- Name
- Benzene
- InChI
- InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H
- InChI Key
- UHOVQNZJYSORNB-UHFFFAOYSA-N
- Formula
- C6H6
- SMILES
- c1ccccc1
- Mol. Weight (g/mol)
- 78.11
- CAS
- 71-43-2
- Name
- Dimethyl Sulfoxide
- InChI
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- InChI Key
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N
- Formula
- C2H6OS
- SMILES
- CS(C)=O
- Mol. Weight (g/mol)
- 78.13
- CAS
- 67-68-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Activity coefficient of Benzene (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene (1) - Liquid | Activity coefficient of Benzene (1) - Liquid |
| 298.15 | 0.0000 | 3.05 |
Activity coefficient of Benzene (1) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene (1) - Liquid | Activity coefficient of Benzene (1) - Liquid |
| 298.15 | 0.0000 | 3.05 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0589 | 1084.47 |
| 293.15 | 0.1255 | 1067.5 |
| 293.15 | 0.1852 | 1052.58 |
| 293.15 | 0.2561 | 1035.37 |
| 293.15 | 0.2934 | 1026.52 |
| 293.15 | 0.3345 | 1016.91 |
| 293.15 | 0.3782 | 1006.87 |
| 293.15 | 0.4312 | 994.89 |
| 293.15 | 0.4757 | 985.02 |
| 293.15 | 0.5963 | 958.97 |
| 293.15 | 0.6875 | 939.81 |
| 293.15 | 0.7369 | 929.61 |
| 293.15 | 0.8637 | 903.71 |
| 293.15 | 0.9562 | 885.02 |
| 303.15 | 0.0596 | 1075.16 |
| 303.15 | 0.1345 | 1056.18 |
| 303.15 | 0.1940 | 1041.49 |
| 303.15 | 0.2473 | 1028.63 |
| 303.15 | 0.2893 | 1018.74 |
| 303.15 | 0.3465 | 1005.44 |
| 303.15 | 0.4213 | 988.61 |
| 303.15 | 0.4835 | 974.94 |
| 303.15 | 0.5431 | 962.12 |
| 303.15 | 0.5968 | 950.76 |
| 303.15 | 0.6763 | 934.26 |
| 303.15 | 0.7781 | 913.49 |
| 303.15 | 0.8511 | 898.8 |
| 303.15 | 0.9542 | 878.27 |
| 313.15 | 0.0590 | 1064.91 |
| 313.15 | 0.1267 | 1047.76 |
| 313.15 | 0.1873 | 1032.78 |
| 313.15 | 0.2676 | 1013.53 |
| 313.15 | 0.2933 | 1007.51 |
| 313.15 | 0.3378 | 997.22 |
| 313.15 | 0.4321 | 976.04 |
| 313.15 | 0.4752 | 966.67 |
| 313.15 | 0.5514 | 950.39 |
| 313.15 | 0.6011 | 939.97 |
| 313.15 | 0.6837 | 923.0 |
| 313.15 | 0.7653 | 906.53 |
| 313.15 | 0.8681 | 886.1 |
| 313.15 | 0.9499 | 870.0 |
| 323.15 | 0.0602 | 1054.55 |
| 323.15 | 0.1257 | 1038.36 |
| 323.15 | 0.1833 | 1024.43 |
| 323.15 | 0.2512 | 1008.48 |
| 323.15 | 0.3294 | 990.67 |
| 323.15 | 0.3931 | 976.6 |
| 323.15 | 0.4615 | 961.88 |
| 323.15 | 0.5232 | 948.95 |
| 323.15 | 0.5972 | 933.77 |
| 323.15 | 0.6502 | 923.09 |
| 323.15 | 0.7149 | 910.25 |
| 323.15 | 0.7896 | 895.64 |
| 323.15 | 0.8788 | 878.39 |
| 323.15 | 0.9556 | 863.66 |
| 333.15 | 0.0593 | 1044.75 |
| 333.15 | 0.1279 | 1028.18 |
| 333.15 | 0.1801 | 1015.83 |
| 333.15 | 0.2566 | 998.31 |
| 333.15 | 0.3263 | 982.84 |
| 333.15 | 0.3862 | 969.9 |
| 333.15 | 0.4523 | 955.99 |
| 333.15 | 0.5213 | 941.87 |
| 333.15 | 0.5869 | 928.72 |
| 333.15 | 0.6532 | 915.7 |
| 333.15 | 0.7256 | 901.71 |
| 333.15 | 0.7959 | 888.33 |
| 333.15 | 0.8864 | 871.29 |
| 333.15 | 0.9116 | 866.58 |
| 343.15 | 0.0593 | 1034.67 |
| 343.15 | 0.1356 | 1016.68 |
| 343.15 | 0.2182 | 997.86 |
| 343.15 | 0.2636 | 987.78 |
| 343.15 | 0.3296 | 973.51 |
| 343.15 | 0.3938 | 960.01 |
| 343.15 | 0.4686 | 944.74 |
| 343.15 | 0.5213 | 934.26 |
| 343.15 | 0.5769 | 923.38 |
| 343.15 | 0.6623 | 907.03 |
| 343.15 | 0.7385 | 892.7 |
| 343.15 | 0.7801 | 884.99 |
| 343.15 | 0.8569 | 870.86 |
| 343.15 | 0.9503 | 853.81 |
| 353.15 | 0.0580 | 1024.84 |
| 353.15 | 0.1585 | 1001.73 |
| 353.15 | 0.2335 | 985.09 |
| 353.15 | 0.3065 | 969.42 |
| 353.15 | 0.3765 | 954.93 |
| 353.15 | 0.4187 | 946.35 |
| 353.15 | 0.4682 | 936.49 |
| 353.15 | 0.5242 | 925.57 |
| 353.15 | 0.5912 | 912.8 |
| 353.15 | 0.6404 | 903.56 |
| 353.15 | 0.7556 | 882.4 |
| 353.15 | 0.8024 | 873.93 |
| 353.15 | 0.8701 | 861.79 |
| 353.15 | 0.9284 | 851.4 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Benzene (1) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0589 | 1084.47 |
| 293.15 | 0.1255 | 1067.5 |
| 293.15 | 0.1852 | 1052.58 |
| 293.15 | 0.2561 | 1035.37 |
| 293.15 | 0.2934 | 1026.52 |
| 293.15 | 0.3345 | 1016.91 |
| 293.15 | 0.3782 | 1006.87 |
| 293.15 | 0.4312 | 994.89 |
| 293.15 | 0.4757 | 985.02 |
| 293.15 | 0.5963 | 958.97 |
| 293.15 | 0.6875 | 939.81 |
| 293.15 | 0.7369 | 929.61 |
| 293.15 | 0.8637 | 903.71 |
| 293.15 | 0.9562 | 885.02 |
| 303.15 | 0.0596 | 1075.16 |
| 303.15 | 0.1345 | 1056.18 |
| 303.15 | 0.1940 | 1041.49 |
| 303.15 | 0.2473 | 1028.63 |
| 303.15 | 0.2893 | 1018.74 |
| 303.15 | 0.3465 | 1005.44 |
| 303.15 | 0.4213 | 988.61 |
| 303.15 | 0.4835 | 974.94 |
| 303.15 | 0.5431 | 962.12 |
| 303.15 | 0.5968 | 950.76 |
| 303.15 | 0.6763 | 934.26 |
| 303.15 | 0.7781 | 913.49 |
| 303.15 | 0.8511 | 898.8 |
| 303.15 | 0.9542 | 878.27 |
| 313.15 | 0.0590 | 1064.91 |
| 313.15 | 0.1267 | 1047.76 |
| 313.15 | 0.1873 | 1032.78 |
| 313.15 | 0.2676 | 1013.53 |
| 313.15 | 0.2933 | 1007.51 |
| 313.15 | 0.3378 | 997.22 |
| 313.15 | 0.4321 | 976.04 |
| 313.15 | 0.4752 | 966.67 |
| 313.15 | 0.5514 | 950.39 |
| 313.15 | 0.6011 | 939.97 |
| 313.15 | 0.6837 | 923.0 |
| 313.15 | 0.7653 | 906.53 |
| 313.15 | 0.8681 | 886.1 |
| 313.15 | 0.9499 | 870.0 |
| 323.15 | 0.0602 | 1054.55 |
| 323.15 | 0.1257 | 1038.36 |
| 323.15 | 0.1833 | 1024.43 |
| 323.15 | 0.2512 | 1008.48 |
| 323.15 | 0.3294 | 990.67 |
| 323.15 | 0.3931 | 976.6 |
| 323.15 | 0.4615 | 961.88 |
| 323.15 | 0.5232 | 948.95 |
| 323.15 | 0.5972 | 933.77 |
| 323.15 | 0.6502 | 923.09 |
| 323.15 | 0.7149 | 910.25 |
| 323.15 | 0.7896 | 895.64 |
| 323.15 | 0.8788 | 878.39 |
| 323.15 | 0.9556 | 863.66 |
| 333.15 | 0.0593 | 1044.75 |
| 333.15 | 0.1279 | 1028.18 |
| 333.15 | 0.1801 | 1015.83 |
| 333.15 | 0.2566 | 998.31 |
| 333.15 | 0.3263 | 982.84 |
| 333.15 | 0.3862 | 969.9 |
| 333.15 | 0.4523 | 955.99 |
| 333.15 | 0.5213 | 941.87 |
| 333.15 | 0.5869 | 928.72 |
| 333.15 | 0.6532 | 915.7 |
| 333.15 | 0.7256 | 901.71 |
| 333.15 | 0.7959 | 888.33 |
| 333.15 | 0.8864 | 871.29 |
| 333.15 | 0.9116 | 866.58 |
| 343.15 | 0.0593 | 1034.67 |
| 343.15 | 0.1356 | 1016.68 |
| 343.15 | 0.2182 | 997.86 |
| 343.15 | 0.2636 | 987.78 |
| 343.15 | 0.3296 | 973.51 |
| 343.15 | 0.3938 | 960.01 |
| 343.15 | 0.4686 | 944.74 |
| 343.15 | 0.5213 | 934.26 |
| 343.15 | 0.5769 | 923.38 |
| 343.15 | 0.6623 | 907.03 |
| 343.15 | 0.7385 | 892.7 |
| 343.15 | 0.7801 | 884.99 |
| 343.15 | 0.8569 | 870.86 |
| 343.15 | 0.9503 | 853.81 |
| 353.15 | 0.0580 | 1024.84 |
| 353.15 | 0.1585 | 1001.73 |
| 353.15 | 0.2335 | 985.09 |
| 353.15 | 0.3065 | 969.42 |
| 353.15 | 0.3765 | 954.93 |
| 353.15 | 0.4187 | 946.35 |
| 353.15 | 0.4682 | 936.49 |
| 353.15 | 0.5242 | 925.57 |
| 353.15 | 0.5912 | 912.8 |
| 353.15 | 0.6404 | 903.56 |
| 353.15 | 0.7556 | 882.4 |
| 353.15 | 0.8024 | 873.93 |
| 353.15 | 0.8701 | 861.79 |
| 353.15 | 0.9284 | 851.4 |
Sources
- Experimental densities and excess volumes for binary mixtures of (dimethyl sulfoxide + an aromatic hydrocarbon) at temperatures from (293.15 to 353.15) K at atmospheric pressure
- Measurement of Activity Coefficients of Solutes at Infinite Dilution in (Dimethyl Sulfoxide + Acetamide, or Formamide, or Urea) Using Gas Liquid Chromatography at the Temperature 298.15 K