- Name
- Toluene
- InChI
- InChI=1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3
- InChI Key
- YXFVVABEGXRONW-UHFFFAOYSA-N
- Formula
- C7H8
- SMILES
- Cc1ccccc1
- Mol. Weight (g/mol)
- 92.14
- CAS
- 108-88-3
- Name
- Pyridine, 3,5-dimethyl-
- InChI
- InChI=1S/C7H9N/c1-6-3-7(2)5-8-4-6/h3-5H,1-2H3
- InChI Key
- HWWYDZCSSYKIAD-UHFFFAOYSA-N
- Formula
- C7H9N
- SMILES
- Cc1cncc(C)c1
- Mol. Weight (g/mol)
- 107.15
- CAS
- 591-22-0
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Pyridine, 3,5-dimethyl- (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1248 | 0.0550 |
| 0.1817 | 0.0680 |
| 0.2194 | 0.0780 |
| 0.3217 | 0.0900 |
| 0.4079 | 0.1060 |
| 0.5991 | 0.1100 |
| 0.6191 | 0.1070 |
Excess molar enthalpy (molar enthalpy of mixing), kJ/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Pyridine, 3,5-dimethyl- (2) - Liquid | Excess molar enthalpy (molar enthalpy of mixing), kJ/mol - Liquid |
|---|---|
| 0.1248 | 0.0550 |
| 0.1817 | 0.0680 |
| 0.2194 | 0.0780 |
| 0.3217 | 0.0900 |
| 0.4079 | 0.1060 |
| 0.5991 | 0.1100 |
| 0.6191 | 0.1070 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Pyridine, 3,5-dimethyl- (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 263.15 | 0.0472 | 0.45 |
| 263.15 | 0.1889 | 0.36 |
| 263.15 | 0.4951 | 0.28 |
| 263.15 | 0.6789 | 0.22 |
| 263.15 | 0.7326 | 0.18 |
| 263.15 | 0.8720 | 0.11 |
| 263.15 | 1.0000 | 0.02 |
| 273.15 | 0.0472 | 0.87 |
| 273.15 | 0.1889 | 0.72 |
| 273.15 | 0.4951 | 0.56 |
| 273.15 | 0.6789 | 0.43 |
| 273.15 | 0.7326 | 0.37 |
| 273.15 | 0.8720 | 0.22 |
| 273.15 | 1.0000 | 0.04 |
| 283.15 | 0.0472 | 1.60 |
| 283.15 | 0.1889 | 1.34 |
| 283.15 | 0.4951 | 1.06 |
| 283.15 | 0.6789 | 0.81 |
| 283.15 | 0.7326 | 0.70 |
| 283.15 | 0.8720 | 0.43 |
| 283.15 | 1.0000 | 0.08 |
| 293.15 | 0.0472 | 2.80 |
| 293.15 | 0.1889 | 2.36 |
| 293.15 | 0.4951 | 1.88 |
| 293.15 | 0.6789 | 1.46 |
| 293.15 | 0.7326 | 1.27 |
| 293.15 | 0.8720 | 0.80 |
| 293.15 | 1.0000 | 0.17 |
| 303.15 | 0.0472 | 4.70 |
| 303.15 | 0.1889 | 3.99 |
| 303.15 | 0.4951 | 3.19 |
| 303.15 | 0.6789 | 2.50 |
| 303.15 | 0.7326 | 2.21 |
| 303.15 | 0.8720 | 1.41 |
| 303.15 | 1.0000 | 0.33 |
| 313.15 | 0.0472 | 7.59 |
| 313.15 | 0.1889 | 6.48 |
| 313.15 | 0.4951 | 5.22 |
| 313.15 | 0.6789 | 4.12 |
| 313.15 | 0.7326 | 3.67 |
| 313.15 | 0.8720 | 2.40 |
| 313.15 | 1.0000 | 0.60 |
| 323.15 | 0.0472 | 11.85 |
| 323.15 | 0.1889 | 10.14 |
| 323.15 | 0.4951 | 8.22 |
| 323.15 | 0.6789 | 6.56 |
| 323.15 | 0.7326 | 5.90 |
| 323.15 | 0.8720 | 3.94 |
| 323.15 | 1.0000 | 1.05 |
| 333.15 | 0.0472 | 17.92 |
| 333.15 | 0.1889 | 15.39 |
| 333.15 | 0.4951 | 12.55 |
| 333.15 | 0.6789 | 10.10 |
| 333.15 | 0.7326 | 9.18 |
| 333.15 | 0.8720 | 6.24 |
| 333.15 | 1.0000 | 1.77 |
| 343.15 | 0.0472 | 26.38 |
| 343.15 | 0.1889 | 22.70 |
| 343.15 | 0.4951 | 18.61 |
| 343.15 | 0.6789 | 15.11 |
| 343.15 | 0.7326 | 13.87 |
| 343.15 | 0.8720 | 9.61 |
| 343.15 | 1.0000 | 2.90 |
| 353.15 | 0.0472 | 37.87 |
| 353.15 | 0.1889 | 32.62 |
| 353.15 | 0.4951 | 26.89 |
| 353.15 | 0.6789 | 22.04 |
| 353.15 | 0.7326 | 20.42 |
| 353.15 | 0.8720 | 14.40 |
| 353.15 | 1.0000 | 4.60 |
Vapor or sublimation pressure, kPa [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Pyridine, 3,5-dimethyl- (2) - Liquid | Vapor or sublimation pressure, kPa - Liquid |
| 263.15 | 0.0472 | 0.45 |
| 263.15 | 0.1889 | 0.36 |
| 263.15 | 0.4951 | 0.28 |
| 263.15 | 0.6789 | 0.22 |
| 263.15 | 0.7326 | 0.18 |
| 263.15 | 0.8720 | 0.11 |
| 263.15 | 1.0000 | 0.02 |
| 273.15 | 0.0472 | 0.87 |
| 273.15 | 0.1889 | 0.72 |
| 273.15 | 0.4951 | 0.56 |
| 273.15 | 0.6789 | 0.43 |
| 273.15 | 0.7326 | 0.37 |
| 273.15 | 0.8720 | 0.22 |
| 273.15 | 1.0000 | 0.04 |
| 283.15 | 0.0472 | 1.60 |
| 283.15 | 0.1889 | 1.34 |
| 283.15 | 0.4951 | 1.06 |
| 283.15 | 0.6789 | 0.81 |
| 283.15 | 0.7326 | 0.70 |
| 283.15 | 0.8720 | 0.43 |
| 283.15 | 1.0000 | 0.08 |
| 293.15 | 0.0472 | 2.80 |
| 293.15 | 0.1889 | 2.36 |
| 293.15 | 0.4951 | 1.88 |
| 293.15 | 0.6789 | 1.46 |
| 293.15 | 0.7326 | 1.27 |
| 293.15 | 0.8720 | 0.80 |
| 293.15 | 1.0000 | 0.17 |
| 303.15 | 0.0472 | 4.70 |
| 303.15 | 0.1889 | 3.99 |
| 303.15 | 0.4951 | 3.19 |
| 303.15 | 0.6789 | 2.50 |
| 303.15 | 0.7326 | 2.21 |
| 303.15 | 0.8720 | 1.41 |
| 303.15 | 1.0000 | 0.33 |
| 313.15 | 0.0472 | 7.59 |
| 313.15 | 0.1889 | 6.48 |
| 313.15 | 0.4951 | 5.22 |
| 313.15 | 0.6789 | 4.12 |
| 313.15 | 0.7326 | 3.67 |
| 313.15 | 0.8720 | 2.40 |
| 313.15 | 1.0000 | 0.60 |
| 323.15 | 0.0472 | 11.85 |
| 323.15 | 0.1889 | 10.14 |
| 323.15 | 0.4951 | 8.22 |
| 323.15 | 0.6789 | 6.56 |
| 323.15 | 0.7326 | 5.90 |
| 323.15 | 0.8720 | 3.94 |
| 323.15 | 1.0000 | 1.05 |
| 333.15 | 0.0472 | 17.92 |
| 333.15 | 0.1889 | 15.39 |
| 333.15 | 0.4951 | 12.55 |
| 333.15 | 0.6789 | 10.10 |
| 333.15 | 0.7326 | 9.18 |
| 333.15 | 0.8720 | 6.24 |
| 333.15 | 1.0000 | 1.77 |
| 343.15 | 0.0472 | 26.38 |
| 343.15 | 0.1889 | 22.70 |
| 343.15 | 0.4951 | 18.61 |
| 343.15 | 0.6789 | 15.11 |
| 343.15 | 0.7326 | 13.87 |
| 343.15 | 0.8720 | 9.61 |
| 343.15 | 1.0000 | 2.90 |
| 353.15 | 0.0472 | 37.87 |
| 353.15 | 0.1889 | 32.62 |
| 353.15 | 0.4951 | 26.89 |
| 353.15 | 0.6789 | 22.04 |
| 353.15 | 0.7326 | 20.42 |
| 353.15 | 0.8720 | 14.40 |
| 353.15 | 1.0000 | 4.60 |