- Name
- 1-Butanamine
- InChI
- InChI=1S/C4H11N/c1-2-3-4-5/h2-5H2,1H3
- InChI Key
- HQABUPZFAYXKJW-UHFFFAOYSA-N
- Formula
- C4H11N
- SMILES
- CCCCN
- Mol. Weight (g/mol)
- 73.14
- CAS
- 109-73-9
- Name
- Formamide, N,N-dimethyl-
- InChI
- InChI=1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3
- InChI Key
- ZMXDDKWLCZADIW-UHFFFAOYSA-N
- Formula
- C3H7NO
- SMILES
- CN(C)C=O
- Mol. Weight (g/mol)
- 73.09
- CAS
- 68-12-2
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- Excess molar enthalpy (molar enthalpy (2)
- n0 - Refractive index (Na D-line) (2)
- ρl - Mass density, kg/m3 (2)
- csound,fluid - Speed of Sound, m/s (2)
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0510 | 0.0890 |
| 0.1009 | 0.1660 |
| 0.1496 | 0.2260 |
| 0.1703 | 0.2470 |
| 0.2005 | 0.2790 |
| 0.2498 | 0.3200 |
| 0.3007 | 0.3520 |
| 0.3496 | 0.3730 |
| 0.4008 | 0.3910 |
| 0.4508 | 0.3930 |
| 0.5008 | 0.3840 |
| 0.5463 | 0.3740 |
| 0.6008 | 0.3550 |
| 0.6463 | 0.3260 |
| 0.7011 | 0.2890 |
| 0.7559 | 0.2450 |
| 0.8005 | 0.2080 |
| 0.8495 | 0.1580 |
| 0.9003 | 0.1060 |
| 0.9519 | 0.0550 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Pressure, kPa = 101 (Liquid)
- Temperature, K = 298.15 (Liquid)
| Mole fraction of Formamide, N,N-dimethyl- (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.0510 | 0.0890 |
| 0.1009 | 0.1660 |
| 0.1496 | 0.2260 |
| 0.1703 | 0.2470 |
| 0.2005 | 0.2790 |
| 0.2498 | 0.3200 |
| 0.3007 | 0.3520 |
| 0.3496 | 0.3730 |
| 0.4008 | 0.3910 |
| 0.4508 | 0.3930 |
| 0.5008 | 0.3840 |
| 0.5463 | 0.3740 |
| 0.6008 | 0.3550 |
| 0.6463 | 0.3260 |
| 0.7011 | 0.2890 |
| 0.7559 | 0.2450 |
| 0.8005 | 0.2080 |
| 0.8495 | 0.1580 |
| 0.9003 | 0.1060 |
| 0.9519 | 0.0550 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0599 | 1.4022 |
| 293.15 | 0.1056 | 1.4035 |
| 293.15 | 0.1591 | 1.405 |
| 293.15 | 0.2010 | 1.4062 |
| 293.15 | 0.2505 | 1.4076 |
| 293.15 | 0.3017 | 1.4091 |
| 293.15 | 0.3583 | 1.4108 |
| 293.15 | 0.3992 | 1.412 |
| 293.15 | 0.4401 | 1.4132 |
| 293.15 | 0.5059 | 1.4152 |
| 293.15 | 0.6043 | 1.4183 |
| 293.15 | 0.6569 | 1.4199 |
| 293.15 | 0.6999 | 1.4213 |
| 293.15 | 0.7537 | 1.4229 |
| 293.15 | 0.8036 | 1.4245 |
| 293.15 | 0.8579 | 1.4262 |
| 293.15 | 0.9048 | 1.4276 |
| 293.15 | 0.9546 | 1.4291 |
| 298.15 | 0.0575 | 1.3995 |
| 298.15 | 0.1092 | 1.4009 |
| 298.15 | 0.1519 | 1.4022 |
| 298.15 | 0.2043 | 1.4037 |
| 298.15 | 0.2448 | 1.4048 |
| 298.15 | 0.3090 | 1.4068 |
| 298.15 | 0.3558 | 1.4082 |
| 298.15 | 0.5028 | 1.4127 |
| 298.15 | 0.6005 | 1.4158 |
| 298.15 | 0.6608 | 1.4177 |
| 298.15 | 0.6934 | 1.4187 |
| 298.15 | 0.7572 | 1.4208 |
| 298.15 | 0.8056 | 1.4223 |
| 298.15 | 0.8546 | 1.4238 |
| 298.15 | 0.9076 | 1.4255 |
| 298.15 | 0.9553 | 1.427 |
| 303.15 | 0.0505 | 1.3964 |
| 303.15 | 0.1477 | 1.3993 |
| 303.15 | 0.2019 | 1.4009 |
| 303.15 | 0.2410 | 1.4021 |
| 303.15 | 0.3024 | 1.4039 |
| 303.15 | 0.3558 | 1.4055 |
| 303.15 | 0.3992 | 1.4069 |
| 303.15 | 0.4358 | 1.408 |
| 303.15 | 0.5114 | 1.4104 |
| 303.15 | 0.5281 | 1.4109 |
| 303.15 | 0.6056 | 1.4134 |
| 303.15 | 0.6574 | 1.415 |
| 303.15 | 0.6960 | 1.4163 |
| 303.15 | 0.7558 | 1.4182 |
| 303.15 | 0.8006 | 1.4196 |
| 303.15 | 0.8544 | 1.4214 |
| 303.15 | 0.8998 | 1.4228 |
| 303.15 | 0.9466 | 1.4243 |
Refractive index (Na D-line) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (2) - Liquid | Refractive index (Na D-line) - Liquid |
| 293.15 | 0.0599 | 1.4022 |
| 293.15 | 0.1056 | 1.4035 |
| 293.15 | 0.1591 | 1.405 |
| 293.15 | 0.2010 | 1.4062 |
| 293.15 | 0.2505 | 1.4076 |
| 293.15 | 0.3017 | 1.4091 |
| 293.15 | 0.3583 | 1.4108 |
| 293.15 | 0.3992 | 1.412 |
| 293.15 | 0.4401 | 1.4132 |
| 293.15 | 0.5059 | 1.4152 |
| 293.15 | 0.6043 | 1.4183 |
| 293.15 | 0.6569 | 1.4199 |
| 293.15 | 0.6999 | 1.4213 |
| 293.15 | 0.7537 | 1.4229 |
| 293.15 | 0.8036 | 1.4245 |
| 293.15 | 0.8579 | 1.4262 |
| 293.15 | 0.9048 | 1.4276 |
| 293.15 | 0.9546 | 1.4291 |
| 298.15 | 0.0575 | 1.3995 |
| 298.15 | 0.1092 | 1.4009 |
| 298.15 | 0.1519 | 1.4022 |
| 298.15 | 0.2043 | 1.4037 |
| 298.15 | 0.2448 | 1.4048 |
| 298.15 | 0.3090 | 1.4068 |
| 298.15 | 0.3558 | 1.4082 |
| 298.15 | 0.5028 | 1.4127 |
| 298.15 | 0.6005 | 1.4158 |
| 298.15 | 0.6608 | 1.4177 |
| 298.15 | 0.6934 | 1.4187 |
| 298.15 | 0.7572 | 1.4208 |
| 298.15 | 0.8056 | 1.4223 |
| 298.15 | 0.8546 | 1.4238 |
| 298.15 | 0.9076 | 1.4255 |
| 298.15 | 0.9553 | 1.427 |
| 303.15 | 0.0505 | 1.3964 |
| 303.15 | 0.1477 | 1.3993 |
| 303.15 | 0.2019 | 1.4009 |
| 303.15 | 0.2410 | 1.4021 |
| 303.15 | 0.3024 | 1.4039 |
| 303.15 | 0.3558 | 1.4055 |
| 303.15 | 0.3992 | 1.4069 |
| 303.15 | 0.4358 | 1.408 |
| 303.15 | 0.5114 | 1.4104 |
| 303.15 | 0.5281 | 1.4109 |
| 303.15 | 0.6056 | 1.4134 |
| 303.15 | 0.6574 | 1.415 |
| 303.15 | 0.6960 | 1.4163 |
| 303.15 | 0.7558 | 1.4182 |
| 303.15 | 0.8006 | 1.4196 |
| 303.15 | 0.8544 | 1.4214 |
| 303.15 | 0.8998 | 1.4228 |
| 303.15 | 0.9466 | 1.4243 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0599 | 747.39 |
| 293.15 | 0.1056 | 755.445 |
| 293.15 | 0.1591 | 765.035 |
| 293.15 | 0.2505 | 782.005 |
| 293.15 | 0.3017 | 791.811 |
| 293.15 | 0.3583 | 802.88 |
| 293.15 | 0.3992 | 811.114 |
| 293.15 | 0.5059 | 833.13 |
| 293.15 | 0.5483 | 842.154 |
| 293.15 | 0.6569 | 866.102 |
| 293.15 | 0.6999 | 875.844 |
| 293.15 | 0.7537 | 888.314 |
| 293.15 | 0.8036 | 900.101 |
| 293.15 | 0.8579 | 913.315 |
| 293.15 | 0.9048 | 924.751 |
| 293.15 | 0.9546 | 937.212 |
| 298.15 | 0.0575 | 742.224 |
| 298.15 | 0.1092 | 751.333 |
| 298.15 | 0.1519 | 759.015 |
| 298.15 | 0.2043 | 768.674 |
| 298.15 | 0.2448 | 776.215 |
| 298.15 | 0.3090 | 788.51 |
| 298.15 | 0.3558 | 797.705 |
| 298.15 | 0.3986 | 806.285 |
| 298.15 | 0.4381 | 814.268 |
| 298.15 | 0.5028 | 827.736 |
| 298.15 | 0.6005 | 848.795 |
| 298.15 | 0.6934 | 869.781 |
| 298.15 | 0.7572 | 884.516 |
| 298.15 | 0.8056 | 895.958 |
| 298.15 | 0.9076 | 920.837 |
| 298.15 | 0.9553 | 932.723 |
| 303.15 | 0.0505 | 736.213 |
| 303.15 | 0.1477 | 753.539 |
| 303.15 | 0.2019 | 763.466 |
| 303.15 | 0.2410 | 770.708 |
| 303.15 | 0.3024 | 782.423 |
| 303.15 | 0.3558 | 792.882 |
| 303.15 | 0.4358 | 808.96 |
| 303.15 | 0.5114 | 824.673 |
| 303.15 | 0.5281 | 828.281 |
| 303.15 | 0.6056 | 845.104 |
| 303.15 | 0.6960 | 865.473 |
| 303.15 | 0.7558 | 879.286 |
| 303.15 | 0.8006 | 889.962 |
| 303.15 | 0.8544 | 902.88 |
| 303.15 | 0.8998 | 914.033 |
| 303.15 | 0.9466 | 925.732 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (2) - Liquid | Mass density, kg/m3 - Liquid |
| 293.15 | 0.0599 | 747.39 |
| 293.15 | 0.1056 | 755.445 |
| 293.15 | 0.1591 | 765.035 |
| 293.15 | 0.2505 | 782.005 |
| 293.15 | 0.3017 | 791.811 |
| 293.15 | 0.3583 | 802.88 |
| 293.15 | 0.3992 | 811.114 |
| 293.15 | 0.5059 | 833.13 |
| 293.15 | 0.5483 | 842.154 |
| 293.15 | 0.6569 | 866.102 |
| 293.15 | 0.6999 | 875.844 |
| 293.15 | 0.7537 | 888.314 |
| 293.15 | 0.8036 | 900.101 |
| 293.15 | 0.8579 | 913.315 |
| 293.15 | 0.9048 | 924.751 |
| 293.15 | 0.9546 | 937.212 |
| 298.15 | 0.0575 | 742.224 |
| 298.15 | 0.1092 | 751.333 |
| 298.15 | 0.1519 | 759.015 |
| 298.15 | 0.2043 | 768.674 |
| 298.15 | 0.2448 | 776.215 |
| 298.15 | 0.3090 | 788.51 |
| 298.15 | 0.3558 | 797.705 |
| 298.15 | 0.3986 | 806.285 |
| 298.15 | 0.4381 | 814.268 |
| 298.15 | 0.5028 | 827.736 |
| 298.15 | 0.6005 | 848.795 |
| 298.15 | 0.6934 | 869.781 |
| 298.15 | 0.7572 | 884.516 |
| 298.15 | 0.8056 | 895.958 |
| 298.15 | 0.9076 | 920.837 |
| 298.15 | 0.9553 | 932.723 |
| 303.15 | 0.0505 | 736.213 |
| 303.15 | 0.1477 | 753.539 |
| 303.15 | 0.2019 | 763.466 |
| 303.15 | 0.2410 | 770.708 |
| 303.15 | 0.3024 | 782.423 |
| 303.15 | 0.3558 | 792.882 |
| 303.15 | 0.4358 | 808.96 |
| 303.15 | 0.5114 | 824.673 |
| 303.15 | 0.5281 | 828.281 |
| 303.15 | 0.6056 | 845.104 |
| 303.15 | 0.6960 | 865.473 |
| 303.15 | 0.7558 | 879.286 |
| 303.15 | 0.8006 | 889.962 |
| 303.15 | 0.8544 | 902.88 |
| 303.15 | 0.8998 | 914.033 |
| 303.15 | 0.9466 | 925.732 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0599 | 1277.7 |
| 293.15 | 0.1056 | 1285.0 |
| 293.15 | 0.1591 | 1293.8 |
| 293.15 | 0.2505 | 1309.6 |
| 293.15 | 0.3017 | 1318.9 |
| 293.15 | 0.3583 | 1329.6 |
| 293.15 | 0.3992 | 1337.8 |
| 293.15 | 0.5059 | 1359.6 |
| 293.15 | 0.5483 | 1368.9 |
| 293.15 | 0.6569 | 1393.7 |
| 293.15 | 0.6999 | 1404.0 |
| 293.15 | 0.7537 | 1416.7 |
| 293.15 | 0.8036 | 1429.0 |
| 293.15 | 0.8579 | 1442.3 |
| 293.15 | 0.9048 | 1453.7 |
| 293.15 | 0.9546 | 1465.6 |
| 298.15 | 0.0575 | 1255.4 |
| 298.15 | 0.1092 | 1263.9 |
| 298.15 | 0.1519 | 1271.1 |
| 298.15 | 0.2043 | 1280.1 |
| 298.15 | 0.2448 | 1287.4 |
| 298.15 | 0.3090 | 1299.3 |
| 298.15 | 0.3558 | 1308.4 |
| 298.15 | 0.3986 | 1317.0 |
| 298.15 | 0.4381 | 1324.9 |
| 298.15 | 0.5028 | 1338.6 |
| 298.15 | 0.6005 | 1360.6 |
| 298.15 | 0.6934 | 1382.5 |
| 298.15 | 0.7572 | 1398.0 |
| 298.15 | 0.8056 | 1410.0 |
| 298.15 | 0.9076 | 1435.1 |
| 298.15 | 0.9553 | 1446.6 |
| 303.15 | 0.0505 | 1233.0 |
| 303.15 | 0.1477 | 1249.4 |
| 303.15 | 0.2019 | 1259.0 |
| 303.15 | 0.2410 | 1266.0 |
| 303.15 | 0.3024 | 1277.5 |
| 303.15 | 0.3558 | 1287.8 |
| 303.15 | 0.4358 | 1304.1 |
| 303.15 | 0.5114 | 1320.3 |
| 303.15 | 0.5281 | 1324.0 |
| 303.15 | 0.6056 | 1341.6 |
| 303.15 | 0.6960 | 1363.2 |
| 303.15 | 0.7558 | 1377.7 |
| 303.15 | 0.8006 | 1389.0 |
| 303.15 | 0.8544 | 1402.3 |
| 303.15 | 0.8998 | 1413.7 |
| 303.15 | 0.9466 | 1425.2 |
Speed of sound, m/s [ref]
Operational conditions:
- Pressure, kPa = 100 (Liquid)
- Frequency, MHz = 3 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Formamide, N,N-dimethyl- (2) - Liquid | Speed of sound, m/s - Liquid |
| 293.15 | 0.0599 | 1277.7 |
| 293.15 | 0.1056 | 1285.0 |
| 293.15 | 0.1591 | 1293.8 |
| 293.15 | 0.2505 | 1309.6 |
| 293.15 | 0.3017 | 1318.9 |
| 293.15 | 0.3583 | 1329.6 |
| 293.15 | 0.3992 | 1337.8 |
| 293.15 | 0.5059 | 1359.6 |
| 293.15 | 0.5483 | 1368.9 |
| 293.15 | 0.6569 | 1393.7 |
| 293.15 | 0.6999 | 1404.0 |
| 293.15 | 0.7537 | 1416.7 |
| 293.15 | 0.8036 | 1429.0 |
| 293.15 | 0.8579 | 1442.3 |
| 293.15 | 0.9048 | 1453.7 |
| 293.15 | 0.9546 | 1465.6 |
| 298.15 | 0.0575 | 1255.4 |
| 298.15 | 0.1092 | 1263.9 |
| 298.15 | 0.1519 | 1271.1 |
| 298.15 | 0.2043 | 1280.1 |
| 298.15 | 0.2448 | 1287.4 |
| 298.15 | 0.3090 | 1299.3 |
| 298.15 | 0.3558 | 1308.4 |
| 298.15 | 0.3986 | 1317.0 |
| 298.15 | 0.4381 | 1324.9 |
| 298.15 | 0.5028 | 1338.6 |
| 298.15 | 0.6005 | 1360.6 |
| 298.15 | 0.6934 | 1382.5 |
| 298.15 | 0.7572 | 1398.0 |
| 298.15 | 0.8056 | 1410.0 |
| 298.15 | 0.9076 | 1435.1 |
| 298.15 | 0.9553 | 1446.6 |
| 303.15 | 0.0505 | 1233.0 |
| 303.15 | 0.1477 | 1249.4 |
| 303.15 | 0.2019 | 1259.0 |
| 303.15 | 0.2410 | 1266.0 |
| 303.15 | 0.3024 | 1277.5 |
| 303.15 | 0.3558 | 1287.8 |
| 303.15 | 0.4358 | 1304.1 |
| 303.15 | 0.5114 | 1320.3 |
| 303.15 | 0.5281 | 1324.0 |
| 303.15 | 0.6056 | 1341.6 |
| 303.15 | 0.6960 | 1363.2 |
| 303.15 | 0.7558 | 1377.7 |
| 303.15 | 0.8006 | 1389.0 |
| 303.15 | 0.8544 | 1402.3 |
| 303.15 | 0.8998 | 1413.7 |
| 303.15 | 0.9466 | 1425.2 |
Sources
- Thermodynamics of amide + amine mixtures. 5. Excess molar enthalpies of N,N-dimethylformamide or N,N-dimethylacetamide + N-propylpropan-1-amine, + N-butylbutan-1-amine, + butan-1-amine, or + hexan-1-amine systems at 298.15 K. Application of the ERAS model
- Thermodynamics of amide + amine mixtures. 1. Volumetric, speed of sound, and refractive index data for N,Ndimethylformamide + N-propylpropan-1-amine, + N-butylbutan-1-amine, + butan-1-amine, or + hexan-1-amine systems at several temperatures