- Name
- Anisole
- InChI
- InChI=1S/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- RDOXTESZEPMUJZ-UHFFFAOYSA-N
- Formula
- C7H8O
- SMILES
- COc1ccccc1
- Mol. Weight (g/mol)
- 108.14
- CAS
- 100-66-3
- Name
- o-Xylene
- InChI
- InChI=1S/C8H10/c1-7-5-3-4-6-8(7)2/h3-6H,1-2H3
- InChI Key
- CTQNGGLPUBDAKN-UHFFFAOYSA-N
- Formula
- C8H10
- SMILES
- Cc1ccccc1C
- Mol. Weight (g/mol)
- 106.17
- CAS
- 95-47-6
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Mole fraction (2)
- η - Viscosity, Pa*s (2)
- n0 - Refractive index (Na D-line) (4)
- ρl - Mass density, kg/m3 (4)
- csound,fluid - Speed of Sound, m/s (2)
- Tboil - Boiling temperature at pressure P, K (2)
Mole fraction of o-Xylene (2) [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of o-Xylene (2) - Liquid | Mole fraction of o-Xylene (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0590 | 0.0840 |
| 0.1060 | 0.1460 |
| 0.2030 | 0.2630 |
| 0.2710 | 0.3370 |
| 0.4200 | 0.4860 |
| 0.5030 | 0.5620 |
| 0.6010 | 0.6500 |
| 0.7010 | 0.7370 |
| 0.8010 | 0.8220 |
| 0.8990 | 0.9090 |
| 0.9500 | 0.9540 |
| 1.0000 | 1.0000 |
Mole fraction of o-Xylene (2) [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of o-Xylene (2) - Liquid | Mole fraction of o-Xylene (2) - Gas |
|---|---|
| 0.0000 | 0.0000 |
| 0.0590 | 0.0840 |
| 0.1060 | 0.1460 |
| 0.2030 | 0.2630 |
| 0.2710 | 0.3370 |
| 0.4200 | 0.4860 |
| 0.5030 | 0.5620 |
| 0.6010 | 0.6500 |
| 0.7010 | 0.7370 |
| 0.8010 | 0.8220 |
| 0.8990 | 0.9090 |
| 0.9500 | 0.9540 |
| 1.0000 | 1.0000 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0000 | 0.0009 |
| 288.15 | 0.0915 | 0.0009 |
| 288.15 | 0.1980 | 0.0009 |
| 288.15 | 0.3680 | 0.0009 |
| 288.15 | 0.4954 | 0.0010 |
| 288.15 | 0.6554 | 0.0010 |
| 288.15 | 0.7660 | 0.0011 |
| 288.15 | 0.8680 | 0.0011 |
| 288.15 | 0.9160 | 0.0012 |
| 288.15 | 0.9490 | 0.0012 |
| 288.15 | 1.0000 | 0.0012 |
| 293.15 | 0.0000 | 0.0008 |
| 293.15 | 0.0915 | 0.0008 |
| 293.15 | 0.1980 | 0.0008 |
| 293.15 | 0.3680 | 0.0009 |
| 293.15 | 0.4954 | 0.0009 |
| 293.15 | 0.6554 | 0.0009 |
| 293.15 | 0.7660 | 0.0010 |
| 293.15 | 0.8680 | 0.0010 |
| 293.15 | 0.9160 | 0.0011 |
| 293.15 | 0.9490 | 0.0011 |
| 293.15 | 1.0000 | 0.0011 |
| 298.15 | 0.0000 | 0.0008 |
| 298.15 | 0.0915 | 0.0008 |
| 298.15 | 0.1980 | 0.0008 |
| 298.15 | 0.3680 | 0.0008 |
| 298.15 | 0.4954 | 0.0008 |
| 298.15 | 0.6554 | 0.0009 |
| 298.15 | 0.7660 | 0.0009 |
| 298.15 | 0.8680 | 0.0010 |
| 298.15 | 0.9160 | 0.0010 |
| 298.15 | 0.9490 | 0.0010 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0007 |
| 303.15 | 0.0915 | 0.0007 |
| 303.15 | 0.1980 | 0.0007 |
| 303.15 | 0.3680 | 0.0008 |
| 303.15 | 0.4954 | 0.0008 |
| 303.15 | 0.6554 | 0.0008 |
| 303.15 | 0.7660 | 0.0008 |
| 303.15 | 0.8680 | 0.0009 |
| 303.15 | 0.9160 | 0.0009 |
| 303.15 | 0.9490 | 0.0009 |
| 303.15 | 1.0000 | 0.0009 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Viscosity, Pa*s - Liquid |
| 288.15 | 0.0000 | 0.0009 |
| 288.15 | 0.0915 | 0.0009 |
| 288.15 | 0.1980 | 0.0009 |
| 288.15 | 0.3680 | 0.0009 |
| 288.15 | 0.4954 | 0.0010 |
| 288.15 | 0.6554 | 0.0010 |
| 288.15 | 0.7660 | 0.0011 |
| 288.15 | 0.8680 | 0.0011 |
| 288.15 | 0.9160 | 0.0012 |
| 288.15 | 0.9490 | 0.0012 |
| 288.15 | 1.0000 | 0.0012 |
| 293.15 | 0.0000 | 0.0008 |
| 293.15 | 0.0915 | 0.0008 |
| 293.15 | 0.1980 | 0.0008 |
| 293.15 | 0.3680 | 0.0009 |
| 293.15 | 0.4954 | 0.0009 |
| 293.15 | 0.6554 | 0.0009 |
| 293.15 | 0.7660 | 0.0010 |
| 293.15 | 0.8680 | 0.0010 |
| 293.15 | 0.9160 | 0.0011 |
| 293.15 | 0.9490 | 0.0011 |
| 293.15 | 1.0000 | 0.0011 |
| 298.15 | 0.0000 | 0.0008 |
| 298.15 | 0.0915 | 0.0008 |
| 298.15 | 0.1980 | 0.0008 |
| 298.15 | 0.3680 | 0.0008 |
| 298.15 | 0.4954 | 0.0008 |
| 298.15 | 0.6554 | 0.0009 |
| 298.15 | 0.7660 | 0.0009 |
| 298.15 | 0.8680 | 0.0010 |
| 298.15 | 0.9160 | 0.0010 |
| 298.15 | 0.9490 | 0.0010 |
| 298.15 | 1.0000 | 0.0010 |
| 303.15 | 0.0000 | 0.0007 |
| 303.15 | 0.0915 | 0.0007 |
| 303.15 | 0.1980 | 0.0007 |
| 303.15 | 0.3680 | 0.0008 |
| 303.15 | 0.4954 | 0.0008 |
| 303.15 | 0.6554 | 0.0008 |
| 303.15 | 0.7660 | 0.0008 |
| 303.15 | 0.8680 | 0.0009 |
| 303.15 | 0.9160 | 0.0009 |
| 303.15 | 0.9490 | 0.0009 |
| 303.15 | 1.0000 | 0.0009 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.15 | 0.0000 | 1.5072 |
| 288.15 | 0.0984 | 1.5091 |
| 288.15 | 0.2473 | 1.5118 |
| 288.15 | 0.3760 | 1.5141 |
| 288.15 | 0.4951 | 1.516 |
| 288.15 | 0.6454 | 1.5193 |
| 288.15 | 0.7463 | 1.521 |
| 288.15 | 0.8640 | 1.5232 |
| 288.15 | 0.9380 | 1.5245 |
| 288.15 | 0.9745 | 1.5252 |
| 288.15 | 1.0000 | 1.5256 |
| 293.15 | 0.0000 | 1.5047 |
| 293.15 | 0.0984 | 1.5061 |
| 293.15 | 0.2473 | 1.508 |
| 293.15 | 0.3760 | 1.5095 |
| 293.15 | 0.4951 | 1.5107 |
| 293.15 | 0.6454 | 1.5128 |
| 293.15 | 0.7463 | 1.5145 |
| 293.15 | 0.8640 | 1.5156 |
| 293.15 | 0.9380 | 1.5164 |
| 293.15 | 0.9745 | 1.5167 |
| 293.15 | 1.0000 | 1.5169 |
| 298.15 | 0.0000 | 1.5018 |
| 298.15 | 0.0984 | 1.5033 |
| 298.15 | 0.2473 | 1.5052 |
| 298.15 | 0.3760 | 1.5067 |
| 298.15 | 0.4951 | 1.5079 |
| 298.15 | 0.6454 | 1.51 |
| 298.15 | 0.7463 | 1.5117 |
| 298.15 | 0.8640 | 1.5128 |
| 298.15 | 0.9380 | 1.5136 |
| 298.15 | 0.9745 | 1.5139 |
| 298.15 | 1.0000 | 1.5141 |
| 303.15 | 0.0000 | 1.5 |
| 303.15 | 0.0984 | 1.5015 |
| 303.15 | 0.2473 | 1.5027 |
| 303.15 | 0.3760 | 1.5048 |
| 303.15 | 0.4951 | 1.5059 |
| 303.15 | 0.6454 | 1.508 |
| 303.15 | 0.7463 | 1.5096 |
| 303.15 | 0.8640 | 1.5107 |
| 303.15 | 0.9380 | 1.5114 |
| 303.15 | 0.9745 | 1.5116 |
| 303.15 | 1.0000 | 1.5117 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid)
- Pressure, kPa = 93.13 (Liquid)
| Mole fraction of o-Xylene (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.517 |
| 0.0825 | 1.5159 |
| 0.1066 | 1.5156 |
| 0.1439 | 1.5151 |
| 0.1945 | 1.5144 |
| 0.2976 | 1.5131 |
| 0.3812 | 1.512 |
| 0.4796 | 1.5109 |
| 0.6170 | 1.5092 |
| 0.6785 | 1.5084 |
| 0.7801 | 1.5072 |
| 0.9159 | 1.5057 |
| 0.9329 | 1.5056 |
| 1.0000 | 1.5048 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Refractive index (Na D-line) - Liquid |
| 288.15 | 0.0000 | 1.5072 |
| 288.15 | 0.0984 | 1.5091 |
| 288.15 | 0.2473 | 1.5118 |
| 288.15 | 0.3760 | 1.5141 |
| 288.15 | 0.4951 | 1.516 |
| 288.15 | 0.6454 | 1.5193 |
| 288.15 | 0.7463 | 1.521 |
| 288.15 | 0.8640 | 1.5232 |
| 288.15 | 0.9380 | 1.5245 |
| 288.15 | 0.9745 | 1.5252 |
| 288.15 | 1.0000 | 1.5256 |
| 293.15 | 0.0000 | 1.5047 |
| 293.15 | 0.0984 | 1.5061 |
| 293.15 | 0.2473 | 1.508 |
| 293.15 | 0.3760 | 1.5095 |
| 293.15 | 0.4951 | 1.5107 |
| 293.15 | 0.6454 | 1.5128 |
| 293.15 | 0.7463 | 1.5145 |
| 293.15 | 0.8640 | 1.5156 |
| 293.15 | 0.9380 | 1.5164 |
| 293.15 | 0.9745 | 1.5167 |
| 293.15 | 1.0000 | 1.5169 |
| 298.15 | 0.0000 | 1.5018 |
| 298.15 | 0.0984 | 1.5033 |
| 298.15 | 0.2473 | 1.5052 |
| 298.15 | 0.3760 | 1.5067 |
| 298.15 | 0.4951 | 1.5079 |
| 298.15 | 0.6454 | 1.51 |
| 298.15 | 0.7463 | 1.5117 |
| 298.15 | 0.8640 | 1.5128 |
| 298.15 | 0.9380 | 1.5136 |
| 298.15 | 0.9745 | 1.5139 |
| 298.15 | 1.0000 | 1.5141 |
| 303.15 | 0.0000 | 1.5 |
| 303.15 | 0.0984 | 1.5015 |
| 303.15 | 0.2473 | 1.5027 |
| 303.15 | 0.3760 | 1.5048 |
| 303.15 | 0.4951 | 1.5059 |
| 303.15 | 0.6454 | 1.508 |
| 303.15 | 0.7463 | 1.5096 |
| 303.15 | 0.8640 | 1.5107 |
| 303.15 | 0.9380 | 1.5114 |
| 303.15 | 0.9745 | 1.5116 |
| 303.15 | 1.0000 | 1.5117 |
Refractive index (Na D-line) [ref]
Operational conditions:
- Temperature, K = 293.15 (Liquid)
- Pressure, kPa = 93.13 (Liquid)
| Mole fraction of o-Xylene (2) - Liquid | Refractive index (Na D-line) - Liquid |
|---|---|
| 0.0000 | 1.517 |
| 0.0825 | 1.5159 |
| 0.1066 | 1.5156 |
| 0.1439 | 1.5151 |
| 0.1945 | 1.5144 |
| 0.2976 | 1.5131 |
| 0.3812 | 1.512 |
| 0.4796 | 1.5109 |
| 0.6170 | 1.5092 |
| 0.6785 | 1.5084 |
| 0.7801 | 1.5072 |
| 0.9159 | 1.5057 |
| 0.9329 | 1.5056 |
| 1.0000 | 1.5048 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 883.29 |
| 288.15 | 0.0984 | 894.18 |
| 288.15 | 0.2473 | 910.8 |
| 288.15 | 0.3760 | 925.35 |
| 288.15 | 0.4951 | 939.01 |
| 288.15 | 0.6454 | 956.51 |
| 288.15 | 0.7463 | 968.37 |
| 288.15 | 0.8640 | 982.31 |
| 288.15 | 0.9380 | 991.11 |
| 288.15 | 0.9745 | 995.42 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 879.08 |
| 293.15 | 0.0984 | 890.01 |
| 293.15 | 0.2473 | 906.56 |
| 293.15 | 0.3760 | 921.0 |
| 293.15 | 0.4951 | 934.55 |
| 293.15 | 0.6454 | 951.98 |
| 293.15 | 0.7463 | 963.81 |
| 293.15 | 0.8640 | 977.72 |
| 293.15 | 0.9380 | 986.44 |
| 293.15 | 0.9745 | 990.69 |
| 293.15 | 1.0000 | 993.65 |
| 298.15 | 0.0000 | 875.53 |
| 298.15 | 0.0984 | 886.52 |
| 298.15 | 0.2473 | 902.92 |
| 298.15 | 0.3760 | 917.17 |
| 298.15 | 0.4951 | 930.58 |
| 298.15 | 0.6454 | 947.89 |
| 298.15 | 0.7463 | 959.66 |
| 298.15 | 0.8640 | 973.49 |
| 298.15 | 0.9380 | 982.08 |
| 298.15 | 0.9745 | 986.24 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 870.73 |
| 303.15 | 0.0984 | 881.84 |
| 303.15 | 0.2473 | 898.24 |
| 303.15 | 0.3760 | 912.46 |
| 303.15 | 0.4951 | 925.89 |
| 303.15 | 0.6454 | 943.26 |
| 303.15 | 0.7463 | 955.11 |
| 303.15 | 0.8640 | 968.92 |
| 303.15 | 0.9380 | 977.48 |
| 303.15 | 0.9745 | 981.57 |
| 303.15 | 1.0000 | 984.37 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 883.285 |
| 288.15 | 0.0915 | 893.348 |
| 288.15 | 0.1980 | 905.888 |
| 288.15 | 0.3680 | 924.439 |
| 288.15 | 0.4954 | 938.936 |
| 288.15 | 0.6554 | 957.421 |
| 288.15 | 0.7660 | 970.279 |
| 288.15 | 0.8680 | 982.607 |
| 288.15 | 0.9160 | 988.769 |
| 288.15 | 0.9490 | 992.756 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 879.083 |
| 293.15 | 0.0915 | 889.076 |
| 293.15 | 0.1980 | 900.83 |
| 293.15 | 0.3680 | 919.973 |
| 293.15 | 0.4954 | 934.513 |
| 293.15 | 0.6554 | 953.102 |
| 293.15 | 0.7660 | 966.072 |
| 293.15 | 0.8680 | 978.09 |
| 293.15 | 0.9160 | 983.748 |
| 293.15 | 0.9490 | 987.635 |
| 293.15 | 1.0000 | 993.649 |
| 298.15 | 0.0000 | 875.532 |
| 298.15 | 0.0915 | 885.509 |
| 298.15 | 0.1980 | 897.159 |
| 298.15 | 0.3680 | 916.136 |
| 298.15 | 0.4954 | 930.569 |
| 298.15 | 0.6554 | 948.998 |
| 298.15 | 0.7660 | 961.882 |
| 298.15 | 0.8680 | 973.792 |
| 298.15 | 0.9160 | 979.418 |
| 298.15 | 0.9490 | 983.27 |
| 298.15 | 1.0000 | 989.104 |
| 303.15 | 0.0000 | 870.726 |
| 303.15 | 0.0915 | 880.756 |
| 303.15 | 0.1980 | 892.435 |
| 303.15 | 0.3680 | 911.407 |
| 303.15 | 0.4954 | 925.824 |
| 303.15 | 0.6554 | 944.269 |
| 303.15 | 0.7660 | 957.177 |
| 303.15 | 0.8680 | 969.125 |
| 303.15 | 0.9160 | 974.761 |
| 303.15 | 0.9490 | 978.63 |
| 303.15 | 1.0000 | 984.372 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 883.29 |
| 288.15 | 0.0984 | 894.18 |
| 288.15 | 0.2473 | 910.8 |
| 288.15 | 0.3760 | 925.35 |
| 288.15 | 0.4951 | 939.01 |
| 288.15 | 0.6454 | 956.51 |
| 288.15 | 0.7463 | 968.37 |
| 288.15 | 0.8640 | 982.31 |
| 288.15 | 0.9380 | 991.11 |
| 288.15 | 0.9745 | 995.42 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 879.08 |
| 293.15 | 0.0984 | 890.01 |
| 293.15 | 0.2473 | 906.56 |
| 293.15 | 0.3760 | 921.0 |
| 293.15 | 0.4951 | 934.55 |
| 293.15 | 0.6454 | 951.98 |
| 293.15 | 0.7463 | 963.81 |
| 293.15 | 0.8640 | 977.72 |
| 293.15 | 0.9380 | 986.44 |
| 293.15 | 0.9745 | 990.69 |
| 293.15 | 1.0000 | 993.65 |
| 298.15 | 0.0000 | 875.53 |
| 298.15 | 0.0984 | 886.52 |
| 298.15 | 0.2473 | 902.92 |
| 298.15 | 0.3760 | 917.17 |
| 298.15 | 0.4951 | 930.58 |
| 298.15 | 0.6454 | 947.89 |
| 298.15 | 0.7463 | 959.66 |
| 298.15 | 0.8640 | 973.49 |
| 298.15 | 0.9380 | 982.08 |
| 298.15 | 0.9745 | 986.24 |
| 298.15 | 1.0000 | 989.15 |
| 303.15 | 0.0000 | 870.73 |
| 303.15 | 0.0984 | 881.84 |
| 303.15 | 0.2473 | 898.24 |
| 303.15 | 0.3760 | 912.46 |
| 303.15 | 0.4951 | 925.89 |
| 303.15 | 0.6454 | 943.26 |
| 303.15 | 0.7463 | 955.11 |
| 303.15 | 0.8640 | 968.92 |
| 303.15 | 0.9380 | 977.48 |
| 303.15 | 0.9745 | 981.57 |
| 303.15 | 1.0000 | 984.37 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Mass density, kg/m3 - Liquid |
| 288.15 | 0.0000 | 883.285 |
| 288.15 | 0.0915 | 893.348 |
| 288.15 | 0.1980 | 905.888 |
| 288.15 | 0.3680 | 924.439 |
| 288.15 | 0.4954 | 938.936 |
| 288.15 | 0.6554 | 957.421 |
| 288.15 | 0.7660 | 970.279 |
| 288.15 | 0.8680 | 982.607 |
| 288.15 | 0.9160 | 988.769 |
| 288.15 | 0.9490 | 992.756 |
| 288.15 | 1.0000 | 998.44 |
| 293.15 | 0.0000 | 879.083 |
| 293.15 | 0.0915 | 889.076 |
| 293.15 | 0.1980 | 900.83 |
| 293.15 | 0.3680 | 919.973 |
| 293.15 | 0.4954 | 934.513 |
| 293.15 | 0.6554 | 953.102 |
| 293.15 | 0.7660 | 966.072 |
| 293.15 | 0.8680 | 978.09 |
| 293.15 | 0.9160 | 983.748 |
| 293.15 | 0.9490 | 987.635 |
| 293.15 | 1.0000 | 993.649 |
| 298.15 | 0.0000 | 875.532 |
| 298.15 | 0.0915 | 885.509 |
| 298.15 | 0.1980 | 897.159 |
| 298.15 | 0.3680 | 916.136 |
| 298.15 | 0.4954 | 930.569 |
| 298.15 | 0.6554 | 948.998 |
| 298.15 | 0.7660 | 961.882 |
| 298.15 | 0.8680 | 973.792 |
| 298.15 | 0.9160 | 979.418 |
| 298.15 | 0.9490 | 983.27 |
| 298.15 | 1.0000 | 989.104 |
| 303.15 | 0.0000 | 870.726 |
| 303.15 | 0.0915 | 880.756 |
| 303.15 | 0.1980 | 892.435 |
| 303.15 | 0.3680 | 911.407 |
| 303.15 | 0.4954 | 925.824 |
| 303.15 | 0.6554 | 944.269 |
| 303.15 | 0.7660 | 957.177 |
| 303.15 | 0.8680 | 969.125 |
| 303.15 | 0.9160 | 974.761 |
| 303.15 | 0.9490 | 978.63 |
| 303.15 | 1.0000 | 984.372 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1390.35 |
| 288.15 | 0.0915 | 1394.98 |
| 288.15 | 0.1980 | 1402.31 |
| 288.15 | 0.3680 | 1409.02 |
| 288.15 | 0.4954 | 1415.73 |
| 288.15 | 0.6554 | 1424.72 |
| 288.15 | 0.7660 | 1431.25 |
| 288.15 | 0.8680 | 1439.41 |
| 288.15 | 0.9160 | 1444.5 |
| 288.15 | 0.9490 | 1447.09 |
| 288.15 | 1.0000 | 1449.09 |
| 293.15 | 0.0000 | 1369.74 |
| 293.15 | 0.0915 | 1374.42 |
| 293.15 | 0.1980 | 1381.74 |
| 293.15 | 0.3680 | 1388.31 |
| 293.15 | 0.4954 | 1394.86 |
| 293.15 | 0.6554 | 1403.87 |
| 293.15 | 0.7660 | 1410.43 |
| 293.15 | 0.8680 | 1418.61 |
| 293.15 | 0.9160 | 1424.01 |
| 293.15 | 0.9490 | 1426.64 |
| 293.15 | 1.0000 | 1428.45 |
| 298.15 | 0.0000 | 1349.39 |
| 298.15 | 0.0915 | 1354.0 |
| 298.15 | 0.1980 | 1359.5 |
| 298.15 | 0.3680 | 1368.57 |
| 298.15 | 0.4954 | 1375.7 |
| 298.15 | 0.6554 | 1385.12 |
| 298.15 | 0.7660 | 1391.92 |
| 298.15 | 0.8680 | 1398.63 |
| 298.15 | 0.9160 | 1402.04 |
| 298.15 | 0.9490 | 1404.3 |
| 298.15 | 1.0000 | 1408.02 |
| 303.15 | 0.0000 | 1328.3 |
| 303.15 | 0.0915 | 1333.42 |
| 303.15 | 0.1980 | 1339.34 |
| 303.15 | 0.3680 | 1348.75 |
| 303.15 | 0.4954 | 1355.92 |
| 303.15 | 0.6554 | 1365.15 |
| 303.15 | 0.7660 | 1371.8 |
| 303.15 | 0.8680 | 1378.13 |
| 303.15 | 0.9160 | 1381.2 |
| 303.15 | 0.9490 | 1383.33 |
| 303.15 | 1.0000 | 1386.66 |
Speed of sound, m/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Anisole (1) - Liquid | Speed of sound, m/s - Liquid |
| 288.15 | 0.0000 | 1390.35 |
| 288.15 | 0.0915 | 1394.98 |
| 288.15 | 0.1980 | 1402.31 |
| 288.15 | 0.3680 | 1409.02 |
| 288.15 | 0.4954 | 1415.73 |
| 288.15 | 0.6554 | 1424.72 |
| 288.15 | 0.7660 | 1431.25 |
| 288.15 | 0.8680 | 1439.41 |
| 288.15 | 0.9160 | 1444.5 |
| 288.15 | 0.9490 | 1447.09 |
| 288.15 | 1.0000 | 1449.09 |
| 293.15 | 0.0000 | 1369.74 |
| 293.15 | 0.0915 | 1374.42 |
| 293.15 | 0.1980 | 1381.74 |
| 293.15 | 0.3680 | 1388.31 |
| 293.15 | 0.4954 | 1394.86 |
| 293.15 | 0.6554 | 1403.87 |
| 293.15 | 0.7660 | 1410.43 |
| 293.15 | 0.8680 | 1418.61 |
| 293.15 | 0.9160 | 1424.01 |
| 293.15 | 0.9490 | 1426.64 |
| 293.15 | 1.0000 | 1428.45 |
| 298.15 | 0.0000 | 1349.39 |
| 298.15 | 0.0915 | 1354.0 |
| 298.15 | 0.1980 | 1359.5 |
| 298.15 | 0.3680 | 1368.57 |
| 298.15 | 0.4954 | 1375.7 |
| 298.15 | 0.6554 | 1385.12 |
| 298.15 | 0.7660 | 1391.92 |
| 298.15 | 0.8680 | 1398.63 |
| 298.15 | 0.9160 | 1402.04 |
| 298.15 | 0.9490 | 1404.3 |
| 298.15 | 1.0000 | 1408.02 |
| 303.15 | 0.0000 | 1328.3 |
| 303.15 | 0.0915 | 1333.42 |
| 303.15 | 0.1980 | 1339.34 |
| 303.15 | 0.3680 | 1348.75 |
| 303.15 | 0.4954 | 1355.92 |
| 303.15 | 0.6554 | 1365.15 |
| 303.15 | 0.7660 | 1371.8 |
| 303.15 | 0.8680 | 1378.13 |
| 303.15 | 0.9160 | 1381.2 |
| 303.15 | 0.9490 | 1383.33 |
| 303.15 | 1.0000 | 1386.66 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of o-Xylene (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 423.38 |
| 0.0590 | 422.33 |
| 0.1060 | 421.58 |
| 0.2030 | 420.20 |
| 0.2710 | 419.36 |
| 0.4200 | 417.82 |
| 0.5030 | 417.11 |
| 0.6010 | 416.38 |
| 0.7010 | 415.74 |
| 0.8010 | 415.21 |
| 0.8990 | 414.77 |
| 0.9500 | 414.57 |
| 1.0000 | 414.41 |
Boiling temperature at pressure P, K [ref]
Operational condition: Pressure, kPa = 93.13 (Liquid)
| Mole fraction of o-Xylene (2) - Liquid | Boiling temperature at pressure P, K - Liquid |
|---|---|
| 0.0000 | 423.38 |
| 0.0590 | 422.33 |
| 0.1060 | 421.58 |
| 0.2030 | 420.20 |
| 0.2710 | 419.36 |
| 0.4200 | 417.82 |
| 0.5030 | 417.11 |
| 0.6010 | 416.38 |
| 0.7010 | 415.74 |
| 0.8010 | 415.21 |
| 0.8990 | 414.77 |
| 0.9500 | 414.57 |
| 1.0000 | 414.41 |
Sources
- Excess molar volumes and refractive indices of (methoxybenzene + benzene, or toluene, or o-xylene, or m-xylene, or p-xylene, or mesitylene) binary mixtures between T = (288.15 to 303.15) K
- Refractive Index and Vapor-Liquid Equilibrium Data for the Binary Systems of Anisole with Xylene Isomers at 93.13 kPa
- Viscosities, Densities, and Speeds of Sound of Binary Mixtures of Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Mesitylene with Anisole at (288.15, 293.15, 298.15, and 303.15) K