- Name
- n-Hexane
- InChI
- InChI=1S/C6H14/c1-3-5-6-4-2/h3-6H2,1-2H3
- InChI Key
- VLKZOEOYAKHREP-UHFFFAOYSA-N
- Formula
- C6H14
- SMILES
- CCCCCC
- Mol. Weight (g/mol)
- 86.18
- CAS
- 110-54-3
- Name
- Diisopropyl ether
- InChI
- InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3
- InChI Key
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N
- Formula
- C6H14O
- SMILES
- CC(C)OC(C)C
- Mol. Weight (g/mol)
- 102.17
- CAS
- 108-20-3
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Datasets
- η - Viscosity, Pa*s (2)
- ν - Kinematic viscosity, m2/s (2)
- csound,fluid - Speed of Sound, m/s (2)
- Excess molar volume, m3/mol (2)
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (2) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0000 | 0.0003 |
| 0.1305 | 0.0003 |
| 0.2555 | 0.0003 |
| 0.3920 | 0.0003 |
| 0.4661 | 0.0003 |
| 0.5633 | 0.0003 |
| 0.6050 | 0.0003 |
| 0.7173 | 0.0003 |
| 0.8460 | 0.0003 |
| 1.0000 | 0.0003 |
Viscosity, Pa*s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (2) - Liquid | Viscosity, Pa*s - Liquid |
|---|---|
| 0.0000 | 0.0003 |
| 0.1305 | 0.0003 |
| 0.2555 | 0.0003 |
| 0.3920 | 0.0003 |
| 0.4661 | 0.0003 |
| 0.5633 | 0.0003 |
| 0.6050 | 0.0003 |
| 0.7173 | 0.0003 |
| 0.8460 | 0.0003 |
| 1.0000 | 0.0003 |
Kinematic viscosity, m2/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Kinematic viscosity, m2/s - Liquid |
| 283.15 | 0.0000 | 5.1250e-07 |
| 283.15 | 0.0523 | 5.0940e-07 |
| 283.15 | 0.0915 | 5.0760e-07 |
| 283.15 | 0.1890 | 5.0310e-07 |
| 283.15 | 0.3016 | 4.9900e-07 |
| 283.15 | 0.3980 | 4.9630e-07 |
| 283.15 | 0.4998 | 4.9440e-07 |
| 283.15 | 0.6007 | 4.9310e-07 |
| 283.15 | 0.6975 | 4.9320e-07 |
| 283.15 | 0.7976 | 4.9340e-07 |
| 283.15 | 0.8959 | 4.9450e-07 |
| 283.15 | 0.9432 | 4.9530e-07 |
| 298.15 | 0.0000 | 4.4930e-07 |
| 298.15 | 0.0523 | 4.4770e-07 |
| 298.15 | 0.0915 | 4.4670e-07 |
| 298.15 | 0.1890 | 4.4460e-07 |
| 298.15 | 0.3016 | 4.4260e-07 |
| 298.15 | 0.3980 | 4.4090e-07 |
| 298.15 | 0.4998 | 4.3970e-07 |
| 298.15 | 0.6007 | 4.3830e-07 |
| 298.15 | 0.6975 | 4.3810e-07 |
| 298.15 | 0.7976 | 4.3810e-07 |
| 298.15 | 0.8959 | 4.3860e-07 |
| 298.15 | 0.9432 | 4.3850e-07 |
| 313.15 | 0.0000 | 4.0390e-07 |
| 313.15 | 0.0523 | 4.0110e-07 |
| 313.15 | 0.0915 | 3.9940e-07 |
| 313.15 | 0.1890 | 3.9610e-07 |
| 313.15 | 0.3016 | 3.9290e-07 |
| 313.15 | 0.3980 | 3.9070e-07 |
| 313.15 | 0.4998 | 3.8890e-07 |
| 313.15 | 0.6007 | 3.8740e-07 |
| 313.15 | 0.6975 | 3.8660e-07 |
| 313.15 | 0.7976 | 3.8590e-07 |
| 313.15 | 0.8959 | 3.8560e-07 |
| 313.15 | 0.9432 | 3.8600e-07 |
Kinematic viscosity, m2/s [ref]
Operational condition: Pressure, kPa = 101 (Liquid)
| Fixed | Measured | |
|---|---|---|
| Temperature, K - Liquid | Mole fraction of Diisopropyl ether (2) - Liquid | Kinematic viscosity, m2/s - Liquid |
| 283.15 | 0.0000 | 5.1250e-07 |
| 283.15 | 0.0523 | 5.0940e-07 |
| 283.15 | 0.0915 | 5.0760e-07 |
| 283.15 | 0.1890 | 5.0310e-07 |
| 283.15 | 0.3016 | 4.9900e-07 |
| 283.15 | 0.3980 | 4.9630e-07 |
| 283.15 | 0.4998 | 4.9440e-07 |
| 283.15 | 0.6007 | 4.9310e-07 |
| 283.15 | 0.6975 | 4.9320e-07 |
| 283.15 | 0.7976 | 4.9340e-07 |
| 283.15 | 0.8959 | 4.9450e-07 |
| 283.15 | 0.9432 | 4.9530e-07 |
| 298.15 | 0.0000 | 4.4930e-07 |
| 298.15 | 0.0523 | 4.4770e-07 |
| 298.15 | 0.0915 | 4.4670e-07 |
| 298.15 | 0.1890 | 4.4460e-07 |
| 298.15 | 0.3016 | 4.4260e-07 |
| 298.15 | 0.3980 | 4.4090e-07 |
| 298.15 | 0.4998 | 4.3970e-07 |
| 298.15 | 0.6007 | 4.3830e-07 |
| 298.15 | 0.6975 | 4.3810e-07 |
| 298.15 | 0.7976 | 4.3810e-07 |
| 298.15 | 0.8959 | 4.3860e-07 |
| 298.15 | 0.9432 | 4.3850e-07 |
| 313.15 | 0.0000 | 4.0390e-07 |
| 313.15 | 0.0523 | 4.0110e-07 |
| 313.15 | 0.0915 | 3.9940e-07 |
| 313.15 | 0.1890 | 3.9610e-07 |
| 313.15 | 0.3016 | 3.9290e-07 |
| 313.15 | 0.3980 | 3.9070e-07 |
| 313.15 | 0.4998 | 3.8890e-07 |
| 313.15 | 0.6007 | 3.8740e-07 |
| 313.15 | 0.6975 | 3.8660e-07 |
| 313.15 | 0.7976 | 3.8590e-07 |
| 313.15 | 0.8959 | 3.8560e-07 |
| 313.15 | 0.9432 | 3.8600e-07 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1052.9 |
| 0.1305 | 1039.2 |
| 0.2555 | 1027.5 |
| 0.3920 | 1016.0 |
| 0.4661 | 1009.9 |
| 0.5633 | 1002.6 |
| 0.6050 | 999.6 |
| 0.7173 | 992.4 |
| 0.8460 | 984.4 |
| 1.0000 | 974.9 |
Speed of sound, m/s [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (2) - Liquid | Speed of sound, m/s - Liquid |
|---|---|
| 0.0000 | 1052.9 |
| 0.1305 | 1039.2 |
| 0.2555 | 1027.5 |
| 0.3920 | 1016.0 |
| 0.4661 | 1009.9 |
| 0.5633 | 1002.6 |
| 0.6050 | 999.6 |
| 0.7173 | 992.4 |
| 0.8460 | 984.4 |
| 1.0000 | 974.9 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.1305 | 1.3700e-07 |
| 0.2555 | 2.4500e-07 |
| 0.3920 | 3.2600e-07 |
| 0.4661 | 3.4400e-07 |
| 0.5633 | 3.3400e-07 |
| 0.6050 | 3.2500e-07 |
| 0.7173 | 2.7900e-07 |
| 0.8460 | 1.7400e-07 |
Excess molar volume, m3/mol [ref]
Operational conditions:
- Temperature, K = 303.15 (Liquid)
- Pressure, kPa = 101 (Liquid)
| Mole fraction of Diisopropyl ether (2) - Liquid | Excess molar volume, m3/mol - Liquid |
|---|---|
| 0.1305 | 1.3700e-07 |
| 0.2555 | 2.4500e-07 |
| 0.3920 | 3.2600e-07 |
| 0.4661 | 3.4400e-07 |
| 0.5633 | 3.3400e-07 |
| 0.6050 | 3.2500e-07 |
| 0.7173 | 2.7900e-07 |
| 0.8460 | 1.7400e-07 |