- InChI
- InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3
- InChI Key
- VQTUBCCKSQIDNK-UHFFFAOYSA-N
- Formula
- C4H8
- SMILES
- C=C(C)C
- Molecular Weight1
- 56.11
- CAS
- 115-11-7
- Other Names
-
- 1,1-Dimethylethene
- 1,1-Dimethylethylene
- 2-METHYL PROPENE
- 2-Methyl-1-propene
- 2-Methylpropene
- 2-Methylpropylene
- 2-methylprop-1-ene
- ISOBUTYLENE
- Isobutene
- Isopropylidenemethylene
- Methylpropene
- Propene, 2-methyl-
- UN 1055
- iso-C4H8
- «gamma»-Butylene
- «gamma»-Butylene
- ω : Acentric Factor.
- PAff : Proton affinity (kJ/mol).
- Tig : Autoignition Temperature (K).
- AP : Aniline Point (K).
- BasG : Gas basicity (kJ/mol).
- ΔcH°gas : Standard gas enthalpy of combustion (kJ/mol).
- Cp,gas : Ideal gas heat capacity (J/mol×K).
- Cp,liquid : Liquid phase heat capacity (J/mol×K).
- μ : Dipole Moment (debye).
- LFL : Lower Flammability Limit (% in Air).
- UFL : Upper Flammability Limit (% in Air).
- Tflash,oc : Flash Point (Open Cup Method) (K).
- ΔfG° : Standard Gibbs free energy of formation (kJ/mol).
- Δc,grossH : Heat of Combustion, Gross form (kJ/mol).
- Δc,netH : Heat of Combustion, Net Form (kJ/mol).
- ΔfH°gas : Enthalpy of formation at standard conditions (kJ/mol).
- ΔfusH° : Enthalpy of fusion at standard conditions (kJ/mol).
- ΔfusH : Enthalpy of fusion at a given temperature (kJ/mol).
- ΔvapH° : Enthalpy of vaporization at standard conditions (kJ/mol).
- ΔvapH : Enthalpy of vaporization at a given temperature (kJ/mol).
- IE : Ionization energy (eV).
- log10WS : Log10 of Water solubility in mol/l.
- logPoct/wat : Octanol/Water partition coefficient.
- McVol : McGowan's characteristic volume (ml/mol).
- Pc : Critical Pressure (kPa).
- Pvap : Vapor pressure (kPa).
- ρc : Critical density (kg/m3).
- ρl : Liquid Density (kg/m3).
- Inp : Non-polar retention indices.
- I : Polar retention indices.
- ΔfusS : Entropy of fusion at a given temperature (J/mol×K).
- S°gas : Molar entropy at standard conditions (J/mol×K).
- S°liquid : Liquid phase molar entropy at standard conditions (J/mol×K).
- Tboil : Normal Boiling Point Temperature (K).
- Tc : Critical Temperature (K).
- Tfus : Normal melting (fusion) point (K).
- Ttriple : Triple Point Temperature (K).
- Vc : Critical Volume (m3/kmol).
- Zc : Critical Compressibility.
- Zra : Rackett Parameter.
- 1: Molecular weight from the IUPAC atomic weights tables.
Cheméo is a service of Céondo GmbH, since 2007, we provide simulation, modelling and software development services for the industry.
Do not hesitate to contact us for your projects.
Physical Properties
| Property | Value | Unit | Source |
|---|---|---|---|
| ω | 0.1940 | KDB | |
| PAff | [802.10; 805.00] | kJ/mol |
|
| PAff | 802.10 | kJ/mol | NIST |
| PAff | 802.30 ± 4.80 | kJ/mol | NIST |
| PAff | 802.30 ± 4.80 | kJ/mol | NIST |
| PAff | 805.00 ± 6.70 | kJ/mol | NIST |
| Tig | 738.15 | K | KDB |
| AP | 288.050 | K | KDB |
| BasG | [775.60; 776.30] | kJ/mol |
|
| BasG | 775.60 | kJ/mol | NIST |
| BasG | 776.30 ± 2.70 | kJ/mol | NIST |
| BasG | 776.30 ± 2.70 | kJ/mol | NIST |
| ΔcH°gas | [-2722.00; -2699.50] | kJ/mol |
|
| ΔcH°gas | -2699.50 ± 1.00 | kJ/mol | NIST |
| ΔcH°gas | -2722.00 | kJ/mol | NIST |
| μ | 0.50 | debye | KDB |
| LFL | 1.80 | % in Air | KDB |
| UFL | 9.60 | % in Air | KDB |
| Tflash,oc | 197.04 | K | KDB |
| ΔfG° | 58.11 | kJ/mol | KDB |
| Δc,grossH | 2679.27 | kJ/mol | KDB |
| Δc,netH | 2503.204 | kJ/mol | KDB |
| ΔfH°gas | [-17.90; -16.91] | kJ/mol |
|
| ΔfH°gas | -16.91 | kJ/mol | KDB |
| ΔfH°gas | -17.90 ± 1.10 | kJ/mol | NIST |
| ΔfusH° | 3.53 | kJ/mol | Joback Calculated Property |
| ΔvapH° | 20.60 | kJ/mol | NIST |
| IE | [9.17; 9.45] | eV |
|
| IE | 9.22 ± 0.02 | eV | NIST |
| IE | 9.19 | eV | NIST |
| IE | 9.24 ± 0.05 | eV | NIST |
| IE | 9.24 ± 0.02 | eV | NIST |
| IE | 9.24 ± 0.00 | eV | NIST |
| IE | 9.19 | eV | NIST |
| IE | 9.21 | eV | NIST |
| IE | 9.17 | eV | NIST |
| IE | 9.23 ± 0.02 | eV | NIST |
| IE | 9.23 | eV | NIST |
| IE | 9.41 | eV | NIST |
| IE | 9.39 | eV | NIST |
| IE | Outlier 9.45 | eV | NIST |
| log10WS | [-2.33; -2.33] |
|
|
| log10WS | -2.33 | Aq. Sol... | |
| log10WS | -2.33 | Estimat... | |
| logPoct/wat | 1.582 | Crippen Calculated Property | |
| McVol | 62.920 | ml/mol | McGowan Calculated Property |
| Pc | [4000.00; 4009.80] | kPa |
|
| Pc | 4000.00 | kPa | KDB |
| Pc | 4009.80 | kPa | Thermod... |
| Pc | 4000.00 ± 10.00 | kPa | NIST |
| Pc | 4000.31 ± 10.13 | kPa | NIST |
| ρc | [233.96; 235.09] | kg/m3 |
|
| ρc | 235.09 ± 0.56 | kg/m3 | NIST |
| ρc | 233.96 ± 2.81 | kg/m3 | NIST |
| Inp | [370.00; 400.00] |
|
|
| Inp | 394.00 | NIST | |
| Inp | 391.00 | NIST | |
| Inp | 389.00 | NIST | |
| Inp | 390.00 | NIST | |
| Inp | 390.00 | NIST | |
| Inp | 390.00 | NIST | |
| Inp | 380.00 | NIST | |
| Inp | 383.00 | NIST | |
| Inp | 383.00 | NIST | |
| Inp | 383.00 | NIST | |
| Inp | 384.00 | NIST | |
| Inp | 390.00 | NIST | |
| Inp | 382.00 | NIST | |
| Inp | 392.00 | NIST | |
| Inp | 391.00 | NIST | |
| Inp | 384.00 | NIST | |
| Inp | 383.00 | NIST | |
| Inp | Outlier 400.00 | NIST | |
| Inp | 385.00 | NIST | |
| Inp | Outlier 370.00 | NIST | |
| Inp | 388.00 | NIST | |
| Inp | 386.00 | NIST | |
| Inp | 384.00 | NIST | |
| Inp | 390.00 | NIST | |
| Inp | 383.00 | NIST | |
| Inp | 387.00 | NIST | |
| Inp | 388.00 | NIST | |
| Inp | 390.00 | NIST | |
| Inp | 390.00 | NIST | |
| Inp | 383.00 | NIST | |
| I | [427.00; 438.00] |
|
|
| I | 438.00 | NIST | |
| I | 427.00 | NIST | |
| S°gas | 293.59 | J/mol×K | NIST |
| S°liquid | 194.00 | J/mol×K | NIST |
| Tboil | [266.20; 269.15] | K |
|
| Tboil | 266.20 | K | KDB |
| Tboil | 266.26 | K | NIST |
| Tboil | 266.30 | K | NIST |
| Tboil | 268.15 ± 1.50 | K | NIST |
| Tboil | 267.15 ± 1.50 | K | NIST |
| Tboil | Outlier 268.65 ± 1.50 | K | NIST |
| Tboil | 266.40 ± 0.50 | K | NIST |
| Tboil | 267.15 ± 1.00 | K | NIST |
| Tboil | 267.15 ± 1.00 | K | NIST |
| Tboil | 266.55 ± 0.70 | K | NIST |
| Tboil | 266.35 ± 0.50 | K | NIST |
| Tboil | 266.65 ± 2.00 | K | NIST |
| Tboil | 266.26 ± 0.55 | K | NIST |
| Tboil | 266.55 ± 0.30 | K | NIST |
| Tboil | 266.22 ± 0.20 | K | NIST |
| Tboil | 267.15 ± 2.00 | K | NIST |
| Tboil | 267.15 ± 2.00 | K | NIST |
| Tboil | 266.55 ± 1.00 | K | NIST |
| Tboil | 266.45 ± 0.50 | K | NIST |
| Tboil | 267.15 ± 2.00 | K | NIST |
| Tboil | 266.85 ± 1.00 | K | NIST |
| Tboil | 266.20 ± 0.50 | K | NIST |
| Tboil | 267.15 ± 1.50 | K | NIST |
| Tboil | 266.35 ± 0.20 | K | NIST |
| Tboil | 266.55 ± 0.50 | K | NIST |
| Tboil | 266.55 ± 2.00 | K | NIST |
| Tboil | 267.15 ± 2.00 | K | NIST |
| Tboil | Outlier 269.15 ± 2.00 | K | NIST |
| Tboil | 267.15 ± 2.00 | K | NIST |
| Tc | [417.88; 420.15] | K |
|
| Tc | 417.90 | K | KDB |
| Tc | 417.90 ± 0.10 | K | NIST |
| Tc | 417.88 ± 0.10 | K | NIST |
| Tc | 420.15 ± 2.00 | K | NIST |
| Tfus | [125.40; 132.95] | K |
|
| Tfus | 132.70 | K | KDB |
| Tfus | 132.95 | K | Aq. Sol... |
| Tfus | 132.38 | K | NIST |
| Tfus | 132.45 ± 0.30 | K | NIST |
| Tfus | 125.40 ± 0.50 | K | NIST |
| Ttriple | 132.40 ± 0.20 | K | NIST |
| Vc | [0.239; 0.239] | m3/kmol |
|
| Vc | 0.239 | m3/kmol | KDB |
| Vc | 0.239 | m3/kmol | NIST |
| Zc | 0.2751370 | KDB | |
| Zra | 0.27 | KDB |
Temperature Dependent Properties
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Cp,gas | [75.86; 100.25] | J/mol×K | [239.15; 353.15] |
|
| Cp,gas | 75.86 ± 0.38 | J/mol×K | 239.15 | NIST |
| Cp,gas | 82.89 ± 0.41 | J/mol×K | 272.15 | NIST |
| Cp,gas | 91.67 ± 0.46 | J/mol×K | 312.15 | NIST |
| Cp,gas | 100.25 ± 0.50 | J/mol×K | 353.15 | NIST |
| Cp,liquid | [121.30; 121.42] | J/mol×K | [253.10; 266.26] |
|
| Cp,liquid | 121.42 | J/mol×K | 253.10 | NIST |
| Cp,liquid | 121.30 | J/mol×K | 266.26 | NIST |
| ΔfusH | [5.92; 5.92] | kJ/mol | [132.40; 132.40] |
|
| ΔfusH | 5.92 | kJ/mol | 132.40 | NIST |
| ΔfusH | 5.92 | kJ/mol | 132.40 | NIST |
| ΔfusH | 5.92 | kJ/mol | 132.40 | NIST |
| ΔvapH | [22.12; 23.10] | kJ/mol | [244.50; 394.50] |
|
| ΔvapH | 22.80 | kJ/mol | 244.50 | NIST |
| ΔvapH | 23.10 | kJ/mol | 245.50 | NIST |
| ΔvapH | 22.12 | kJ/mol | 266.30 | KDB |
| ΔvapH | 22.70 | kJ/mol | 289.50 | NIST |
| ΔvapH | 22.20 | kJ/mol | 343.00 | NIST |
| ΔvapH | 22.20 | kJ/mol | 350.50 | NIST |
| ΔvapH | 22.30 | kJ/mol | 394.50 | NIST |
| Pvap | [133.00; 1546.60] | kPa | [273.15; 364.52] |
|
| Pvap | 133.00 | kPa | 273.15 | (Vapour... |
| Pvap | 133.00 | kPa | 273.15 | Vapor l... |
| Pvap | 223.00 | kPa | 288.15 | Vapor-L... |
| Pvap | 224.00 | kPa | 288.15 | Vapor l... |
| Pvap | 224.00 | kPa | 288.15 | (Vapour... |
| Pvap | 353.00 | kPa | 303.15 | Vapor l... |
| Pvap | 352.00 | kPa | 303.15 | Vapor-L... |
| Pvap | 353.00 | kPa | 303.15 | (Vapour... |
| Pvap | 413.70 | kPa | 308.13 | Vapor-L... |
| Pvap | 467.10 | kPa | 312.59 | Phase e... |
| Pvap | 466.10 | kPa | 312.59 | Vapour ... |
| Pvap | 465.30 | kPa | 312.60 | Isother... |
| Pvap | 536.00 | kPa | 318.15 | Vapor-L... |
| Pvap | 538.00 | kPa | 318.15 | (Vapour... |
| Pvap | 538.00 | kPa | 318.15 | Vapor l... |
| Pvap | 542.10 | kPa | 318.35 | Vapor-L... |
| Pvap | 538.15 | kPa | 318.40 | Vapour ... |
| Pvap | 605.14 | kPa | 322.79 | Isother... |
| Pvap | 607.94 | kPa | 323.07 | Vapor-L... |
| Pvap | 608.94 | kPa | 323.11 | Isother... |
| Pvap | 608.84 | kPa | 323.14 | Isother... |
| Pvap | 609.14 | kPa | 323.14 | Isother... |
| Pvap | 611.04 | kPa | 323.15 | Isother... |
| Pvap | 787.00 | kPa | 333.15 | Vapor l... |
| Pvap | 785.00 | kPa | 333.15 | Vapor-L... |
| Pvap | 787.00 | kPa | 333.15 | (Vapour... |
| Pvap | 855.50 | kPa | 336.84 | Vapor-L... |
| Pvap | 1054.90 | kPa | 346.14 | Vapor-L... |
| Pvap | 1107.00 | kPa | 348.15 | Vapor-L... |
| Pvap | 1110.00 | kPa | 348.15 | Vapor l... |
| Pvap | 1110.00 | kPa | 348.15 | (Vapour... |
| Pvap | 1154.30 | kPa | 350.43 | Vapor-L... |
| Pvap | 1515.00 | kPa | 363.15 | Vapor-L... |
| Pvap | 1546.00 | kPa | 364.49 | Isother... |
| Pvap | 1546.50 | kPa | 364.51 | Isother... |
| Pvap | 1546.60 | kPa | 364.51 | Isother... |
| Pvap | 1546.20 | kPa | 364.51 | Vapor L... |
| Pvap | 1546.30 | kPa | 364.52 | Isother... |
| ρl | 594.00 | kg/m3 | 293.00 | KDB |
| ΔfusS | 44.71 | J/mol×K | 132.40 | NIST |
Correlations
| Property | Value | Unit | Temperature (K) | Source |
|---|---|---|---|---|
| Pvap | [1.33; 202.66] | kPa | [191.15; 285.02] |
The Yaw...
|
| Equation | ln(Pvp) = A + B/(T + C) | |||
| Coefficient A | 1.40957e+01 | |||
| Coefficient B | -2.26626e+03 | |||
| Coefficient C | -2.70260e+01 | |||
| Temperature range, min. | 191.15 | |||
| Temperature range, max. | 285.02 | |||
| Pvap | 1.33 | kPa | 191.15 | Calculated Property |
| Pvap | 3.04 | kPa | 201.58 | Calculated Property |
| Pvap | 6.33 | kPa | 212.01 | Calculated Property |
| Pvap | 12.16 | kPa | 222.44 | Calculated Property |
| Pvap | 21.89 | kPa | 232.87 | Calculated Property |
| Pvap | 37.23 | kPa | 243.30 | Calculated Property |
| Pvap | 60.29 | kPa | 253.73 | Calculated Property |
| Pvap | 93.58 | kPa | 264.16 | Calculated Property |
| Pvap | 139.97 | kPa | 274.59 | Calculated Property |
| Pvap | 202.66 | kPa | 285.02 | Calculated Property |
| Pvap | [6.66e-04; 4013.56] | kPa | [132.81; 417.90] |
KDB Vap...
|
| Equation | ln(Pvp) = A + B/T + C*ln(T) + D*T^2 | |||
| Coefficient A | 6.75294e+01 | |||
| Coefficient B | -4.53316e+03 | |||
| Coefficient C | -8.37142e+00 | |||
| Coefficient D | 1.22482e-05 | |||
| Temperature range, min. | 132.81 | |||
| Temperature range, max. | 417.90 | |||
| Pvap | 6.66e-04 | kPa | 132.81 | Calculated Property |
| Pvap | 0.09 | kPa | 164.49 | Calculated Property |
| Pvap | 2.01 | kPa | 196.16 | Calculated Property |
| Pvap | 16.84 | kPa | 227.84 | Calculated Property |
| Pvap | 77.59 | kPa | 259.52 | Calculated Property |
| Pvap | 244.97 | kPa | 291.19 | Calculated Property |
| Pvap | 603.20 | kPa | 322.87 | Calculated Property |
| Pvap | 1256.40 | kPa | 354.55 | Calculated Property |
| Pvap | 2334.76 | kPa | 386.22 | Calculated Property |
| Pvap | 4013.56 | kPa | 417.90 | Calculated Property |
Similar Compounds
Find more compounds similar to 1-Propene, 2-methyl-.
Mixtures
- 1-Propene, 2-methyl- + Ethyl Acetate
- Dimethyl sulfide + 1-Propene, 2-methyl-
- 1-Propene, 2-methyl- + Ethane, 1,1-difluoro-
- 1-Propene, 2-methyl- + Diethyl sulfide
- 1-Propene, 2-methyl- + Propanenitrile
- Ethane, 1,1,1-trifluoro- + 1-Propene, 2-methyl-
- 1-Propene, 2-methyl- + Methyl Alcohol
- 1-Propene, 2-methyl- + Ethanol
- Isopropyl Alcohol + 1-Propene, 2-methyl-
- 2-Propanol, 2-methyl- + 1-Propene, 2-methyl-
- 1-Propanol + 1-Propene, 2-methyl-
- 1-Propene, 2-methyl- + Acetone
- 1-Propene, 2-methyl- + Thiophene
- 1-Propene, 2-methyl- + Disulfide, dimethyl
- 1-Propene, 2-methyl- + Tetrahydropyran
- 1-Propene, 2-methyl- + Thiophene, tetrahydro-
- 1-Propene, 2-methyl- + 1-Propanol, 2-methyl-
- 1-Propene, 2-methyl- + 1-Pentanol
- 1-Propene, 2-methyl- + 2-Pentanol
- 1-Propene, 2-methyl- + 3-Pentanol
Find more mixtures with 1-Propene, 2-methyl-.
Sources
- KDB Vapor Pressure Data
- Crippen Method
- Thermodynamic properties of the butenes Part I. Experimental densities, vapor pressures, and critical points
- Vapour liquid equilibrium for the ethyl ethanoate + 1-butene, +cis-2-butene, +trans-2-butene, +2-methylpropene, +n-butane and +2-methylpropane
- Henry s law constants of 1-butene, 2-methylpropene, trans-2-butene, and 1,3-butadiene in methanol at 374 490K
- Isothermal binary vapour liquid equilibrium for butanes and butenes with dimethylsulphide
- Vapor liquid equilibria of the 1,1-difluoroethane (HFC-152a) + isobutene system
- Vapour liquid equilibrium for the systems diethyl sulphide + 1-butene, +cis-2-butene, +2-methylpropane, +2-methylpropene, +n-butane, +trans-2-butene
- Phase equilibrium measurements for systems containing propanenitrile with tert-butyl ethyl ether and C4-hydrocarbons
- Henry's constants and infinite dilution activity coefficients of propane, propene, butane, isobutene, 1-butene, isobutane, trans-2-butene and 1,3-butadiene in 1-propanol at T=(260 to 340) K
- Henry's constants and infinite dilution activity coefficients of propane, propene, butane, isobutane, 1-butene, isobutene, trans-2-butene, and 1,3-butadiene in isobutanol and tert-butanol
- Henry's constants and infinite dilution activity coefficients of propane, propene, butane, isobutane, 1-butene, isobutene, trans-2-butene, and 1,3-butadiene in 1-pentanol, 2-pentanol and 3-pentanol
- (Vapour + liquid) equilibria of the {1,1,1-trifluoroethane (HFC-143a) + isobutene} system
- Thermodynamic Analysis of the Experimental Equilibria for the Liquid-Phase Etherification of Isobutene with C1 to C4 Linear Primary Alcohols
- Isothermal Vapor Liquid Equilibrium for Binary 2-Methylpropene - C1-C4 Alcohol-Systems
- Henry's Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, Isobutane, 1-Butene, Isobutene, trans-2-Butene, and 1,3-butadiene in 2-propanol at 250-330 K
- Henry's Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, Isobutane, 1-Butene, Isobutene, trans-2-Butene and 1,3-Butadiene in 1-Butanol and 2-Butanol at (250 to 330) K
- Henry's law constants and infinite dilution activity coefficients of propane, propene, butane, isobutane, 1-butene, isobutene, trans-2-butene, and 1,3-butadiene in 2-methyl-1-butanol, 3-methyl-1-butanol, and 2-methyl-2-butanol
- Vapor-Liquid Equilibrium for 1-Propanol + 1-Butene, + cis-2-Butene, + 2-Methyl-propene, + trans-2-Butene, + n-Butane, and + 2-Methyl-propane
- Henry's Law Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, 2-Methylpropane, 1-Butene, 2-Methylpropene, trans-2-Butene, cis-2-Butene, 1,3-Butadiene, Dimethyl Ether, Chloroethane, and 1,1-Difluoroethane in 2-Propen-1-ol
- Henry s Law Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, 2-Methylpropane, 1-Butene, 2-Methylpropene, trans-2-Butene, cis-2-Butene, 1,3-Butadiene, Dimethyl Ether, Chloroethane, and 1,1-Difluoroethane in 2-Methyl-3-buten-2-ol and 3-Methyl-3-buten-1-ol
- Vapor Liquid Equilibrium for Six Binary Systems of C4-Hydrocarbons + 2-Propanone
- Isothermal Vapor Liquid Equilibrium for 2-Methylpropene + Methanol, + 1-Propanol, + 2-Propanol, + 2-Butanol, and + 2-Methyl-2-propanol Binary Systems at 364.5 K
- Henry's Law Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, 2-Methylpropane, 1-Butene, 2-Methylpropene, trans-2-Butene, cis-2-Butene, 1,3-Butadiene, Dimethyl Ether, Chloroethane, and 1,1-Difluoroethane in Benzene, Toluene, o-Xylene, m-Xylene, p-Xylene, and Styrene
- Henry's Law Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, 2-Methylpropane, 1-Butene, 2-Methylpropene, trans-2-Butene, cis-2-Butene, 1,3-Butadiene, Dimethyl Ether, Chloroethane, and 1,1-Difluoroethane in 2-Methylphenol, 3-Methylphenol, and 4-Methylphenol
- Vapor-Liquid Equilibrium for Thiophene + Butane, + trans-But-2-ene, + 2-Methylpropane, and + 2-Methylpropene
- Vapor-Liquid Equilibrium for Dimethyl Disulfide + Butane, + trans-But-2-ene, + 2-Methylpropane, + 2-Methylpropene, + Ethanol, and 2-Ethoxy-2-methylpropane
- Henry s Law Constants and Infinite Dilution Activity Coefficients of Propane, Propene, Butane, 2-Methylpropane, 1-Butene, 2-Methylpropene, trans-2-Butene, cis-2-Butene, 1,3-Butadiene, Dimethylether, Chloroethane, 1,1-Difluoroethane, and Hexane in Tetrahydropyran
- Vapor-Liquid Equilibria of the 1,1,1,2,3,3,3-Heptafluoropropane + Isobutene System
- Vapor-Liquid Equilibrium for Tetrahydrothiophene + n-Butane, + trans-2-Butene, + 2-Methylpropane, and + 2-Methylpropene
- Joback Method
- KDB
- Aqueous Solubility Prediction Method
- Estimated Solubility Method
- McGowan Method
- NIST Webbook
- The Yaws Handbook of Vapor Pressure
Note: Cheméo is only indexing the data, follow the source links to retrieve the latest data. The source is also providing more information like the publication year, authors and more.
Take the time to validate and double check the source of the data.
Outlier This icon means
that the value is more than 2 standard deviations away from the
property mean.