- Name
- Isopropyl Alcohol
- InChI
- InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3
- InChI Key
- KFZMGEQAYNKOFK-UHFFFAOYSA-N
- Formula
- C3H8O
- SMILES
- CC(C)O
- Mol. Weight (g/mol)
- 60.09
- CAS
- 67-63-0
- Name
- Anisole
- InChI
- InChI=1S/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- RDOXTESZEPMUJZ-UHFFFAOYSA-N
- Formula
- C7H8O
- SMILES
- COc1ccccc1
- Mol. Weight (g/mol)
- 108.14
- CAS
- 100-66-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
- Tboil - Boiling temperature at pressure P, K (2)
Mole fraction of Isopropyl Alcohol (1) [ref]
Operational condition: Pressure, kPa = 96.15 (Liquid)
| Mole fraction of Isopropyl Alcohol (1) - Liquid | Mole fraction of Isopropyl Alcohol (1) - Gas |
|---|---|
| 1.0000 | 1.0000 |
| 0.9486 | 0.9841 |
| 0.9276 | 0.9783 |
| 0.8653 | 0.9643 |
| 0.7998 | 0.9519 |
| 0.7034 | 0.9399 |
| 0.6214 | 0.9294 |
| 0.5090 | 0.9128 |
| 0.4071 | 0.9027 |
| 0.3110 | 0.8926 |
| 0.1623 | 0.8255 |
| 0.1047 | 0.7800 |
| 0.0000 | 0.0000 |
Mole fraction of Isopropyl Alcohol (1) [ref]
Operational condition: Pressure, kPa = 96.15 (Liquid)
| Mole fraction of Isopropyl Alcohol (1) - Liquid | Mole fraction of Isopropyl Alcohol (1) - Gas |
|---|---|
| 1.0000 | 1.0000 |
| 0.9486 | 0.9841 |
| 0.9276 | 0.9783 |
| 0.8653 | 0.9643 |
| 0.7998 | 0.9519 |
| 0.7034 | 0.9399 |
| 0.6214 | 0.9294 |
| 0.5090 | 0.9128 |
| 0.4071 | 0.9027 |
| 0.3110 | 0.8926 |
| 0.1623 | 0.8255 |
| 0.1047 | 0.7800 |
| 0.0000 | 0.0000 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0020 |
| 298.15 | 0.0964 | 0.0015 |
| 298.15 | 0.1995 | 0.0012 |
| 298.15 | 0.2995 | 0.0011 |
| 298.15 | 0.3965 | 0.0010 |
| 298.15 | 0.4947 | 0.0010 |
| 298.15 | 0.5932 | 0.0009 |
| 298.15 | 0.6966 | 0.0009 |
| 298.15 | 0.8069 | 0.0009 |
| 298.15 | 0.9052 | 0.0008 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.0964 | 0.0013 |
| 303.15 | 0.1995 | 0.0011 |
| 303.15 | 0.2995 | 0.0010 |
| 303.15 | 0.3965 | 0.0009 |
| 303.15 | 0.4947 | 0.0009 |
| 303.15 | 0.5932 | 0.0009 |
| 303.15 | 0.6966 | 0.0008 |
| 303.15 | 0.8069 | 0.0008 |
| 303.15 | 0.9052 | 0.0008 |
| 303.15 | 1.0000 | 0.0009 |
| 308.15 | 0.0000 | 0.0015 |
| 308.15 | 0.0964 | 0.0012 |
| 308.15 | 0.1995 | 0.0010 |
| 308.15 | 0.2995 | 0.0009 |
| 308.15 | 0.3965 | 0.0008 |
| 308.15 | 0.4947 | 0.0008 |
| 308.15 | 0.5932 | 0.0008 |
| 308.15 | 0.6966 | 0.0008 |
| 308.15 | 0.8069 | 0.0007 |
| 308.15 | 0.9052 | 0.0007 |
| 308.15 | 1.0000 | 0.0009 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Viscosity, Pa*s - Liquid |
| 298.15 | 0.0000 | 0.0020 |
| 298.15 | 0.0964 | 0.0015 |
| 298.15 | 0.1995 | 0.0012 |
| 298.15 | 0.2995 | 0.0011 |
| 298.15 | 0.3965 | 0.0010 |
| 298.15 | 0.4947 | 0.0010 |
| 298.15 | 0.5932 | 0.0009 |
| 298.15 | 0.6966 | 0.0009 |
| 298.15 | 0.8069 | 0.0009 |
| 298.15 | 0.9052 | 0.0008 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0018 |
| 303.15 | 0.0964 | 0.0013 |
| 303.15 | 0.1995 | 0.0011 |
| 303.15 | 0.2995 | 0.0010 |
| 303.15 | 0.3965 | 0.0009 |
| 303.15 | 0.4947 | 0.0009 |
| 303.15 | 0.5932 | 0.0009 |
| 303.15 | 0.6966 | 0.0008 |
| 303.15 | 0.8069 | 0.0008 |
| 303.15 | 0.9052 | 0.0008 |
| 303.15 | 1.0000 | 0.0009 |
| 308.15 | 0.0000 | 0.0015 |
| 308.15 | 0.0964 | 0.0012 |
| 308.15 | 0.1995 | 0.0010 |
| 308.15 | 0.2995 | 0.0009 |
| 308.15 | 0.3965 | 0.0008 |
| 308.15 | 0.4947 | 0.0008 |
| 308.15 | 0.5932 | 0.0008 |
| 308.15 | 0.6966 | 0.0008 |
| 308.15 | 0.8069 | 0.0007 |
| 308.15 | 0.9052 | 0.0007 |
| 308.15 | 1.0000 | 0.0009 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3745 |
| 298.15 | 0.0964 | 1.3925 |
| 298.15 | 0.1995 | 1.4115 |
| 298.15 | 0.2995 | 1.4275 |
| 298.15 | 0.3965 | 1.4427 |
| 298.15 | 0.4947 | 1.4571 |
| 298.15 | 0.5932 | 1.4701 |
| 298.15 | 0.6966 | 1.482 |
| 298.15 | 0.8069 | 1.495 |
| 298.15 | 0.9052 | 1.5049 |
| 298.15 | 1.0000 | 1.5137 |
| 303.15 | 0.0000 | 1.3721 |
| 303.15 | 0.0964 | 1.3901 |
| 303.15 | 0.1995 | 1.4075 |
| 303.15 | 0.2995 | 1.4244 |
| 303.15 | 0.3965 | 1.4399 |
| 303.15 | 0.4947 | 1.4535 |
| 303.15 | 0.5932 | 1.467 |
| 303.15 | 0.6966 | 1.4793 |
| 303.15 | 0.8069 | 1.4923 |
| 303.15 | 0.9052 | 1.5018 |
| 303.15 | 1.0000 | 1.5113 |
| 308.15 | 0.0000 | 1.3702 |
| 308.15 | 0.0964 | 1.3879 |
| 308.15 | 0.1995 | 1.4064 |
| 308.15 | 0.2995 | 1.4226 |
| 308.15 | 0.3965 | 1.438 |
| 308.15 | 0.4947 | 1.451 |
| 308.15 | 0.5932 | 1.465 |
| 308.15 | 0.6966 | 1.4763 |
| 308.15 | 0.8069 | 1.4884 |
| 308.15 | 0.9052 | 1.4999 |
| 308.15 | 1.0000 | 1.5088 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 96.15 (Liquid)
- Temperature, K = 293 (Liquid)
| Mole fraction of Isopropyl Alcohol (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 1.0000 | 1.3758 |
| 0.9693 | 1.3861 |
| 0.9372 | 1.3911 |
| 0.8790 | 1.4019 |
| 0.8063 | 1.4143 |
| 0.7293 | 1.4272 |
| 0.6429 | 1.4403 |
| 0.5438 | 1.4543 |
| 0.4359 | 1.4688 |
| 0.3122 | 1.484 |
| 0.1663 | 1.5011 |
| 0.0879 | 1.5092 |
| 0.0000 | 1.5175 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 298.15 | 0.0000 | 1.3745 |
| 298.15 | 0.0964 | 1.3925 |
| 298.15 | 0.1995 | 1.4115 |
| 298.15 | 0.2995 | 1.4275 |
| 298.15 | 0.3965 | 1.4427 |
| 298.15 | 0.4947 | 1.4571 |
| 298.15 | 0.5932 | 1.4701 |
| 298.15 | 0.6966 | 1.482 |
| 298.15 | 0.8069 | 1.495 |
| 298.15 | 0.9052 | 1.5049 |
| 298.15 | 1.0000 | 1.5137 |
| 303.15 | 0.0000 | 1.3721 |
| 303.15 | 0.0964 | 1.3901 |
| 303.15 | 0.1995 | 1.4075 |
| 303.15 | 0.2995 | 1.4244 |
| 303.15 | 0.3965 | 1.4399 |
| 303.15 | 0.4947 | 1.4535 |
| 303.15 | 0.5932 | 1.467 |
| 303.15 | 0.6966 | 1.4793 |
| 303.15 | 0.8069 | 1.4923 |
| 303.15 | 0.9052 | 1.5018 |
| 303.15 | 1.0000 | 1.5113 |
| 308.15 | 0.0000 | 1.3702 |
| 308.15 | 0.0964 | 1.3879 |
| 308.15 | 0.1995 | 1.4064 |
| 308.15 | 0.2995 | 1.4226 |
| 308.15 | 0.3965 | 1.438 |
| 308.15 | 0.4947 | 1.451 |
| 308.15 | 0.5932 | 1.465 |
| 308.15 | 0.6966 | 1.4763 |
| 308.15 | 0.8069 | 1.4884 |
| 308.15 | 0.9052 | 1.4999 |
| 308.15 | 1.0000 | 1.5088 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Pressure, kPa = 96.15 (Liquid)
- Temperature, K = 293 (Liquid)
| Mole fraction of Isopropyl Alcohol (1) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 1.0000 | 1.3758 |
| 0.9693 | 1.3861 |
| 0.9372 | 1.3911 |
| 0.8790 | 1.4019 |
| 0.8063 | 1.4143 |
| 0.7293 | 1.4272 |
| 0.6429 | 1.4403 |
| 0.5438 | 1.4543 |
| 0.4359 | 1.4688 |
| 0.3122 | 1.484 |
| 0.1663 | 1.5011 |
| 0.0879 | 1.5092 |
| 0.0000 | 1.5175 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 781.36 |
| 298.15 | 0.0964 | 809.04 |
| 298.15 | 0.1995 | 836.66 |
| 298.15 | 0.2995 | 861.3 |
| 298.15 | 0.3965 | 882.77 |
| 298.15 | 0.4947 | 903.09 |
| 298.15 | 0.5932 | 921.89 |
| 298.15 | 0.6966 | 940.52 |
| 298.15 | 0.8069 | 958.9 |
| 298.15 | 0.9052 | 974.58 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 777.09 |
| 303.15 | 0.0964 | 804.55 |
| 303.15 | 0.1995 | 832.04 |
| 303.15 | 0.2995 | 856.56 |
| 303.15 | 0.3965 | 877.97 |
| 303.15 | 0.4947 | 898.25 |
| 303.15 | 0.5932 | 917.04 |
| 303.15 | 0.6966 | 935.67 |
| 303.15 | 0.8069 | 954.07 |
| 303.15 | 0.9052 | 969.52 |
| 303.15 | 1.0000 | 984.45 |
| 308.15 | 0.0000 | 772.75 |
| 308.15 | 0.0964 | 799.99 |
| 308.15 | 0.1995 | 827.34 |
| 308.15 | 0.2995 | 851.78 |
| 308.15 | 0.3965 | 873.12 |
| 308.15 | 0.4947 | 893.38 |
| 308.15 | 0.5932 | 912.14 |
| 308.15 | 0.6966 | 930.78 |
| 308.15 | 0.8069 | 949.22 |
| 308.15 | 0.9052 | 965.01 |
| 308.15 | 1.0000 | 979.73 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (2) - Liquid | Mass density, kg/m3 - Liquid |
| 298.15 | 0.0000 | 781.36 |
| 298.15 | 0.0964 | 809.04 |
| 298.15 | 0.1995 | 836.66 |
| 298.15 | 0.2995 | 861.3 |
| 298.15 | 0.3965 | 882.77 |
| 298.15 | 0.4947 | 903.09 |
| 298.15 | 0.5932 | 921.89 |
| 298.15 | 0.6966 | 940.52 |
| 298.15 | 0.8069 | 958.9 |
| 298.15 | 0.9052 | 974.58 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 777.09 |
| 303.15 | 0.0964 | 804.55 |
| 303.15 | 0.1995 | 832.04 |
| 303.15 | 0.2995 | 856.56 |
| 303.15 | 0.3965 | 877.97 |
| 303.15 | 0.4947 | 898.25 |
| 303.15 | 0.5932 | 917.04 |
| 303.15 | 0.6966 | 935.67 |
| 303.15 | 0.8069 | 954.07 |
| 303.15 | 0.9052 | 969.52 |
| 303.15 | 1.0000 | 984.45 |
| 308.15 | 0.0000 | 772.75 |
| 308.15 | 0.0964 | 799.99 |
| 308.15 | 0.1995 | 827.34 |
| 308.15 | 0.2995 | 851.78 |
| 308.15 | 0.3965 | 873.12 |
| 308.15 | 0.4947 | 893.38 |
| 308.15 | 0.5932 | 912.14 |
| 308.15 | 0.6966 | 930.78 |
| 308.15 | 0.8069 | 949.22 |
| 308.15 | 0.9052 | 965.01 |
| 308.15 | 1.0000 | 979.73 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Anisole (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1141.0 |
| 0.0964 | 1168.0 |
| 0.1995 | 1195.0 |
| 0.2995 | 1223.0 |
| 0.3965 | 1250.0 |
| 0.4947 | 1277.0 |
| 0.5932 | 1304.0 |
| 0.6966 | 1331.0 |
| 0.8069 | 1358.0 |
| 0.9052 | 1384.0 |
| 1.0000 | 1412.0 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Anisole (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1141.0 |
| 0.0964 | 1168.0 |
| 0.1995 | 1195.0 |
| 0.2995 | 1223.0 |
| 0.3965 | 1250.0 |
| 0.4947 | 1277.0 |
| 0.5932 | 1304.0 |
| 0.6966 | 1331.0 |
| 0.8069 | 1358.0 |
| 0.9052 | 1384.0 |
| 1.0000 | 1412.0 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 96.15 (Liquid)
| Mole fraction of Isopropyl Alcohol (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 1.0000 | 354.17 |
| 0.9486 | 354.98 |
| 0.9276 | 354.86 |
| 0.8653 | 356.20 |
| 0.7998 | 357.46 |
| 0.7034 | 358.31 |
| 0.6214 | 358.83 |
| 0.5090 | 359.84 |
| 0.4071 | 361.34 |
| 0.3110 | 363.60 |
| 0.1623 | 371.77 |
| 0.1047 | 377.95 |
| 0.0000 | 424.79 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 96.15 (Liquid)
| Mole fraction of Isopropyl Alcohol (1) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 1.0000 | 354.17 |
| 0.9486 | 354.98 |
| 0.9276 | 354.86 |
| 0.8653 | 356.20 |
| 0.7998 | 357.46 |
| 0.7034 | 358.31 |
| 0.6214 | 358.83 |
| 0.5090 | 359.84 |
| 0.4071 | 361.34 |
| 0.3110 | 363.60 |
| 0.1623 | 371.77 |
| 0.1047 | 377.95 |
| 0.0000 | 424.79 |
Sources
- Thermodynamic interactions in binary mixtures of anisole with ethanol, propan-1-ol, propan-2-ol, butan-1-ol, pentan-1-ol, and 3-methylbutan-1-ol at T = (298.15, 303.15, and 308.15) K
- Vapor Liquid Equilibrium Data for Binary Mixtures of Acetic Acid + Anisole, Acetone + Anisole, and Isopropanol + Anisole at Pressure 96.15 kPa