| 298.15 | 0.6001 | -6.6300e-08 |
| 298.15 | 0.7008 | -5.9100e-08 |
| 298.15 | 0.7996 | -5.0500e-08 |
| 298.15 | 0.8992 | -3.4400e-08 |
| 298.15 | 0.9500 | -2.3100e-08 |
| 298.15 | 1.0000 | 0.0000 |
| 303.15 | 0.0000 | 0.0000 |
| 303.15 | 0.0996 | -1.8700e-08 |
| 303.15 | 0.1997 | -3.7000e-08 |
| 303.15 | 0.3007 | -5.3200e-08 |
| 303.15 | 0.3997 | -6.2500e-08 |
| 303.15 | 0.5001 | -7.0100e-08 |
| 303.15 | 0.6012 | -7.1100e-08 |
| 303.15 | 0.7009 | -6.7400e-08 |
| 303.15 | 0.7988 | -5.7100e-08 |
| 303.15 | 0.8998 | -4.1400e-08 |
| 303.15 | 0.9498 | -2.9500e-08 |
| 303.15 | 1.0000 | 0.0000 |
| 308.15 | 0.0000 | 0.0000 |
| 308.15 | 0.0998 | -2.1800e-08 |
| 308.15 | 0.2005 | -4.1800e-08 |
| 308.15 | 0.3003 | -5.8100e-08 |
| 308.15 | 0.4009 | -6.8900e-08 |
| 308.15 | 0.4991 | -7.3700e-08 |
| 308.15 | 0.5995 | -7.5500e-08 |
| 308.15 | 0.7013 | -7.1900e-08 |
| 308.15 | 0.7991 | -6.2500e-08 |
| 308.15 | 0.9008 | -4.6500e-08 |
| 308.15 | 0.9503 | -3.4000e-08 |
| 308.15 | 1.0000 | 0.0000 |