- Name
- Benzoic acid
- InChI
- InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)
- InChI Key
- WPYMKLBDIGXBTP-UHFFFAOYSA-N
- Formula
- C7H6O2
- SMILES
- O=C(O)c1ccccc1
- Mol. Weight (g/mol)
- 122.12
- CAS
- 65-85-0
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Datasets
- Mole fraction (34)
- η - Viscosity, Pa*s (2)
- ρl - Mass density, kg/m3 (2)
- λ - Thermal conductivity, W/m/K (2)
- Tfus - Solid-liquid equilibrium temperature, K (6)
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 297.75 | 0.0005 |
| 298.15 | 0.0005 |
| 303.15 | 0.0006 |
| 308.15 | 0.0008 |
| 313.15 | 0.0009 |
| 315.55 | 0.0009 |
| 318.15 | 0.0011 |
| 323.15 | 0.0014 |
| 328.15 | 0.0016 |
| 330.95 | 0.0016 |
| 333.15 | 0.0018 |
| 338.15 | 0.0022 |
| 343.15 | 0.0026 |
| 347.25 | 0.0031 |
| 348.15 | 0.0033 |
| 353.15 | 0.0041 |
| 356.25 | 0.0047 |
| 358.15 | 0.0050 |
| 366.35 | 0.0087 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 363.15 | 0.0063 |
| 353.15 | 0.0042 |
| 343.15 | 0.0027 |
| 333.15 | 0.0018 |
| 323.15 | 0.0014 |
| 313.15 | 0.0009 |
| 303.15 | 0.0006 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzoic acid (1) - Liquid mixture 1 |
|---|---|
| 423.15 | 0.0403 |
| 413.15 | 0.0296 |
| 403.15 | 0.0212 |
| 393.15 | 0.0155 |
| 383.15 | 0.0104 |
| 373.15 | 0.0091 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 278.40 | 0.0003 |
| 282.90 | 0.0003 |
| 294.10 | 0.0005 |
| 300.40 | 0.0006 |
| 307.70 | 0.0007 |
| 317.70 | 0.0012 |
| 326.70 | 0.0015 |
| 336.60 | 0.0022 |
| 340.90 | 0.0026 |
Molality, mol/kg [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Molality, mol/kg - Liquid |
|---|---|
| 281.15 | 0.0173 |
| 295.65 | 0.0297 |
| 300.15 | 0.0340 |
| 305.15 | 0.0398 |
| 309.65 | 0.0407 |
| 318.15 | 0.0594 |
| 333.15 | 0.0976 |
| 337.15 | 0.1210 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 273.15 | 0.0003 |
| 283.15 | 0.0003 |
| 293.15 | 0.0004 |
| 298.15 | 0.0005 |
| 303.15 | 0.0006 |
| 313.15 | 0.0008 |
| 323.15 | 0.0012 |
| 333.15 | 0.0017 |
Molality, mol/kg of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Molality, mol/kg of Benzoic acid (1) - Liquid |
|---|---|
| 283.15 | 0.0174 |
| 293.15 | 0.0233 |
| 298.15 | 0.0277 |
| 303.15 | 0.0332 |
| 308.15 | 0.0390 |
| 313.15 | 0.0447 |
| 318.15 | 0.0539 |
| 323.15 | 0.0645 |
Mass ratio of solute to solvent of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (1) - Liquid |
|---|---|
| 293.10 | 0.0025 |
| 298.10 | 0.0030 |
| 303.10 | 0.0036 |
| 308.10 | 0.0042 |
| 313.10 | 0.0053 |
| 318.10 | 0.0062 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 94.47 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 288.15 | 0.0002 |
| 293.15 | 0.0003 |
| 298.15 | 0.0004 |
| 303.15 | 0.0006 |
| 308.15 | 0.0007 |
| 313.15 | 0.0008 |
| 318.15 | 0.0009 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 281.15 | 0.0003 |
| 295.65 | 0.0005 |
| 300.15 | 0.0006 |
| 305.15 | 0.0007 |
| 318.15 | 0.0011 |
Mass ratio of solute to solvent of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 84 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (1) - Liquid |
|---|---|
| 298.15 | 0.0026 |
| 303.15 | 0.0034 |
| 308.15 | 0.0039 |
| 313.15 | 0.0047 |
| 318.15 | 0.0056 |
| 323.15 | 0.0066 |
Molality, mol/kg [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Molality, mol/kg - Liquid mixture 1 |
|---|---|
| 303.65 | 0.0300 |
| 312.75 | 0.0431 |
| 318.25 | 0.0482 |
| 323.25 | 0.0554 |
| 328.35 | 0.0595 |
| 333.65 | 0.0677 |
| 338.35 | 0.0728 |
| 343.15 | 0.0779 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 283.20 | 0.0003 |
| 293.20 | 0.0004 |
| 303.20 | 0.0006 |
| 313.20 | 0.0008 |
| 323.20 | 0.0011 |
Mass ratio of solute to solvent of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (1) - Liquid |
|---|---|
| 298.85 | 0.0034 |
| 305.95 | 0.0043 |
| 312.85 | 0.0054 |
| 319.35 | 0.0068 |
| 323.25 | 0.0083 |
| 329.55 | 0.0103 |
| 335.25 | 0.0127 |
| 340.25 | 0.0156 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 295.95 | 0.0005 |
| 305.55 | 0.0007 |
| 310.94 | 0.0008 |
| 317.05 | 0.0009 |
| 320.71 | 0.0011 |
| 323.85 | 0.0012 |
| 328.06 | 0.0014 |
| 333.27 | 0.0018 |
| 338.79 | 0.0022 |
| 344.25 | 0.0027 |
| 348.88 | 0.0034 |
| 354.64 | 0.0043 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 5000 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 298.00 | 0.0022 |
| 323.00 | 0.0049 |
| 348.00 | 0.0110 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 5000 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzoic acid (1) - Liquid mixture 1 |
|---|---|
| 373.00 | 0.0404 |
| 398.00 | 0.1080 |
| 423.00 | 0.1310 |
| 473.00 | 0.1360 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 297.75 | 0.0005 |
| 298.15 | 0.0005 |
| 303.15 | 0.0006 |
| 308.15 | 0.0008 |
| 313.15 | 0.0009 |
| 315.55 | 0.0009 |
| 318.15 | 0.0011 |
| 323.15 | 0.0014 |
| 328.15 | 0.0016 |
| 330.95 | 0.0016 |
| 333.15 | 0.0018 |
| 338.15 | 0.0022 |
| 343.15 | 0.0026 |
| 347.25 | 0.0031 |
| 348.15 | 0.0033 |
| 353.15 | 0.0041 |
| 356.25 | 0.0047 |
| 358.15 | 0.0050 |
| 366.35 | 0.0087 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 363.15 | 0.0063 |
| 353.15 | 0.0042 |
| 343.15 | 0.0027 |
| 333.15 | 0.0018 |
| 323.15 | 0.0014 |
| 313.15 | 0.0009 |
| 303.15 | 0.0006 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzoic acid (1) - Liquid mixture 1 |
|---|---|
| 423.15 | 0.0403 |
| 413.15 | 0.0296 |
| 403.15 | 0.0212 |
| 393.15 | 0.0155 |
| 383.15 | 0.0104 |
| 373.15 | 0.0091 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.325 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 278.40 | 0.0003 |
| 282.90 | 0.0003 |
| 294.10 | 0.0005 |
| 300.40 | 0.0006 |
| 307.70 | 0.0007 |
| 317.70 | 0.0012 |
| 326.70 | 0.0015 |
| 336.60 | 0.0022 |
| 340.90 | 0.0026 |
Molality, mol/kg [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Molality, mol/kg - Liquid |
|---|---|
| 281.15 | 0.0173 |
| 295.65 | 0.0297 |
| 300.15 | 0.0340 |
| 305.15 | 0.0398 |
| 309.65 | 0.0407 |
| 318.15 | 0.0594 |
| 333.15 | 0.0976 |
| 337.15 | 0.1210 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 273.15 | 0.0003 |
| 283.15 | 0.0003 |
| 293.15 | 0.0004 |
| 298.15 | 0.0005 |
| 303.15 | 0.0006 |
| 313.15 | 0.0008 |
| 323.15 | 0.0012 |
| 333.15 | 0.0017 |
Molality, mol/kg of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Temperature, K - Liquid | Molality, mol/kg of Benzoic acid (1) - Liquid |
|---|---|
| 283.15 | 0.0174 |
| 293.15 | 0.0233 |
| 298.15 | 0.0277 |
| 303.15 | 0.0332 |
| 308.15 | 0.0390 |
| 313.15 | 0.0447 |
| 318.15 | 0.0539 |
| 323.15 | 0.0645 |
Mass ratio of solute to solvent of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (1) - Liquid |
|---|---|
| 293.10 | 0.0025 |
| 298.10 | 0.0030 |
| 303.10 | 0.0036 |
| 308.10 | 0.0042 |
| 313.10 | 0.0053 |
| 318.10 | 0.0062 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 94.47 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 288.15 | 0.0002 |
| 293.15 | 0.0003 |
| 298.15 | 0.0004 |
| 303.15 | 0.0006 |
| 308.15 | 0.0007 |
| 313.15 | 0.0008 |
| 318.15 | 0.0009 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.2 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 281.15 | 0.0003 |
| 295.65 | 0.0005 |
| 300.15 | 0.0006 |
| 305.15 | 0.0007 |
| 318.15 | 0.0011 |
Mass ratio of solute to solvent of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 84 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (1) - Liquid |
|---|---|
| 298.15 | 0.0026 |
| 303.15 | 0.0034 |
| 308.15 | 0.0039 |
| 313.15 | 0.0047 |
| 318.15 | 0.0056 |
| 323.15 | 0.0066 |
Molality, mol/kg [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Molality, mol/kg - Liquid mixture 1 |
|---|---|
| 303.65 | 0.0300 |
| 312.75 | 0.0431 |
| 318.25 | 0.0482 |
| 323.25 | 0.0554 |
| 328.35 | 0.0595 |
| 333.65 | 0.0677 |
| 338.35 | 0.0728 |
| 343.15 | 0.0779 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 283.20 | 0.0003 |
| 293.20 | 0.0004 |
| 303.20 | 0.0006 |
| 313.20 | 0.0008 |
| 323.20 | 0.0011 |
Mass ratio of solute to solvent of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Temperature, K - Liquid | Mass ratio of solute to solvent of Benzoic acid (1) - Liquid |
|---|---|
| 298.85 | 0.0034 |
| 305.95 | 0.0043 |
| 312.85 | 0.0054 |
| 319.35 | 0.0068 |
| 323.25 | 0.0083 |
| 329.55 | 0.0103 |
| 335.25 | 0.0127 |
| 340.25 | 0.0156 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 295.95 | 0.0005 |
| 305.55 | 0.0007 |
| 310.94 | 0.0008 |
| 317.05 | 0.0009 |
| 320.71 | 0.0011 |
| 323.85 | 0.0012 |
| 328.06 | 0.0014 |
| 333.27 | 0.0018 |
| 338.79 | 0.0022 |
| 344.25 | 0.0027 |
| 348.88 | 0.0034 |
| 354.64 | 0.0043 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 5000 (Liquid)
| Temperature, K - Liquid | Mole fraction of Benzoic acid (1) - Liquid |
|---|---|
| 298.00 | 0.0022 |
| 323.00 | 0.0049 |
| 348.00 | 0.0110 |
Mole fraction of Benzoic acid (1) [ref]
Operational condition: Pressure, kPa = 5000 (Liquid mixture 1)
| Temperature, K - Liquid mixture 1 | Mole fraction of Benzoic acid (1) - Liquid mixture 1 |
|---|---|
| 373.00 | 0.0404 |
| 398.00 | 0.1080 |
| 423.00 | 0.1310 |
| 473.00 | 0.1360 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Benzoic acid (1) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 0.0500 | 381.10 | 0.0003 |
| 0.0500 | 397.60 | 0.0003 |
| 0.0500 | 416.40 | 0.0002 |
| 0.0500 | 436.10 | 0.0002 |
| 0.0500 | 453.80 | 0.0002 |
| 0.1000 | 380.60 | 0.0003 |
| 0.1000 | 395.90 | 0.0003 |
| 0.1000 | 415.10 | 0.0002 |
| 0.1000 | 431.40 | 0.0002 |
| 0.1000 | 447.90 | 0.0002 |
| 0.2000 | 401.80 | 0.0003 |
| 0.2000 | 416.80 | 0.0003 |
| 0.2000 | 434.90 | 0.0002 |
| 0.2000 | 455.40 | 0.0002 |
| 0.4000 | 402.30 | 0.0005 |
| 0.4000 | 417.80 | 0.0004 |
| 0.4000 | 435.60 | 0.0003 |
| 0.4000 | 455.10 | 0.0003 |
| 0.6000 | 403.10 | 0.0007 |
| 0.6000 | 418.90 | 0.0005 |
| 0.6000 | 436.90 | 0.0004 |
| 0.6000 | 456.40 | 0.0003 |
| 0.8000 | 402.40 | 0.0009 |
| 0.8000 | 418.80 | 0.0007 |
| 0.8000 | 434.30 | 0.0005 |
| 0.8000 | 452.40 | 0.0004 |
| 1.0000 | 400.30 | 0.0014 |
| 1.0000 | 409.30 | 0.0012 |
| 1.0000 | 418.30 | 0.0011 |
| 1.0000 | 427.20 | 0.0010 |
| 1.0000 | 432.10 | 0.0010 |
| 1.0000 | 447.10 | 0.0008 |
Viscosity, Pa*s [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Benzoic acid (1) - Liquid | Temperature, K - Liquid | Viscosity, Pa*s - Liquid |
| 0.0500 | 381.10 | 0.0003 |
| 0.0500 | 397.60 | 0.0003 |
| 0.0500 | 416.40 | 0.0002 |
| 0.0500 | 436.10 | 0.0002 |
| 0.0500 | 453.80 | 0.0002 |
| 0.1000 | 380.60 | 0.0003 |
| 0.1000 | 395.90 | 0.0003 |
| 0.1000 | 415.10 | 0.0002 |
| 0.1000 | 431.40 | 0.0002 |
| 0.1000 | 447.90 | 0.0002 |
| 0.2000 | 401.80 | 0.0003 |
| 0.2000 | 416.80 | 0.0003 |
| 0.2000 | 434.90 | 0.0002 |
| 0.2000 | 455.40 | 0.0002 |
| 0.4000 | 402.30 | 0.0005 |
| 0.4000 | 417.80 | 0.0004 |
| 0.4000 | 435.60 | 0.0003 |
| 0.4000 | 455.10 | 0.0003 |
| 0.6000 | 403.10 | 0.0007 |
| 0.6000 | 418.90 | 0.0005 |
| 0.6000 | 436.90 | 0.0004 |
| 0.6000 | 456.40 | 0.0003 |
| 0.8000 | 402.40 | 0.0009 |
| 0.8000 | 418.80 | 0.0007 |
| 0.8000 | 434.30 | 0.0005 |
| 0.8000 | 452.40 | 0.0004 |
| 1.0000 | 400.30 | 0.0014 |
| 1.0000 | 409.30 | 0.0012 |
| 1.0000 | 418.30 | 0.0011 |
| 1.0000 | 427.20 | 0.0010 |
| 1.0000 | 432.10 | 0.0010 |
| 1.0000 | 447.10 | 0.0008 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Benzoic acid (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0500 | 379.60 | 963.7 |
| 0.0500 | 394.60 | 951.9 |
| 0.0500 | 413.40 | 935.5 |
| 0.0500 | 433.10 | 915.2 |
| 0.0500 | 450.80 | 896.3 |
| 0.1000 | 379.10 | 974.1 |
| 0.1000 | 392.90 | 961.0 |
| 0.1000 | 412.10 | 945.4 |
| 0.1000 | 428.40 | 929.6 |
| 0.1000 | 444.90 | 912.6 |
| 0.2000 | 400.30 | 963.5 |
| 0.2000 | 413.80 | 950.8 |
| 0.2000 | 431.90 | 933.7 |
| 0.2000 | 452.40 | 912.0 |
| 0.4000 | 400.80 | 988.8 |
| 0.4000 | 414.80 | 975.1 |
| 0.4000 | 432.60 | 955.0 |
| 0.4000 | 452.10 | 932.0 |
| 0.6000 | 401.60 | 1013.8 |
| 0.6000 | 415.90 | 999.2 |
| 0.6000 | 433.90 | 981.1 |
| 0.6000 | 453.40 | 959.5 |
| 0.8000 | 400.90 | 1050.1 |
| 0.8000 | 414.80 | 1035.0 |
| 0.8000 | 431.30 | 1018.8 |
| 0.8000 | 449.40 | 1000.5 |
| 1.0000 | 401.30 | 1089.5 |
| 1.0000 | 410.30 | 1080.2 |
| 1.0000 | 419.30 | 1069.8 |
| 1.0000 | 428.20 | 1060.2 |
| 1.0000 | 432.10 | 1055.0 |
| 1.0000 | 447.10 | 1036.0 |
Mass density, kg/m3 [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Benzoic acid (1) - Liquid | Temperature, K - Liquid | Mass density, kg/m3 - Liquid |
| 0.0500 | 379.60 | 963.7 |
| 0.0500 | 394.60 | 951.9 |
| 0.0500 | 413.40 | 935.5 |
| 0.0500 | 433.10 | 915.2 |
| 0.0500 | 450.80 | 896.3 |
| 0.1000 | 379.10 | 974.1 |
| 0.1000 | 392.90 | 961.0 |
| 0.1000 | 412.10 | 945.4 |
| 0.1000 | 428.40 | 929.6 |
| 0.1000 | 444.90 | 912.6 |
| 0.2000 | 400.30 | 963.5 |
| 0.2000 | 413.80 | 950.8 |
| 0.2000 | 431.90 | 933.7 |
| 0.2000 | 452.40 | 912.0 |
| 0.4000 | 400.80 | 988.8 |
| 0.4000 | 414.80 | 975.1 |
| 0.4000 | 432.60 | 955.0 |
| 0.4000 | 452.10 | 932.0 |
| 0.6000 | 401.60 | 1013.8 |
| 0.6000 | 415.90 | 999.2 |
| 0.6000 | 433.90 | 981.1 |
| 0.6000 | 453.40 | 959.5 |
| 0.8000 | 400.90 | 1050.1 |
| 0.8000 | 414.80 | 1035.0 |
| 0.8000 | 431.30 | 1018.8 |
| 0.8000 | 449.40 | 1000.5 |
| 1.0000 | 401.30 | 1089.5 |
| 1.0000 | 410.30 | 1080.2 |
| 1.0000 | 419.30 | 1069.8 |
| 1.0000 | 428.20 | 1060.2 |
| 1.0000 | 432.10 | 1055.0 |
| 1.0000 | 447.10 | 1036.0 |
Thermal conductivity, W/m/K [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Benzoic acid (1) - Liquid | Temperature, K - Liquid | Thermal conductivity, W/m/K - Liquid |
| 0.0500 | 374.60 | 0.6710 |
| 0.0500 | 393.60 | 0.6750 |
| 0.0500 | 413.30 | 0.6760 |
| 0.1000 | 373.00 | 0.6590 |
| 0.1000 | 394.20 | 0.6620 |
| 0.1000 | 410.90 | 0.6700 |
| 0.2000 | 391.00 | 0.6490 |
| 0.2000 | 409.20 | 0.6500 |
| 0.2000 | 418.00 | 0.6510 |
| 0.4000 | 393.60 | 0.5750 |
| 0.4000 | 409.20 | 0.5710 |
| 0.4000 | 420.10 | 0.5490 |
| 0.4000 | 430.10 | 0.5680 |
| 0.8000 | 393.90 | 0.1990 |
| 0.8000 | 413.20 | 0.1970 |
| 0.8000 | 433.10 | 0.1920 |
| 0.8000 | 451.00 | 0.1880 |
| 1.0000 | 406.80 | 0.1390 |
| 1.0000 | 424.40 | 0.1370 |
| 1.0000 | 444.90 | 0.1340 |
| 1.0000 | 465.10 | 0.1320 |
Thermal conductivity, W/m/K [ref]
Operational condition: Pressure, kPa = 100 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Mass fraction of Benzoic acid (1) - Liquid | Temperature, K - Liquid | Thermal conductivity, W/m/K - Liquid |
| 0.0500 | 374.60 | 0.6710 |
| 0.0500 | 393.60 | 0.6750 |
| 0.0500 | 413.30 | 0.6760 |
| 0.1000 | 373.00 | 0.6590 |
| 0.1000 | 394.20 | 0.6620 |
| 0.1000 | 410.90 | 0.6700 |
| 0.2000 | 391.00 | 0.6490 |
| 0.2000 | 409.20 | 0.6500 |
| 0.2000 | 418.00 | 0.6510 |
| 0.4000 | 393.60 | 0.5750 |
| 0.4000 | 409.20 | 0.5710 |
| 0.4000 | 420.10 | 0.5490 |
| 0.4000 | 430.10 | 0.5680 |
| 0.8000 | 393.90 | 0.1990 |
| 0.8000 | 413.20 | 0.1970 |
| 0.8000 | 433.10 | 0.1920 |
| 0.8000 | 451.00 | 0.1880 |
| 1.0000 | 406.80 | 0.1390 |
| 1.0000 | 424.40 | 0.1370 |
| 1.0000 | 444.90 | 0.1340 |
| 1.0000 | 465.10 | 0.1320 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Benzoic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0004 | 290.35 |
| 0.0004 | 291.30 |
| 0.0004 | 293.01 |
| 0.0005 | 295.97 |
| 0.0005 | 297.15 |
| 0.0005 | 297.38 |
| 0.0006 | 303.16 |
| 0.0006 | 304.48 |
| 0.0007 | 306.72 |
| 0.0007 | 308.44 |
| 0.0008 | 313.16 |
| 0.0008 | 313.18 |
| 0.0009 | 314.65 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Benzoic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0005 | 298.15 |
| 0.0006 | 303.25 |
| 0.0007 | 308.45 |
| 0.0009 | 314.35 |
| 0.0011 | 320.05 |
| 0.0013 | 323.65 |
| 0.0014 | 325.95 |
| 0.0017 | 332.95 |
| 0.0023 | 340.05 |
| 0.0029 | 345.95 |
| 0.0037 | 352.05 |
| 0.0046 | 356.25 |
| 0.0057 | 360.55 |
| 0.0062 | 362.25 |
| 0.0070 | 364.25 |
| 0.0088 | 366.75 |
| 0.0095 | 368.15 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mass ratio of solute to solvent of Benzoic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0034 | 298.85 |
| 0.0043 | 305.95 |
| 0.0054 | 312.85 |
| 0.0068 | 319.35 |
| 0.0083 | 323.25 |
| 0.0103 | 329.55 |
| 0.0127 | 335.25 |
| 0.0156 | 340.25 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Benzoic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0004 | 290.35 |
| 0.0004 | 291.30 |
| 0.0004 | 293.01 |
| 0.0005 | 295.97 |
| 0.0005 | 297.15 |
| 0.0005 | 297.38 |
| 0.0006 | 303.16 |
| 0.0006 | 304.48 |
| 0.0007 | 306.72 |
| 0.0007 | 308.44 |
| 0.0008 | 313.16 |
| 0.0008 | 313.18 |
| 0.0009 | 314.65 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Mole fraction of Benzoic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0005 | 298.15 |
| 0.0006 | 303.25 |
| 0.0007 | 308.45 |
| 0.0009 | 314.35 |
| 0.0011 | 320.05 |
| 0.0013 | 323.65 |
| 0.0014 | 325.95 |
| 0.0017 | 332.95 |
| 0.0023 | 340.05 |
| 0.0029 | 345.95 |
| 0.0037 | 352.05 |
| 0.0046 | 356.25 |
| 0.0057 | 360.55 |
| 0.0062 | 362.25 |
| 0.0070 | 364.25 |
| 0.0088 | 366.75 |
| 0.0095 | 368.15 |
Solid-liquid equilibrium temperature, K [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid)
| Mass ratio of solute to solvent of Benzoic acid (1) - Liquid | Solid-liquid equilibrium temperature, K - Liquid |
|---|---|
| 0.0034 | 298.85 |
| 0.0043 | 305.95 |
| 0.0054 | 312.85 |
| 0.0068 | 319.35 |
| 0.0083 | 323.25 |
| 0.0103 | 329.55 |
| 0.0127 | 335.25 |
| 0.0156 | 340.25 |
Sources
- The effect of temperature on the solubility of benzoic acid derivatives in water
- Solubility of chlocyphos in different solvents
- Determination and modeling of aqueous solubility of 4-position substituted benzoic acid compounds in a high-temperature solution
- Solubility of (+)-Catechin in Water and Water-Ethanol Mixtures within the Temperature Range 277.6 to 331.2 K: Fundamental Data to Design Polyphenol Extraction Processes
- Solubility of paroxetine hydrochloride hemi-hydrate in (water + acetone)
- The solubilities of benzene polycarboxylic acids in water
- Solubilities of benzoic acid in binary (benzyl alcohol + benzaldehyde) solvent mixtures
- Solid-liquid equilibrium and phase diagram for the ternary (2-naphthaldehyde + o-phthalic anhydride + 1,4-dioxane) system
- Solubility and vapor pressure data of bioactive 6-(acetylamino)-N-(5-ethyl-1,3,4-thiadiazol-2-yl) hexanamide
- Measurement and Thermodynamic Modeling of the Solubility of Lamotrigine, Deferiprone, Cefixime Trihydrate, and Cephalexin Monohydrate in Different Pure Solvents from 283.1 to 323.1 K
- Solubility Measurement and Thermodynamic Modeling of Benzoic Acid in Monosolvents and Binary Mixtures
- Binary Solid-Liquid Solubility Determination and Model Correlation of Quizalofop-p-ethyl in Different Pure Solvents
- Thermodynamic Modeling and Solubility Measurement of Cetirizine Hydrochloride and Deferiprone in Pure Solvents of Acetonitrile, Ethanol, Acetic Acid, Sulfolane, and Ethyl Acetate and Their Mixtures
- Density, Viscosity and Thermal Conductivity of Aqueous Benzoic Acid Mixtures between 375 K and 465 K
- Solubility of Benzoic Acid in Mixed Solvents
- Solubility of 2,2',6,6'-Tetrabromo-4,4'-isopropylidene Phenol in Aqueous Pollutant Solutions
- Solubilities of Benzoic Acid in Binary Methylbenzene + Benzyl Alcohol and Methylbenzene + Benzaldehyde Solvent Mixtures
- Solubility of Imidacloprid in Different Solvents
- Solubility of Benzoic and Salicylic Acids in Subcritical Water at Temperatures Ranging from (298 to 473) K