- Name
- Carbon dioxide
- InChI
- InChI=1S/CO2/c2-1-3
- InChI Key
- CURLTUGMZLYLDI-UHFFFAOYSA-N
- Formula
- CO2
- SMILES
- O=C=O
- Mol. Weight (g/mol)
- 44.01
- CAS
- 124-38-9
- Name
- Vanillin
- InChI
- InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3
- InChI Key
- MWOOGOJBHIARFG-UHFFFAOYSA-N
- Formula
- C8H8O3
- SMILES
- COc1cc(C=O)ccc1O
- Mol. Weight (g/mol)
- 152.15
- CAS
- 121-33-5
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
Mole fraction of Vanillin (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Vanillin (2) - Fluid (supercritical or subcritical phases) |
| 313.20 | 8700.00 | 0.0003 |
| 313.20 | 11650.00 | 0.0013 |
| 313.20 | 14600.00 | 0.0026 |
| 313.20 | 14900.00 | 0.0028 |
| 313.20 | 16350.00 | 0.0032 |
| 313.20 | 17400.00 | 0.0035 |
| 313.20 | 18650.00 | 0.0035 |
| 313.20 | 19780.00 | 0.0037 |
| 313.20 | 20450.00 | 0.0038 |
| 313.20 | 22700.00 | 0.0039 |
| 313.20 | 23500.00 | 0.0039 |
| 313.20 | 25930.00 | 0.0038 |
| 313.20 | 27330.00 | 0.0039 |
| 333.20 | 8430.00 | 0.0001 |
| 333.20 | 10870.00 | 0.0005 |
| 333.20 | 12730.00 | 0.0012 |
| 333.20 | 14830.00 | 0.0019 |
| 333.20 | 16150.00 | 0.0030 |
| 333.20 | 17250.00 | 0.0032 |
| 333.20 | 17800.00 | 0.0033 |
| 333.20 | 20010.00 | 0.0045 |
| 333.20 | 23290.00 | 0.0061 |
| 333.20 | 27650.00 | 0.0051 |
| 353.20 | 8000.00 | 0.0001 |
| 353.20 | 9480.00 | 0.0005 |
| 353.20 | 11180.00 | 0.0004 |
| 353.20 | 12830.00 | 0.0011 |
| 353.20 | 14100.00 | 0.0021 |
| 353.20 | 16600.00 | 0.0033 |
| 353.20 | 17250.00 | 0.0034 |
| 353.20 | 19730.00 | 0.0055 |
| 353.20 | 22950.00 | 0.0077 |
| 353.20 | 25350.00 | 0.0105 |
| 353.20 | 26830.00 | 0.0129 |
Mole fraction of Vanillin (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Vanillin (2) - Fluid (supercritical or subcritical phases) |
| 315.00 | 8610.00 | 0.0001 |
| 315.00 | 10560.00 | 0.0010 |
| 315.00 | 14970.00 | 0.0020 |
| 315.00 | 20430.00 | 0.0030 |
| 315.00 | 23810.00 | 0.0033 |
| 315.00 | 30810.00 | 0.0038 |
| 324.90 | 8100.00 | 0.0001 |
| 324.90 | 10150.00 | 0.0006 |
| 324.90 | 15100.00 | 0.0020 |
| 324.90 | 20240.00 | 0.0034 |
| 324.90 | 25290.00 | 0.0044 |
| 324.90 | 30360.00 | 0.0048 |
| 334.71 | 10280.00 | 0.0021 |
| 334.71 | 14840.00 | 0.0026 |
| 334.71 | 19170.00 | 0.0033 |
| 334.71 | 25540.00 | 0.0048 |
| 334.71 | 30100.00 | 0.0052 |
Mole fraction of Vanillin (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Vanillin (2) - Fluid (supercritical or subcritical phases) |
| 313.20 | 8700.00 | 0.0003 |
| 313.20 | 11650.00 | 0.0013 |
| 313.20 | 14600.00 | 0.0026 |
| 313.20 | 14900.00 | 0.0028 |
| 313.20 | 16350.00 | 0.0032 |
| 313.20 | 17400.00 | 0.0035 |
| 313.20 | 18650.00 | 0.0035 |
| 313.20 | 19780.00 | 0.0037 |
| 313.20 | 20450.00 | 0.0038 |
| 313.20 | 22700.00 | 0.0039 |
| 313.20 | 23500.00 | 0.0039 |
| 313.20 | 25930.00 | 0.0038 |
| 313.20 | 27330.00 | 0.0039 |
| 333.20 | 8430.00 | 0.0001 |
| 333.20 | 10870.00 | 0.0005 |
| 333.20 | 12730.00 | 0.0012 |
| 333.20 | 14830.00 | 0.0019 |
| 333.20 | 16150.00 | 0.0030 |
| 333.20 | 17250.00 | 0.0032 |
| 333.20 | 17800.00 | 0.0033 |
| 333.20 | 20010.00 | 0.0045 |
| 333.20 | 23290.00 | 0.0061 |
| 333.20 | 27650.00 | 0.0051 |
| 353.20 | 8000.00 | 0.0001 |
| 353.20 | 9480.00 | 0.0005 |
| 353.20 | 11180.00 | 0.0004 |
| 353.20 | 12830.00 | 0.0011 |
| 353.20 | 14100.00 | 0.0021 |
| 353.20 | 16600.00 | 0.0033 |
| 353.20 | 17250.00 | 0.0034 |
| 353.20 | 19730.00 | 0.0055 |
| 353.20 | 22950.00 | 0.0077 |
| 353.20 | 25350.00 | 0.0105 |
| 353.20 | 26830.00 | 0.0129 |
Mole fraction of Vanillin (2) [ref]
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Fluid (supercritical or subcritical phases) | Pressure, kPa - Fluid (supercritical or subcritical phases) | Mole fraction of Vanillin (2) - Fluid (supercritical or subcritical phases) |
| 315.00 | 8610.00 | 0.0001 |
| 315.00 | 10560.00 | 0.0010 |
| 315.00 | 14970.00 | 0.0020 |
| 315.00 | 20430.00 | 0.0030 |
| 315.00 | 23810.00 | 0.0033 |
| 315.00 | 30810.00 | 0.0038 |
| 324.90 | 8100.00 | 0.0001 |
| 324.90 | 10150.00 | 0.0006 |
| 324.90 | 15100.00 | 0.0020 |
| 324.90 | 20240.00 | 0.0034 |
| 324.90 | 25290.00 | 0.0044 |
| 324.90 | 30360.00 | 0.0048 |
| 334.71 | 10280.00 | 0.0021 |
| 334.71 | 14840.00 | 0.0026 |
| 334.71 | 19170.00 | 0.0033 |
| 334.71 | 25540.00 | 0.0048 |
| 334.71 | 30100.00 | 0.0052 |
Vapor or sublimation pressure, kPa [ref]
| Temperature, K - Gas | Vapor or sublimation pressure, kPa - Gas |
|---|---|
| 338.80 | 33100.00 |
| 339.50 | 35050.00 |
| 339.60 | 36900.00 |
| 340.20 | 25550.00 |
| 340.30 | 28550.00 |
| 340.50 | 26950.00 |
| 340.90 | 41800.00 |
| 341.10 | 30850.00 |
| 341.20 | 48350.00 |
| 342.20 | 23000.00 |
| 342.70 | 21000.00 |
| 343.10 | 19130.00 |
| 343.50 | 15000.00 |
| 343.70 | 13280.00 |
| 344.50 | 10900.00 |
| 345.60 | 7150.00 |
| 345.70 | 9400.00 |
| 347.50 | 5130.00 |
| 348.10 | 6380.00 |
| 348.30 | 4200.00 |
| 349.20 | 4430.00 |
| 350.70 | 3580.00 |
| 351.40 | 2450.00 |
| 351.50 | 2450.00 |
| 351.70 | 1800.00 |
| 352.40 | 1500.00 |
| 352.50 | 1350.00 |
| 352.70 | 1100.00 |
| 352.80 | 1000.00 |
| 353.00 | 500.00 |
| 353.20 | 800.00 |
| 353.40 | 1000.00 |
| 353.70 | 700.00 |
| 353.80 | 150.00 |
| 354.00 | 400.00 |
| 354.80 | 100.00 |
Temperature, K
Vapor or sublimation pressure, kPa
0
10000
20000
30000
40000
50000
340
345
350
355
Vapor or sublimation pressure, kPa [ref]
| Temperature, K - Gas | Vapor or sublimation pressure, kPa - Gas |
|---|---|
| 338.80 | 33100.00 |
| 339.50 | 35050.00 |
| 339.60 | 36900.00 |
| 340.20 | 25550.00 |
| 340.30 | 28550.00 |
| 340.50 | 26950.00 |
| 340.90 | 41800.00 |
| 341.10 | 30850.00 |
| 341.20 | 48350.00 |
| 342.20 | 23000.00 |
| 342.70 | 21000.00 |
| 343.10 | 19130.00 |
| 343.50 | 15000.00 |
| 343.70 | 13280.00 |
| 344.50 | 10900.00 |
| 345.60 | 7150.00 |
| 345.70 | 9400.00 |
| 347.50 | 5130.00 |
| 348.10 | 6380.00 |
| 348.30 | 4200.00 |
| 349.20 | 4430.00 |
| 350.70 | 3580.00 |
| 351.40 | 2450.00 |
| 351.50 | 2450.00 |
| 351.70 | 1800.00 |
| 352.40 | 1500.00 |
| 352.50 | 1350.00 |
| 352.70 | 1100.00 |
| 352.80 | 1000.00 |
| 353.00 | 500.00 |
| 353.20 | 800.00 |
| 353.40 | 1000.00 |
| 353.70 | 700.00 |
| 353.80 | 150.00 |
| 354.00 | 400.00 |
| 354.80 | 100.00 |
Temperature, K
Vapor or sublimation pressure, kPa
0
10000
20000
30000
40000
50000
340
345
350
355