- Name
- Ethyl Acetate
- InChI
- InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
- InChI Key
- XEKOWRVHYACXOJ-UHFFFAOYSA-N
- Formula
- C4H8O2
- SMILES
- CCOC(C)=O
- Mol. Weight (g/mol)
- 88.11
- CAS
- 141-78-6
- Name
- 2,3-Butanediol
- InChI
- InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3
- InChI Key
- OWBTYPJTUOEWEK-UHFFFAOYSA-N
- Formula
- C4H10O2
- SMILES
- CC(O)C(C)O
- Mol. Weight (g/mol)
- 90.12
- CAS
- 513-85-9
- Name
- Water
- InChI
- InChI=1S/H2O/h1H2
- InChI Key
- XLYOFNOQVPJJNP-UHFFFAOYSA-N
- Formula
- H2O
- SMILES
- O
- Mol. Weight (g/mol)
- 18.02
- CAS
- 7732-18-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of 2,3-Butanediol (2) - Liquid mixture 1 | Mass fraction of 2,3-Butanediol (2) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 |
| 298.15 | 0.0572 | 0.0703 | 0.2953 | 0.5687 |
| 298.15 | 0.0437 | 0.0280 | 0.2229 | 0.6840 |
| 298.15 | 0.0622 | 0.0687 | 0.2920 | 0.5741 |
| 298.15 | 0.0563 | 0.0611 | 0.2786 | 0.6013 |
| 298.15 | 0.0370 | 0.0117 | 0.1787 | 0.7380 |
| 298.15 | 0.0496 | 0.0439 | 0.2490 | 0.6447 |
| 308.15 | 0.0847 | 0.0976 | 0.2775 | 0.5471 |
| 308.15 | 0.0544 | 0.0361 | 0.2013 | 0.6511 |
| 308.15 | 0.0819 | 0.0864 | 0.2686 | 0.5478 |
| 308.15 | 0.0815 | 0.0767 | 0.2539 | 0.5643 |
| 308.15 | 0.0493 | 0.0190 | 0.1530 | 0.7011 |
| 308.15 | 0.0642 | 0.0578 | 0.2361 | 0.6148 |
| 318.15 | 0.1553 | 0.1389 | 0.2550 | 0.5039 |
| 318.15 | 0.0638 | 0.0475 | 0.1871 | 0.6840 |
| 318.15 | 0.1114 | 0.1112 | 0.2542 | 0.5491 |
| 318.15 | 0.0977 | 0.0969 | 0.2305 | 0.5736 |
| 318.15 | 0.0569 | 0.0281 | 0.1282 | 0.7389 |
| 318.15 | 0.0952 | 0.0918 | 0.2245 | 0.5902 |
Mass fraction of 2,3-Butanediol (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of 2,3-Butanediol (2) - Liquid mixture 1 |
| 298.15 | 0.0310 | 0.0000 |
| 298.15 | 0.0460 | 0.0511 |
| 298.15 | 0.0608 | 0.0721 |
| 298.15 | 0.0951 | 0.1391 |
| 298.15 | 0.1089 | 0.1547 |
| 298.15 | 0.1290 | 0.1735 |
| 298.15 | 0.1478 | 0.1939 |
| 298.15 | 0.1788 | 0.2186 |
| 298.15 | 0.2094 | 0.2391 |
| 298.15 | 0.2491 | 0.2645 |
| 298.15 | 0.2768 | 0.2810 |
| 298.15 | 0.3051 | 0.2950 |
| 298.15 | 0.3337 | 0.3082 |
| 298.15 | 0.3364 | 0.3067 |
| 298.15 | 0.3596 | 0.3164 |
| 298.15 | 0.3986 | 0.3251 |
| 298.15 | 0.4187 | 0.3267 |
| 298.15 | 0.4387 | 0.3237 |
| 298.15 | 0.4703 | 0.3204 |
| 298.15 | 0.5401 | 0.3031 |
| 298.15 | 0.6182 | 0.2655 |
| 298.15 | 0.6805 | 0.2255 |
| 298.15 | 0.8365 | 0.0760 |
| 298.15 | 0.9190 | 0.0000 |
| 308.15 | 0.0344 | 0.0000 |
| 308.15 | 0.0425 | 0.0344 |
| 308.15 | 0.0684 | 0.0786 |
| 308.15 | 0.0783 | 0.0857 |
| 308.15 | 0.0951 | 0.1011 |
| 308.15 | 0.1498 | 0.1503 |
| 308.15 | 0.2202 | 0.2120 |
| 308.15 | 0.2812 | 0.2505 |
| 308.15 | 0.3214 | 0.2741 |
| 308.15 | 0.3404 | 0.2806 |
| 308.15 | 0.3555 | 0.2858 |
| 308.15 | 0.3703 | 0.2901 |
| 308.15 | 0.3856 | 0.2935 |
| 308.15 | 0.3996 | 0.2986 |
| 308.15 | 0.4822 | 0.2882 |
| 308.15 | 0.5059 | 0.2818 |
| 308.15 | 0.5497 | 0.2732 |
| 308.15 | 0.6017 | 0.2393 |
| 308.15 | 0.7088 | 0.1687 |
| 308.15 | 0.7402 | 0.1441 |
| 308.15 | 0.7709 | 0.1190 |
| 308.15 | 0.8162 | 0.0840 |
| 308.15 | 0.8789 | 0.0291 |
| 308.15 | 0.9148 | 0.0000 |
| 318.15 | 0.0413 | 0.0000 |
| 318.15 | 0.0529 | 0.0339 |
| 318.15 | 0.0676 | 0.0624 |
| 318.15 | 0.0869 | 0.0869 |
| 318.15 | 0.1037 | 0.0975 |
| 318.15 | 0.1251 | 0.1166 |
| 318.15 | 0.1997 | 0.1698 |
| 318.15 | 0.2468 | 0.2012 |
| 318.15 | 0.3065 | 0.2444 |
| 318.15 | 0.3312 | 0.2537 |
| 318.15 | 0.3513 | 0.2604 |
| 318.15 | 0.3737 | 0.2661 |
| 318.15 | 0.3890 | 0.2697 |
| 318.15 | 0.4076 | 0.2720 |
| 318.15 | 0.4203 | 0.2755 |
| 318.15 | 0.4380 | 0.2708 |
| 318.15 | 0.4698 | 0.2661 |
| 318.15 | 0.4882 | 0.2704 |
| 318.15 | 0.5052 | 0.2634 |
| 318.15 | 0.5909 | 0.2312 |
| 318.15 | 0.6192 | 0.2181 |
| 318.15 | 0.6951 | 0.1736 |
| 318.15 | 0.8254 | 0.0674 |
| 318.15 | 0.9016 | 0.0000 |
Temperature, K x Mass fraction [ref]
Operational condition: Pressure, kPa = 101.3 (Liquid mixture 1)
| Fixed | Measured | |||
|---|---|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of 2,3-Butanediol (2) - Liquid mixture 1 | Mass fraction of 2,3-Butanediol (2) - Liquid mixture 2 | Mass fraction of Water (3) - Liquid mixture 2 |
| 298.15 | 0.0572 | 0.0703 | 0.2953 | 0.5687 |
| 298.15 | 0.0437 | 0.0280 | 0.2229 | 0.6840 |
| 298.15 | 0.0622 | 0.0687 | 0.2920 | 0.5741 |
| 298.15 | 0.0563 | 0.0611 | 0.2786 | 0.6013 |
| 298.15 | 0.0370 | 0.0117 | 0.1787 | 0.7380 |
| 298.15 | 0.0496 | 0.0439 | 0.2490 | 0.6447 |
| 308.15 | 0.0847 | 0.0976 | 0.2775 | 0.5471 |
| 308.15 | 0.0544 | 0.0361 | 0.2013 | 0.6511 |
| 308.15 | 0.0819 | 0.0864 | 0.2686 | 0.5478 |
| 308.15 | 0.0815 | 0.0767 | 0.2539 | 0.5643 |
| 308.15 | 0.0493 | 0.0190 | 0.1530 | 0.7011 |
| 308.15 | 0.0642 | 0.0578 | 0.2361 | 0.6148 |
| 318.15 | 0.1553 | 0.1389 | 0.2550 | 0.5039 |
| 318.15 | 0.0638 | 0.0475 | 0.1871 | 0.6840 |
| 318.15 | 0.1114 | 0.1112 | 0.2542 | 0.5491 |
| 318.15 | 0.0977 | 0.0969 | 0.2305 | 0.5736 |
| 318.15 | 0.0569 | 0.0281 | 0.1282 | 0.7389 |
| 318.15 | 0.0952 | 0.0918 | 0.2245 | 0.5902 |
Mass fraction of 2,3-Butanediol (2) [ref]
Operational condition: Pressure, kPa = 101 (Liquid mixture 1)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid mixture 1 | Mass fraction of Water (3) - Liquid mixture 1 | Mass fraction of 2,3-Butanediol (2) - Liquid mixture 1 |
| 298.15 | 0.0310 | 0.0000 |
| 298.15 | 0.0460 | 0.0511 |
| 298.15 | 0.0608 | 0.0721 |
| 298.15 | 0.0951 | 0.1391 |
| 298.15 | 0.1089 | 0.1547 |
| 298.15 | 0.1290 | 0.1735 |
| 298.15 | 0.1478 | 0.1939 |
| 298.15 | 0.1788 | 0.2186 |
| 298.15 | 0.2094 | 0.2391 |
| 298.15 | 0.2491 | 0.2645 |
| 298.15 | 0.2768 | 0.2810 |
| 298.15 | 0.3051 | 0.2950 |
| 298.15 | 0.3337 | 0.3082 |
| 298.15 | 0.3364 | 0.3067 |
| 298.15 | 0.3596 | 0.3164 |
| 298.15 | 0.3986 | 0.3251 |
| 298.15 | 0.4187 | 0.3267 |
| 298.15 | 0.4387 | 0.3237 |
| 298.15 | 0.4703 | 0.3204 |
| 298.15 | 0.5401 | 0.3031 |
| 298.15 | 0.6182 | 0.2655 |
| 298.15 | 0.6805 | 0.2255 |
| 298.15 | 0.8365 | 0.0760 |
| 298.15 | 0.9190 | 0.0000 |
| 308.15 | 0.0344 | 0.0000 |
| 308.15 | 0.0425 | 0.0344 |
| 308.15 | 0.0684 | 0.0786 |
| 308.15 | 0.0783 | 0.0857 |
| 308.15 | 0.0951 | 0.1011 |
| 308.15 | 0.1498 | 0.1503 |
| 308.15 | 0.2202 | 0.2120 |
| 308.15 | 0.2812 | 0.2505 |
| 308.15 | 0.3214 | 0.2741 |
| 308.15 | 0.3404 | 0.2806 |
| 308.15 | 0.3555 | 0.2858 |
| 308.15 | 0.3703 | 0.2901 |
| 308.15 | 0.3856 | 0.2935 |
| 308.15 | 0.3996 | 0.2986 |
| 308.15 | 0.4822 | 0.2882 |
| 308.15 | 0.5059 | 0.2818 |
| 308.15 | 0.5497 | 0.2732 |
| 308.15 | 0.6017 | 0.2393 |
| 308.15 | 0.7088 | 0.1687 |
| 308.15 | 0.7402 | 0.1441 |
| 308.15 | 0.7709 | 0.1190 |
| 308.15 | 0.8162 | 0.0840 |
| 308.15 | 0.8789 | 0.0291 |
| 308.15 | 0.9148 | 0.0000 |
| 318.15 | 0.0413 | 0.0000 |
| 318.15 | 0.0529 | 0.0339 |
| 318.15 | 0.0676 | 0.0624 |
| 318.15 | 0.0869 | 0.0869 |
| 318.15 | 0.1037 | 0.0975 |
| 318.15 | 0.1251 | 0.1166 |
| 318.15 | 0.1997 | 0.1698 |
| 318.15 | 0.2468 | 0.2012 |
| 318.15 | 0.3065 | 0.2444 |
| 318.15 | 0.3312 | 0.2537 |
| 318.15 | 0.3513 | 0.2604 |
| 318.15 | 0.3737 | 0.2661 |
| 318.15 | 0.3890 | 0.2697 |
| 318.15 | 0.4076 | 0.2720 |
| 318.15 | 0.4203 | 0.2755 |
| 318.15 | 0.4380 | 0.2708 |
| 318.15 | 0.4698 | 0.2661 |
| 318.15 | 0.4882 | 0.2704 |
| 318.15 | 0.5052 | 0.2634 |
| 318.15 | 0.5909 | 0.2312 |
| 318.15 | 0.6192 | 0.2181 |
| 318.15 | 0.6951 | 0.1736 |
| 318.15 | 0.8254 | 0.0674 |
| 318.15 | 0.9016 | 0.0000 |